![]() |
Name |
Dichlorodiaportin
|
Molecular Formula | C13H12Cl2O5 | |
IUPAC Name* |
3-[(2R)-3,3-dichloro-2-hydroxypropyl]-8-hydroxy-6-methoxyisochromen-1-one
|
|
SMILES |
COC1=CC(=C2C(=C1)C=C(OC2=O)C[C@H](C(Cl)Cl)O)O
|
|
InChI |
InChI=1S/C13H12Cl2O5/c1-19-7-2-6-3-8(5-10(17)12(14)15)20-13(18)11(6)9(16)4-7/h2-4,10,12,16-17H,5H2,1H3/t10-/m1/s1
|
|
InChIKey |
RCUFLECOBNVNRE-SNVBAGLBSA-N
|
|
Synonyms |
Dichlorodiaportin; CHEMBL4165254; ZINC67910584
|
|
CAS | NA | |
PubChem CID | 5324333 | |
ChEMBL ID | CHEMBL4165254 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 319.13 | ALogp: | 3.1 |
HBD: | 2 | HBA: | 5 |
Rotatable Bonds: | 4 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 76.0 | Aromatic Rings: | 2 |
Heavy Atoms: | 20 | QED Weighted: | 0.847 |
Caco-2 Permeability: | -4.819 | MDCK Permeability: | 0.00004330 |
Pgp-inhibitor: | 0.002 | Pgp-substrate: | 0.757 |
Human Intestinal Absorption (HIA): | 0.016 | 20% Bioavailability (F20%): | 0.003 |
30% Bioavailability (F30%): | 0.151 |
Blood-Brain-Barrier Penetration (BBB): | 0.071 | Plasma Protein Binding (PPB): | 94.76% |
Volume Distribution (VD): | 0.763 | Fu: | 4.64% |
CYP1A2-inhibitor: | 0.957 | CYP1A2-substrate: | 0.892 |
CYP2C19-inhibitor: | 0.059 | CYP2C19-substrate: | 0.822 |
CYP2C9-inhibitor: | 0.19 | CYP2C9-substrate: | 0.941 |
CYP2D6-inhibitor: | 0.062 | CYP2D6-substrate: | 0.631 |
CYP3A4-inhibitor: | 0.058 | CYP3A4-substrate: | 0.365 |
Clearance (CL): | 5.421 | Half-life (T1/2): | 0.604 |
hERG Blockers: | 0.035 | Human Hepatotoxicity (H-HT): | 0.397 |
Drug-inuced Liver Injury (DILI): | 0.204 | AMES Toxicity: | 0.141 |
Rat Oral Acute Toxicity: | 0.103 | Maximum Recommended Daily Dose: | 0.661 |
Skin Sensitization: | 0.464 | Carcinogencity: | 0.353 |
Eye Corrosion: | 0.018 | Eye Irritation: | 0.493 |
Respiratory Toxicity: | 0.892 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC002509 | ![]() |
0.750 | D06GCK | ![]() |
0.255 | ||
ENC005211 | ![]() |
0.746 | D0Q1IT | ![]() |
0.253 | ||
ENC001632 | ![]() |
0.746 | D0D1DI | ![]() |
0.253 | ||
ENC002072 | ![]() |
0.710 | D04KJO | ![]() |
0.253 | ||
ENC004994 | ![]() |
0.667 | D07MGA | ![]() |
0.250 | ||
ENC005212 | ![]() |
0.667 | D0DJ1B | ![]() |
0.247 | ||
ENC003881 | ![]() |
0.584 | D04UTT | ![]() |
0.245 | ||
ENC005210 | ![]() |
0.584 | D04AIT | ![]() |
0.244 | ||
ENC002113 | ![]() |
0.583 | D0K8KX | ![]() |
0.239 | ||
ENC001569 | ![]() |
0.563 | D0U0OT | ![]() |
0.237 |