![]() |
Name |
5-bromo-6-chloro-N-(4-hydroxyphenyl)pyridine-3-sulfonamide
|
Molecular Formula | C11H8BrClN2O3S | |
IUPAC Name* |
5-bromo-6-chloro-N-(4-hydroxyphenyl)pyridine-3-sulfonamide
|
|
SMILES |
C1=CC(=CC=C1NS(=O)(=O)C2=CC(=C(N=C2)Cl)Br)O
|
|
InChI |
InChI=1S/C11H8BrClN2O3S/c12-10-5-9(6-14-11(10)13)19(17,18)15-7-1-3-8(16)4-2-7/h1-6,15-16H
|
|
InChIKey |
BRNPVZXTHZDFGV-UHFFFAOYSA-N
|
|
Synonyms |
AKOS002735423
|
|
CAS | NA | |
PubChem CID | 4862055 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 363.62 | ALogp: | 2.7 |
HBD: | 2 | HBA: | 5 |
Rotatable Bonds: | 3 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 87.7 | Aromatic Rings: | 2 |
Heavy Atoms: | 19 | QED Weighted: | 0.642 |
Caco-2 Permeability: | -4.631 | MDCK Permeability: | 0.00002540 |
Pgp-inhibitor: | 0.015 | Pgp-substrate: | 0 |
Human Intestinal Absorption (HIA): | 0.008 | 20% Bioavailability (F20%): | 0.001 |
30% Bioavailability (F30%): | 0.005 |
Blood-Brain-Barrier Penetration (BBB): | 0.027 | Plasma Protein Binding (PPB): | 97.14% |
Volume Distribution (VD): | 0.347 | Fu: | 2.99% |
CYP1A2-inhibitor: | 0.602 | CYP1A2-substrate: | 0.136 |
CYP2C19-inhibitor: | 0.881 | CYP2C19-substrate: | 0.32 |
CYP2C9-inhibitor: | 0.853 | CYP2C9-substrate: | 0.94 |
CYP2D6-inhibitor: | 0.649 | CYP2D6-substrate: | 0.137 |
CYP3A4-inhibitor: | 0.541 | CYP3A4-substrate: | 0.724 |
Clearance (CL): | 0.487 | Half-life (T1/2): | 0.254 |
hERG Blockers: | 0.047 | Human Hepatotoxicity (H-HT): | 0.273 |
Drug-inuced Liver Injury (DILI): | 0.984 | AMES Toxicity: | 0.006 |
Rat Oral Acute Toxicity: | 0.2 | Maximum Recommended Daily Dose: | 0.657 |
Skin Sensitization: | 0.168 | Carcinogencity: | 0.372 |
Eye Corrosion: | 0.005 | Eye Irritation: | 0.06 |
Respiratory Toxicity: | 0.033 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC000072 | ![]() |
0.344 | D07SYJ | ![]() |
0.346 | ||
ENC000112 | ![]() |
0.342 | D0U5QK | ![]() |
0.344 | ||
ENC000109 | ![]() |
0.333 | D0H1GJ | ![]() |
0.342 | ||
ENC000113 | ![]() |
0.333 | D0R9OH | ![]() |
0.338 | ||
ENC000114 | ![]() |
0.313 | D05LKP | ![]() |
0.333 | ||
ENC005996 | ![]() |
0.284 | D0D4CY | ![]() |
0.333 | ||
ENC001562 | ![]() |
0.284 | D0V9YR | ![]() |
0.333 | ||
ENC000005 | ![]() |
0.283 | D09TBD | ![]() |
0.312 | ||
ENC001097 | ![]() |
0.282 | D07PAO | ![]() |
0.310 | ||
ENC002499 | ![]() |
0.280 | D0T1GT | ![]() |
0.305 |