![]() |
Name |
Ophiobolin A
|
Molecular Formula | C25H36O4 | |
IUPAC Name* |
(1'R,2S,3S,3'S,4'R,5R,7'S,8'E,11'R)-4'-hydroxy-1',3,4'-trimethyl-5-(2-methylprop-1-enyl)-6'-oxospiro[oxolane-2,12'-tricyclo[9.3.0.03,7]tetradec-8-ene]-8'-carbaldehyde
|
|
SMILES |
C[C@H]1C[C@@H](O[C@@]12CC[C@]3([C@H]2C/C=C(\[C@@H]4[C@H](C3)[C@](CC4=O)(C)O)/C=O)C)C=C(C)C
|
|
InChI |
InChI=1S/C25H36O4/c1-15(2)10-18-11-16(3)25(29-18)9-8-23(4)12-19-22(20(27)13-24(19,5)28)17(14-26)6-7-21(23)25/h6,10,14,16,18-19,21-22,28H,7-9,11-13H2,1-5H3/b17-6-/t16-,18-,19-,21+,22+,23+,24+,25-/m0/s1
|
|
InChIKey |
MWYYLZRWWNBROW-BDZRSQQBSA-N
|
|
Synonyms |
Ophiobolin A; Cochliobolin A; 4611-05-6; Cochliobolin; Ophiobolin; CHEBI:7777; (1'R,2S,3S,3'S,4'R,5R,7'S,8'E,11'R)-4'-hydroxy-1',3,4'-trimethyl-5-(2-methylprop-1-enyl)-6'-oxospiro[oxolane-2,12'-tricyclo[9.3.0.03,7]tetradec-8-ene]-8'-carbaldehyde; NSC-114340; NSC 114340; CHEMBL522808; SCHEMBL1959293; DTXSID301017596; Ophiobolin A, >=95% (HPLC); HY-N6781; HB0474; Ophiobola-7,19-dien-25-al, 14,18-epoxy-3-hydroxy-5-oxo-, (18R)-; LMPR0105050001; Spiro(dicyclopenta(a,d)cyclooctene-3(2H),2'(3'H)-furan)-6-carboxaldehyde, 1,3a,4,4',5',6a,7,8,9a,10,10a-dodecahydro-9-hydroxy-3',9,10a-trimethyl-5'-(2-methyl-1-propenyl)-7-oxo-, (2'S,3'S,3aR,5'R,6aS,9R,9aS,10aR)-; CS-0093830; C09145; Q27107581; (18R)-14,18-epoxy-3-hydroxy-5-oxoophiobola-7,19-dien-25-al; (18R)-3-hydroxy-5-oxo-14,18-epoxyophiobola-7,19-dien-25-al; (2'S,3'S,3aR,5'R,6aS,9R,9aS,10aR)-1,3a,4,4',5',6a,7,8,9,9a,10,10a- dodecahydro-9-hydroxy-3',9,10a-trimethyl-5'-(2-methylpropen-1-yl)-7- oxospiro[dicyclopenta[a,d]cyclooctene-3(2H),2'(3'H)-furan]-6-carbaldehyde
|
|
CAS | 4611-05-6 | |
PubChem CID | 5281387 | |
ChEMBL ID | CHEMBL522808 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 400.5 | ALogp: | 3.5 |
HBD: | 1 | HBA: | 4 |
Rotatable Bonds: | 2 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 63.6 | Aromatic Rings: | 4 |
Heavy Atoms: | 29 | QED Weighted: | 0.527 |
Caco-2 Permeability: | -4.743 | MDCK Permeability: | 0.00002020 |
Pgp-inhibitor: | 0.984 | Pgp-substrate: | 0.018 |
Human Intestinal Absorption (HIA): | 0.025 | 20% Bioavailability (F20%): | 0.333 |
30% Bioavailability (F30%): | 0.295 |
Blood-Brain-Barrier Penetration (BBB): | 0.039 | Plasma Protein Binding (PPB): | 92.46% |
Volume Distribution (VD): | 2.212 | Fu: | 4.06% |
CYP1A2-inhibitor: | 0.053 | CYP1A2-substrate: | 0.572 |
CYP2C19-inhibitor: | 0.538 | CYP2C19-substrate: | 0.74 |
CYP2C9-inhibitor: | 0.343 | CYP2C9-substrate: | 0.059 |
CYP2D6-inhibitor: | 0.09 | CYP2D6-substrate: | 0.064 |
CYP3A4-inhibitor: | 0.802 | CYP3A4-substrate: | 0.478 |
Clearance (CL): | 5.361 | Half-life (T1/2): | 0.112 |
hERG Blockers: | 0.415 | Human Hepatotoxicity (H-HT): | 0.935 |
Drug-inuced Liver Injury (DILI): | 0.438 | AMES Toxicity: | 0.13 |
Rat Oral Acute Toxicity: | 0.056 | Maximum Recommended Daily Dose: | 0.955 |
Skin Sensitization: | 0.935 | Carcinogencity: | 0.251 |
Eye Corrosion: | 0.034 | Eye Irritation: | 0.111 |
Respiratory Toxicity: | 0.977 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC003209 | ![]() |
0.656 | D0I2SD | ![]() |
0.301 | ||
ENC002271 | ![]() |
0.576 | D04SFH | ![]() |
0.289 | ||
ENC003783 | ![]() |
0.535 | D06AEO | ![]() |
0.271 | ||
ENC002000 | ![]() |
0.535 | D0P0HT | ![]() |
0.269 | ||
ENC004222 | ![]() |
0.486 | D04GJN | ![]() |
0.267 | ||
ENC003687 | ![]() |
0.446 | D0D2TN | ![]() |
0.267 | ||
ENC003251 | ![]() |
0.354 | D0I5DS | ![]() |
0.256 | ||
ENC002983 | ![]() |
0.350 | D08PIQ | ![]() |
0.256 | ||
ENC002982 | ![]() |
0.345 | D0B4RU | ![]() |
0.254 | ||
ENC005882 | ![]() |
0.318 | D0X4RS | ![]() |
0.254 |