![]() |
Name |
Eugenitin
|
Molecular Formula | C12H12O4 | |
IUPAC Name* |
5-hydroxy-7-methoxy-2,6-dimethylchromen-4-one
|
|
SMILES |
CC1=CC(=O)C2=C(C(=C(C=C2O1)OC)C)O
|
|
InChI |
InChI=1S/C12H12O4/c1-6-4-8(13)11-10(16-6)5-9(15-3)7(2)12(11)14/h4-5,14H,1-3H3
|
|
InChIKey |
RGTSAUBIQAKKLC-UHFFFAOYSA-N
|
|
Synonyms |
Eugenitin; 480-12-6; 5-hydroxy-7-methoxy-2,6-dimethylchromen-4-one; CHEBI:67491; 5-hydroxy-7-methoxy-2,6-dimethyl-4H-chromen-4-one; Eugenetin; EUGENITIN(RG); MLS004257385; CHEMBL3104955; DTXSID30197376; 4H-1-Benzopyran-4-one, 5-hydroxy-7-methoxy-2,6-dimethyl-; SMR003082516; D85078; Q5408353; 5-hydroxy-7-methoxy-2,6-dimethyl-4h -1-benzopyran-4-one; 5-Hydroxy-7-methoxy-2,6-dimethyl-4H-1-Benzopyran-4-one
|
|
CAS | 480-12-6 | |
PubChem CID | 3083581 | |
ChEMBL ID | CHEMBL3104955 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 220.22 | ALogp: | 2.5 |
HBD: | 1 | HBA: | 4 |
Rotatable Bonds: | 1 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 55.8 | Aromatic Rings: | 2 |
Heavy Atoms: | 16 | QED Weighted: | 0.802 |
Caco-2 Permeability: | -4.772 | MDCK Permeability: | 0.00001330 |
Pgp-inhibitor: | 0.001 | Pgp-substrate: | 0.723 |
Human Intestinal Absorption (HIA): | 0.014 | 20% Bioavailability (F20%): | 0.005 |
30% Bioavailability (F30%): | 0.044 |
Blood-Brain-Barrier Penetration (BBB): | 0.085 | Plasma Protein Binding (PPB): | 86.12% |
Volume Distribution (VD): | 0.737 | Fu: | 13.88% |
CYP1A2-inhibitor: | 0.94 | CYP1A2-substrate: | 0.971 |
CYP2C19-inhibitor: | 0.315 | CYP2C19-substrate: | 0.836 |
CYP2C9-inhibitor: | 0.287 | CYP2C9-substrate: | 0.834 |
CYP2D6-inhibitor: | 0.063 | CYP2D6-substrate: | 0.87 |
CYP3A4-inhibitor: | 0.11 | CYP3A4-substrate: | 0.394 |
Clearance (CL): | 5.501 | Half-life (T1/2): | 0.539 |
hERG Blockers: | 0.014 | Human Hepatotoxicity (H-HT): | 0.1 |
Drug-inuced Liver Injury (DILI): | 0.401 | AMES Toxicity: | 0.434 |
Rat Oral Acute Toxicity: | 0.215 | Maximum Recommended Daily Dose: | 0.344 |
Skin Sensitization: | 0.647 | Carcinogencity: | 0.099 |
Eye Corrosion: | 0.022 | Eye Irritation: | 0.942 |
Respiratory Toxicity: | 0.305 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC002207 | ![]() |
0.712 | D06GCK | ![]() |
0.400 | ||
ENC004732 | ![]() |
0.712 | D0G4KG | ![]() |
0.391 | ||
ENC001417 | ![]() |
0.704 | D0FA2O | ![]() |
0.343 | ||
ENC001518 | ![]() |
0.694 | D04AIT | ![]() |
0.278 | ||
ENC006031 | ![]() |
0.686 | D07MGA | ![]() |
0.268 | ||
ENC000962 | ![]() |
0.578 | D0O6KE | ![]() |
0.267 | ||
ENC001617 | ![]() |
0.558 | D0E9CD | ![]() |
0.259 | ||
ENC003982 | ![]() |
0.551 | D0K8KX | ![]() |
0.256 | ||
ENC005905 | ![]() |
0.534 | D0N0OU | ![]() |
0.255 | ||
ENC002186 | ![]() |
0.528 | D0J4IX | ![]() |
0.250 |