![]() |
Name |
Tiglic aldehyde
|
Molecular Formula | C5H8O | |
IUPAC Name* |
(E)-2-methylbut-2-enal
|
|
SMILES |
C/C=C(\C)/C=O
|
|
InChI |
InChI=1S/C5H8O/c1-3-5(2)4-6/h3-4H,1-2H3/b5-3+
|
|
InChIKey |
ACWQBUSCFPJUPN-HWKANZROSA-N
|
|
Synonyms |
Tiglic aldehyde; trans-2-Methyl-2-butenal; 497-03-0; Tiglaldehyde; (E)-2-Methylbut-2-enal; 2-methylbut-2-enal; 1115-11-3; Tiglinaldehyde; E-2-Methyl-2-butenal; 2-Butenal, 2-methyl-, (2E)-; 2,3-Dimethylacrolein; 2-Methylcrotonaldehyde; 2-Butenal, 2-methyl-, (E)-; trans-Tiglaldehyde; 2-Butenal, 2-methyl-; trans-2,3-Dimethylacrolein; 2-METHYL-2-BUTENAL; Crotonaldehyde, 2-methyl-, (E)-; FEMA No. 3407; (e)-2-methyl-2-butenal; Tiglic acid aldehyde; trans-Methyl-2-butenal; (2E)-2-methylbut-2-enal; 27ZVE2K81C; NSC-2179; NSC 2179; 2-methyl-(E)-2-butenal; trans-2-Methylcrotonaldehyde; Tigaldehyde, trans-; 2-Methyl-2-butenal, trans-; 2-Methylcrotonaldehyde, (E)-; 2-Methyl-2-butenal, (E)-; 2-Butenal,2-methyl-(Z)-; 2-Methylbut-2-en-1-al, (E)-; 6038-09-1; EINECS 207-833-0; MFCD00006977; UNII-27ZVE2K81C; AI3-24379; CCRIS 8097; (E)-tiglaldehyde; Tiglic aldehyde, >=96%; trans-2-methyl-but-2-enal; DSSTox_CID_29264; DSSTox_RID_83383; DSSTox_GSID_49308; CHEMBL53493; DTXSID1049308; 2-Butenal,2-methyl-, (Z)-; ACWQBUSCFPJUPN-HWKANZROSA-; NSC2179; ZINC1577193; 2-METHYL-2-BUTENAL [FHFI]; Tox21_202837; AKOS015912688; NCGC00260383-01; CAS-497-03-0; T1003; trans-2-Methyl-2-butenal, analytical standard; D92433; EN300-109078; EN300-304066; Q3045687; trans-2-Methyl-2-butenal, sum of isomers, >=99%, FG
|
|
CAS | 497-03-0 | |
PubChem CID | 5321950 | |
ChEMBL ID | CHEMBL53493 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 84.12 | ALogp: | 0.9 |
HBD: | 0 | HBA: | 1 |
Rotatable Bonds: | 1 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 17.1 | Aromatic Rings: | 0 |
Heavy Atoms: | 6 | QED Weighted: | 0.348 |
Caco-2 Permeability: | -4.249 | MDCK Permeability: | 0.00003490 |
Pgp-inhibitor: | 0 | Pgp-substrate: | 0.004 |
Human Intestinal Absorption (HIA): | 0.005 | 20% Bioavailability (F20%): | 0.002 |
30% Bioavailability (F30%): | 0.002 |
Blood-Brain-Barrier Penetration (BBB): | 0.996 | Plasma Protein Binding (PPB): | 49.07% |
Volume Distribution (VD): | 1.297 | Fu: | 48.52% |
CYP1A2-inhibitor: | 0.673 | CYP1A2-substrate: | 0.897 |
CYP2C19-inhibitor: | 0.157 | CYP2C19-substrate: | 0.866 |
CYP2C9-inhibitor: | 0.016 | CYP2C9-substrate: | 0.901 |
CYP2D6-inhibitor: | 0.012 | CYP2D6-substrate: | 0.752 |
CYP3A4-inhibitor: | 0.009 | CYP3A4-substrate: | 0.216 |
Clearance (CL): | 7.863 | Half-life (T1/2): | 0.822 |
hERG Blockers: | 0.008 | Human Hepatotoxicity (H-HT): | 0.027 |
Drug-inuced Liver Injury (DILI): | 0.031 | AMES Toxicity: | 0.791 |
Rat Oral Acute Toxicity: | 0.035 | Maximum Recommended Daily Dose: | 0.161 |
Skin Sensitization: | 0.577 | Carcinogencity: | 0.167 |
Eye Corrosion: | 0.993 | Eye Irritation: | 0.995 |
Respiratory Toxicity: | 0.916 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC000879 | ![]() |
0.333 | D04CRL | ![]() |
0.211 | ||
ENC001740 | ![]() |
0.333 | D0C1PY | ![]() |
0.200 | ||
ENC001732 | ![]() |
0.323 | D0Z4UY | ![]() |
0.200 | ||
ENC001839 | ![]() |
0.303 | D0H6VY | ![]() |
0.186 | ||
ENC001556 | ![]() |
0.267 | D0F1GS | ![]() |
0.185 | ||
ENC002437 | ![]() |
0.258 | D0Z4NI | ![]() |
0.185 | ||
ENC000847 | ![]() |
0.250 | D0R9BG | ![]() |
0.182 | ||
ENC005021 | ![]() |
0.245 | D0A7MY | ![]() |
0.171 | ||
ENC001718 | ![]() |
0.242 | D0G4JI | ![]() |
0.167 | ||
ENC000415 | ![]() |
0.241 | D0ZK8H | ![]() |
0.167 |