![]() |
Name |
(3S,10R,13S)-3-[[4-(2-hydroxyethoxy)phenyl]methyl]-13-[(2S)-2-hydroxypentyl]-4,10-dimethyl-1-oxa-4-azacyclotridecane-2,5-dione
|
Molecular Formula | C27H43NO6 | |
IUPAC Name* |
(3S,10R,13S)-3-[[4-(2-hydroxyethoxy)phenyl]methyl]-13-[(2S)-2-hydroxypentyl]-4,10-dimethyl-1-oxa-4-azacyclotridecane-2,5-dione
|
|
SMILES |
CCC[C@@H](C[C@@H]1CC[C@@H](CCCCC(=O)N([C@H](C(=O)O1)CC2=CC=C(C=C2)OCCO)C)C)O
|
|
InChI |
InChI=1S/C27H43NO6/c1-4-7-22(30)19-24-13-10-20(2)8-5-6-9-26(31)28(3)25(27(32)34-24)18-21-11-14-23(15-12-21)33-17-16-29/h11-12,14-15,20,22,24-25,29-30H,4-10,13,16-19H2,1-3H3/t20-,22+,24+,25+/m1/s1
|
|
InChIKey |
SDBGPLZSWIQIOV-VQPAQMSKSA-N
|
|
Synonyms |
Pf 1163a; PF1163A; PF-1163A; (3S,10R,13S)-3-[[4-(2-hydroxyethoxy)phenyl]methyl]-13-[(2S)-2-hydroxypentyl]-4,10-dimethyl-1-oxa-4-azacyclotridecane-2,5-dione; (-)-PF 1163A; (3S,10R,13S)-3-[4-(2-hydroxyethoxy)benzyl]-13-[(2S)-2-hydroxypentyl]-4,10-dimethyl-1-oxa-4-azacyclotridecane-2,5-dione; 258871-59-9; CHEMBL4581359; CHEBI:66740; (?)-PF-1163A; Q27135363; 6-((2S)-2-Hydroxypentyl)(3S,9R)-2-aza-3-{[4-(2-hydroxyethoxy)phenyl]methyl}-2,9-dimethyl-5-oxacyclotridecane-1,4-dione
|
|
CAS | NA | |
PubChem CID | 489139 | |
ChEMBL ID | CHEMBL4581359 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 477.6 | ALogp: | 4.6 |
HBD: | 2 | HBA: | 6 |
Rotatable Bonds: | 9 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 96.3 | Aromatic Rings: | 2 |
Heavy Atoms: | 34 | QED Weighted: | 0.507 |
Caco-2 Permeability: | -4.644 | MDCK Permeability: | 0.00006750 |
Pgp-inhibitor: | 0.984 | Pgp-substrate: | 0.953 |
Human Intestinal Absorption (HIA): | 0.004 | 20% Bioavailability (F20%): | 0.054 |
30% Bioavailability (F30%): | 0.94 |
Blood-Brain-Barrier Penetration (BBB): | 0.155 | Plasma Protein Binding (PPB): | 85.61% |
Volume Distribution (VD): | 0.741 | Fu: | 15.27% |
CYP1A2-inhibitor: | 0.037 | CYP1A2-substrate: | 0.197 |
CYP2C19-inhibitor: | 0.587 | CYP2C19-substrate: | 0.688 |
CYP2C9-inhibitor: | 0.748 | CYP2C9-substrate: | 0.815 |
CYP2D6-inhibitor: | 0.013 | CYP2D6-substrate: | 0.218 |
CYP3A4-inhibitor: | 0.868 | CYP3A4-substrate: | 0.363 |
Clearance (CL): | 11.619 | Half-life (T1/2): | 0.253 |
hERG Blockers: | 0.343 | Human Hepatotoxicity (H-HT): | 0.862 |
Drug-inuced Liver Injury (DILI): | 0.407 | AMES Toxicity: | 0.005 |
Rat Oral Acute Toxicity: | 0.031 | Maximum Recommended Daily Dose: | 0.955 |
Skin Sensitization: | 0.935 | Carcinogencity: | 0.514 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.017 |
Respiratory Toxicity: | 0.056 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC001114 | ![]() |
0.808 | D0A6CQ | ![]() |
0.298 | ||
ENC005268 | ![]() |
0.528 | D03ROX | ![]() |
0.298 | ||
ENC005888 | ![]() |
0.314 | D0BN9X | ![]() |
0.295 | ||
ENC004822 | ![]() |
0.289 | D04QLR | ![]() |
0.289 | ||
ENC001970 | ![]() |
0.289 | D03OFF | ![]() |
0.275 | ||
ENC004816 | ![]() |
0.288 | D02HXS | ![]() |
0.273 | ||
ENC002054 | ![]() |
0.286 | D0B2GI | ![]() |
0.268 | ||
ENC003692 | ![]() |
0.281 | D0V4UF | ![]() |
0.266 | ||
ENC002484 | ![]() |
0.277 | D06XZW | ![]() |
0.266 | ||
ENC005257 | ![]() |
0.273 | D0I2MK | ![]() |
0.265 |