![]() |
Name |
Methyl 2-propionylbenzoate
|
Molecular Formula | C11H12O3 | |
IUPAC Name* |
methyl 2-propanoylbenzoate
|
|
SMILES |
CCC(=O)C1=CC=CC=C1C(=O)OC
|
|
InChI |
InChI=1S/C11H12O3/c1-3-10(12)8-6-4-5-7-9(8)11(13)14-2/h4-7H,3H2,1-2H3
|
|
InChIKey |
PJVVSYKDAYJZCV-UHFFFAOYSA-N
|
|
Synonyms |
Methyl 2-propionylbenzoate; 32025-37-9; Methyl2-propionylbenzoate; Methyl 2-propionylbenzoate #; SCHEMBL5592190; AMY18699; 2-(1-Oxopropyl)benzoic acid methyl ester; Benzoic acid,2-(1-oxopropyl)-,methyl ester; Benzoic acid, 2-(1-oxopropyl)-, methyl ester
|
|
CAS | NA | |
PubChem CID | 595877 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 192.21 | ALogp: | 1.9 |
HBD: | 0 | HBA: | 3 |
Rotatable Bonds: | 4 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 43.4 | Aromatic Rings: | 1 |
Heavy Atoms: | 14 | QED Weighted: | 0.546 |
Caco-2 Permeability: | -4.45 | MDCK Permeability: | 0.00002920 |
Pgp-inhibitor: | 0.005 | Pgp-substrate: | 0.001 |
Human Intestinal Absorption (HIA): | 0.004 | 20% Bioavailability (F20%): | 0.004 |
30% Bioavailability (F30%): | 0.902 |
Blood-Brain-Barrier Penetration (BBB): | 0.708 | Plasma Protein Binding (PPB): | 74.69% |
Volume Distribution (VD): | 0.748 | Fu: | 14.32% |
CYP1A2-inhibitor: | 0.954 | CYP1A2-substrate: | 0.92 |
CYP2C19-inhibitor: | 0.871 | CYP2C19-substrate: | 0.285 |
CYP2C9-inhibitor: | 0.498 | CYP2C9-substrate: | 0.658 |
CYP2D6-inhibitor: | 0.091 | CYP2D6-substrate: | 0.358 |
CYP3A4-inhibitor: | 0.077 | CYP3A4-substrate: | 0.245 |
Clearance (CL): | 9.647 | Half-life (T1/2): | 0.616 |
hERG Blockers: | 0.046 | Human Hepatotoxicity (H-HT): | 0.039 |
Drug-inuced Liver Injury (DILI): | 0.734 | AMES Toxicity: | 0.101 |
Rat Oral Acute Toxicity: | 0.051 | Maximum Recommended Daily Dose: | 0.015 |
Skin Sensitization: | 0.164 | Carcinogencity: | 0.088 |
Eye Corrosion: | 0.011 | Eye Irritation: | 0.939 |
Respiratory Toxicity: | 0.104 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC000299 | ![]() |
0.689 | D0GY5Z | ![]() |
0.431 | ||
ENC001804 | ![]() |
0.611 | D0G2MH | ![]() |
0.375 | ||
ENC000154 | ![]() |
0.547 | D0Y0JH | ![]() |
0.358 | ||
ENC000104 | ![]() |
0.545 | D07HBX | ![]() |
0.354 | ||
ENC000303 | ![]() |
0.545 | D0N3UL | ![]() |
0.339 | ||
ENC000301 | ![]() |
0.519 | D05OFX | ![]() |
0.333 | ||
ENC000300 | ![]() |
0.492 | D07ONP | ![]() |
0.321 | ||
ENC001805 | ![]() |
0.484 | D0T3NY | ![]() |
0.317 | ||
ENC002235 | ![]() |
0.480 | D04OSE | ![]() |
0.313 | ||
ENC001027 | ![]() |
0.460 | D02YPG | ![]() |
0.309 |