NPs Basic Information
|
Name |
Ophiobolin A
|
| Molecular Formula | C25H36O4 | |
| IUPAC Name* |
(1'R,2S,3S,3'S,4'R,5R,7'S,8'E,11'R)-4'-hydroxy-1',3,4'-trimethyl-5-(2-methylprop-1-enyl)-6'-oxospiro[oxolane-2,12'-tricyclo[9.3.0.03,7]tetradec-8-ene]-8'-carbaldehyde
|
|
| SMILES |
C[C@H]1C[C@@H](O[C@@]12CC[C@]3([C@H]2C/C=C(\[C@@H]4[C@H](C3)[C@](CC4=O)(C)O)/C=O)C)C=C(C)C
|
|
| InChI |
InChI=1S/C25H36O4/c1-15(2)10-18-11-16(3)25(29-18)9-8-23(4)12-19-22(20(27)13-24(19,5)28)17(14-26)6-7-21(23)25/h6,10,14,16,18-19,21-22,28H,7-9,11-13H2,1-5H3/b17-6-/t16-,18-,19-,21+,22+,23+,24+,25-/m0/s1
|
|
| InChIKey |
MWYYLZRWWNBROW-BDZRSQQBSA-N
|
|
| Synonyms |
Ophiobolin A; Cochliobolin A; 4611-05-6; Cochliobolin; Ophiobolin; CHEBI:7777; (1'R,2S,3S,3'S,4'R,5R,7'S,8'E,11'R)-4'-hydroxy-1',3,4'-trimethyl-5-(2-methylprop-1-enyl)-6'-oxospiro[oxolane-2,12'-tricyclo[9.3.0.03,7]tetradec-8-ene]-8'-carbaldehyde; NSC-114340; NSC 114340; CHEMBL522808; SCHEMBL1959293; DTXSID301017596; Ophiobolin A, >=95% (HPLC); HY-N6781; HB0474; Ophiobola-7,19-dien-25-al, 14,18-epoxy-3-hydroxy-5-oxo-, (18R)-; LMPR0105050001; Spiro(dicyclopenta(a,d)cyclooctene-3(2H),2'(3'H)-furan)-6-carboxaldehyde, 1,3a,4,4',5',6a,7,8,9a,10,10a-dodecahydro-9-hydroxy-3',9,10a-trimethyl-5'-(2-methyl-1-propenyl)-7-oxo-, (2'S,3'S,3aR,5'R,6aS,9R,9aS,10aR)-; CS-0093830; C09145; Q27107581; (18R)-14,18-epoxy-3-hydroxy-5-oxoophiobola-7,19-dien-25-al; (18R)-3-hydroxy-5-oxo-14,18-epoxyophiobola-7,19-dien-25-al; (2'S,3'S,3aR,5'R,6aS,9R,9aS,10aR)-1,3a,4,4',5',6a,7,8,9,9a,10,10a- dodecahydro-9-hydroxy-3',9,10a-trimethyl-5'-(2-methylpropen-1-yl)-7- oxospiro[dicyclopenta[a,d]cyclooctene-3(2H),2'(3'H)-furan]-6-carbaldehyde
|
|
| CAS | 4611-05-6 | |
| PubChem CID | 5281387 | |
| ChEMBL ID | CHEMBL522808 |
*Note: the IUPAC Name was collected from PubChem.
Chemical Classification: |
|
|
|---|
——————————————————————————————————————————
NPs Physi-Chem Properties
| Molecular Weight: | 400.5 | ALogp: | 3.5 |
| HBD: | 1 | HBA: | 4 |
| Rotatable Bonds: | 2 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 63.6 | Aromatic Rings: | 4 |
| Heavy Atoms: | 29 | QED Weighted: | 0.527 |
——————————————————————————————————————————
NPs ADMET Properties*
ADMET: Absorption
| Caco-2 Permeability: | -4.743 | MDCK Permeability: | 0.00002020 |
| Pgp-inhibitor: | 0.984 | Pgp-substrate: | 0.018 |
| Human Intestinal Absorption (HIA): | 0.025 | 20% Bioavailability (F20%): | 0.333 |
| 30% Bioavailability (F30%): | 0.295 |
——————————————————————————————————————————
ADMET: Distribution
| Blood-Brain-Barrier Penetration (BBB): | 0.039 | Plasma Protein Binding (PPB): | 92.46% |
| Volume Distribution (VD): | 2.212 | Fu: | 4.06% |
——————————————————————————————————————————
ADMET: Metabolism
| CYP1A2-inhibitor: | 0.053 | CYP1A2-substrate: | 0.572 |
| CYP2C19-inhibitor: | 0.538 | CYP2C19-substrate: | 0.74 |
| CYP2C9-inhibitor: | 0.343 | CYP2C9-substrate: | 0.059 |
| CYP2D6-inhibitor: | 0.09 | CYP2D6-substrate: | 0.064 |
| CYP3A4-inhibitor: | 0.802 | CYP3A4-substrate: | 0.478 |
——————————————————————————————————————————
ADMET: Excretion
| Clearance (CL): | 5.361 | Half-life (T1/2): | 0.112 |
——————————————————————————————————————————
ADMET: Toxicity
| hERG Blockers: | 0.415 | Human Hepatotoxicity (H-HT): | 0.935 |
| Drug-inuced Liver Injury (DILI): | 0.438 | AMES Toxicity: | 0.13 |
| Rat Oral Acute Toxicity: | 0.056 | Maximum Recommended Daily Dose: | 0.955 |
| Skin Sensitization: | 0.935 | Carcinogencity: | 0.251 |
| Eye Corrosion: | 0.034 | Eye Irritation: | 0.111 |
| Respiratory Toxicity: | 0.977 |
——————————————————————————————————————————
*Note: the ADMET properties was calculated by ADMETlab 2.0. Reference: PMID: 33893803.
Similar Compounds*
Compounds similar to EMNPD with top10 similarity:
Showing 1 to 10 of 10 entries