![]() |
Name |
1(2H)-Naphthalenone, 3,4-dihydro-3,6,8-trihydroxy-, (3R)-
|
Molecular Formula | C10H10O4 | |
IUPAC Name* |
3,6,8-trihydroxy-3,4-dihydro-2H-naphthalen-1-one
|
|
SMILES |
C1C(CC(=O)C2=C1C=C(C=C2O)O)O
|
|
InChI |
InChI=1S/C10H10O4/c11-6-1-5-2-7(12)4-9(14)10(5)8(13)3-6/h1,3,7,11-13H,2,4H2
|
|
InChIKey |
RTWVXIIKUFSDJB-UHFFFAOYSA-N
|
|
Synonyms |
Scytalone; 49598-85-8; 1(2H)-Naphthalenone, 3,4-dihydro-3,6,8-trihydroxy-, (3R)-; 3,6,8-trihydroxy-3,4-dihydronaphthalen-1(2H)-one; 3,6,8-trihydroxytetralone; 3,6,8-trihydroxy-3,4-dihydro-2H-naphthalen-1-one; SCHEMBL2025113; CHEBI:16945; 3,6,8-Trihydroxytetralin-1-one; AKOS006272782; SB47735; 3,4-dihydro-3,6,8-trihydroxy-1(2H)-naphthalenone; Q27102146; 3,6,8-trihydroxy-1,2,3,4-tetrahydronaphthalen-1-one
|
|
CAS | NA | |
PubChem CID | 3477029 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 194.18 | ALogp: | 0.9 |
HBD: | 3 | HBA: | 4 |
Rotatable Bonds: | 0 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 77.8 | Aromatic Rings: | 2 |
Heavy Atoms: | 14 | QED Weighted: | 0.575 |
Caco-2 Permeability: | -4.917 | MDCK Permeability: | 0.00000631 |
Pgp-inhibitor: | 0.002 | Pgp-substrate: | 0.385 |
Human Intestinal Absorption (HIA): | 0.107 | 20% Bioavailability (F20%): | 0.995 |
30% Bioavailability (F30%): | 0.998 |
Blood-Brain-Barrier Penetration (BBB): | 0.309 | Plasma Protein Binding (PPB): | 48.79% |
Volume Distribution (VD): | 0.909 | Fu: | 54.91% |
CYP1A2-inhibitor: | 0.624 | CYP1A2-substrate: | 0.183 |
CYP2C19-inhibitor: | 0.061 | CYP2C19-substrate: | 0.066 |
CYP2C9-inhibitor: | 0.052 | CYP2C9-substrate: | 0.72 |
CYP2D6-inhibitor: | 0.093 | CYP2D6-substrate: | 0.252 |
CYP3A4-inhibitor: | 0.137 | CYP3A4-substrate: | 0.174 |
Clearance (CL): | 16.174 | Half-life (T1/2): | 0.841 |
hERG Blockers: | 0.04 | Human Hepatotoxicity (H-HT): | 0.088 |
Drug-inuced Liver Injury (DILI): | 0.497 | AMES Toxicity: | 0.146 |
Rat Oral Acute Toxicity: | 0.192 | Maximum Recommended Daily Dose: | 0.862 |
Skin Sensitization: | 0.9 | Carcinogencity: | 0.095 |
Eye Corrosion: | 0.012 | Eye Irritation: | 0.961 |
Respiratory Toxicity: | 0.692 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC005096 | ![]() |
0.617 | D07MGA | ![]() |
0.375 | ||
ENC004397 | ![]() |
0.583 | D07EXH | ![]() |
0.292 | ||
ENC005180 | ![]() |
0.560 | D04AIT | ![]() |
0.263 | ||
ENC006107 | ![]() |
0.560 | D0K8KX | ![]() |
0.256 | ||
ENC005853 | ![]() |
0.560 | D0H6QU | ![]() |
0.234 | ||
ENC002936 | ![]() |
0.560 | D0R6BI | ![]() |
0.228 | ||
ENC003216 | ![]() |
0.560 | D02NSF | ![]() |
0.220 | ||
ENC003000 | ![]() |
0.551 | D02UFG | ![]() |
0.219 | ||
ENC003360 | ![]() |
0.551 | D00ZFP | ![]() |
0.218 | ||
ENC005249 | ![]() |
0.551 | D0V9EN | ![]() |
0.217 |