![]() |
Name |
Acetic acid, [bis[(trimethylsilyl)oxy]phosphinyl]-, trimethylsilyl ester
|
Molecular Formula | C11H29O5PSi3 | |
IUPAC Name* |
trimethylsilyl 2-bis(trimethylsilyloxy)phosphorylacetate
|
|
SMILES |
C[Si](C)(C)OC(=O)CP(=O)(O[Si](C)(C)C)O[Si](C)(C)C
|
|
InChI |
InChI=1S/C11H29O5PSi3/c1-18(2,3)14-11(12)10-17(13,15-19(4,5)6)16-20(7,8)9/h10H2,1-9H3
|
|
InChIKey |
BHJOIVXJMQHKIY-UHFFFAOYSA-N
|
|
Synonyms |
53044-27-2; Acetic acid, [bis[(trimethylsilyl)oxy]phosphinyl]-, trimethylsilyl ester; Phosphonoacetic Acid, 3TMS derivative; Trimethylsilyl (bis[(trimethylsilyl)oxy]phosphoryl)acetate #; [Bis[(trimethylsilyl)oxy]phosphinyl]acetic acid trimethylsilyl ester
|
|
CAS | NA | |
PubChem CID | 631032 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 356.57 | ALogp: | 4.3 |
HBD: | 0 | HBA: | 5 |
Rotatable Bonds: | 8 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 61.8 | Aromatic Rings: | 0 |
Heavy Atoms: | 20 | QED Weighted: | 0.483 |
Caco-2 Permeability: | -5.976 | MDCK Permeability: | 0.00050078 |
Pgp-inhibitor: | 0.007 | Pgp-substrate: | 0.044 |
Human Intestinal Absorption (HIA): | 0.988 | 20% Bioavailability (F20%): | 0.908 |
30% Bioavailability (F30%): | 0.498 |
Blood-Brain-Barrier Penetration (BBB): | 0.001 | Plasma Protein Binding (PPB): | 94.22% |
Volume Distribution (VD): | 1.571 | Fu: | 20.21% |
CYP1A2-inhibitor: | 0.498 | CYP1A2-substrate: | 0.977 |
CYP2C19-inhibitor: | 0.212 | CYP2C19-substrate: | 0.454 |
CYP2C9-inhibitor: | 0.072 | CYP2C9-substrate: | 0.75 |
CYP2D6-inhibitor: | 0.041 | CYP2D6-substrate: | 0.386 |
CYP3A4-inhibitor: | 0.036 | CYP3A4-substrate: | 0.076 |
Clearance (CL): | 1.988 | Half-life (T1/2): | 0.91 |
hERG Blockers: | 0.003 | Human Hepatotoxicity (H-HT): | 0.005 |
Drug-inuced Liver Injury (DILI): | 0.035 | AMES Toxicity: | 0.043 |
Rat Oral Acute Toxicity: | 0.006 | Maximum Recommended Daily Dose: | 0.156 |
Skin Sensitization: | 0.971 | Carcinogencity: | 0.494 |
Eye Corrosion: | 1 | Eye Irritation: | 0.992 |
Respiratory Toxicity: | 0.988 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC001123 | ![]() |
0.421 | D0K3LW | ![]() |
0.165 | ||
ENC001149 | ![]() |
0.421 | D0Q7ZQ | ![]() |
0.161 | ||
ENC000530 | ![]() |
0.370 | D04MWJ | ![]() |
0.152 | ||
ENC001122 | ![]() |
0.355 | D0Q6DX | ![]() |
0.143 | ||
ENC001272 | ![]() |
0.342 | D0U8AT | ![]() |
0.141 | ||
ENC001182 | ![]() |
0.326 | D01JFT | ![]() |
0.140 | ||
ENC001270 | ![]() |
0.288 | D0Q9HF | ![]() |
0.138 | ||
ENC001785 | ![]() |
0.277 | D0S1ZB | ![]() |
0.138 | ||
ENC000373 | ![]() |
0.277 | D0ML1F | ![]() |
0.137 | ||
ENC001271 | ![]() |
0.267 | D07XYV | ![]() |
0.136 |