|
Name |
Mevinic acid
|
Molecular Formula | C23H36O6 | |
IUPAC Name* |
(3R,5R)-7-[(1S,2S,8S,8aR)-2-methyl-8-[(2S)-2-methylbutanoyl]oxy-1,2,6,7,8,8a-hexahydronaphthalen-1-yl]-3,5-dihydroxyheptanoic acid
|
|
SMILES |
CC[C@H](C)C(=O)O[C@H]1CCC=C2[C@H]1[C@H]([C@H](C=C2)C)CC[C@H](C[C@H](CC(=O)O)O)O
|
|
InChI |
InChI=1S/C23H36O6/c1-4-14(2)23(28)29-20-7-5-6-16-9-8-15(3)19(22(16)20)11-10-17(24)12-18(25)13-21(26)27/h6,8-9,14-15,17-20,22,24-25H,4-5,7,10-13H2,1-3H3,(H,26,27)/t14-,15-,17+,18+,19-,20-,22-/m0/s1
|
|
InChIKey |
BOZILQFLQYBIIY-INTXDZFKSA-N
|
|
Synonyms |
Mevinic acid; Mevastatin acid; Compactin acid; Mevastatin hydroxy acid; Mevastatin (acid form); ML 236B acid; 1R89KK61YI; 84064-38-0; (3r,5r)-3,5-Dihydroxy-7-[(1s,2s,8s,8ar)-2-Methyl-8-{[(2s)-2-Methylbutanoyl]oxy}-1,2,6,7,8,8a-Hexahydronaphthalen-1-Yl]heptanoic Acid; eptanoic acid; Compactic acid; ML-236B acid; UNII-1R89KK61YI; CHEMBL503456; SCHEMBL8191581; CHEBI:39508; ZINC4134477; Q27252788; (3R,5R)-3,5-dihydroxy-7-[(1S,2S,8S,8aR)-2-methyl-8-{[(2S)-2-methylbutanoyl]oxy}-1,2,6,7,8,8a-hexahydronaphthalen-1-yl]h; 1-NAPHTHALENEHEPTANOIC ACID, 1,2,6,7,8,8A-HEXAHYDRO-.BETA.,.DELTA.-DIHYDROXY-2-METHYL-8-((2S)-2-METHYL-1-OXOBUTOXY)-, (.BETA.R,.DELTA.R,1S,2S,8S,8AR)-; 1-Naphthaleneheptanoic acid, 1,2,6,7,8,8a-hexahydro-beta,delta-dihydroxy-2-methyl-8-((2S)-2-methyl-1-oxobutoxy)-, (betaR,deltaR,1S,2S,8S,8aR)-
|
|
CAS | 84064-38-0 | |
PubChem CID | 446154 | |
ChEMBL ID | CHEMBL503456 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 408.5 | ALogp: | 3.1 |
HBD: | 3 | HBA: | 6 |
Rotatable Bonds: | 11 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 104.0 | Aromatic Rings: | 2 |
Heavy Atoms: | 29 | QED Weighted: | 0.468 |
Caco-2 Permeability: | -5.383 | MDCK Permeability: | 0.00003340 |
Pgp-inhibitor: | 0.001 | Pgp-substrate: | 0.994 |
Human Intestinal Absorption (HIA): | 0.832 | 20% Bioavailability (F20%): | 0.994 |
30% Bioavailability (F30%): | 0.99 |
Blood-Brain-Barrier Penetration (BBB): | 0.14 | Plasma Protein Binding (PPB): | 81.71% |
Volume Distribution (VD): | 0.52 | Fu: | 8.67% |
CYP1A2-inhibitor: | 0.015 | CYP1A2-substrate: | 0.055 |
CYP2C19-inhibitor: | 0.013 | CYP2C19-substrate: | 0.77 |
CYP2C9-inhibitor: | 0.006 | CYP2C9-substrate: | 0.556 |
CYP2D6-inhibitor: | 0.004 | CYP2D6-substrate: | 0.07 |
CYP3A4-inhibitor: | 0.162 | CYP3A4-substrate: | 0.63 |
Clearance (CL): | 13.857 | Half-life (T1/2): | 0.91 |
hERG Blockers: | 0.11 | Human Hepatotoxicity (H-HT): | 0.946 |
Drug-inuced Liver Injury (DILI): | 0.015 | AMES Toxicity: | 0.008 |
Rat Oral Acute Toxicity: | 0.079 | Maximum Recommended Daily Dose: | 0.986 |
Skin Sensitization: | 0.955 | Carcinogencity: | 0.586 |
Eye Corrosion: | 0.004 | Eye Irritation: | 0.056 |
Respiratory Toxicity: | 0.951 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC006006 | 0.663 | D02RQU | 0.778 | ||||
ENC000662 | 0.539 | D06WTZ | 0.420 | ||||
ENC006008 | 0.495 | D0H0ND | 0.309 | ||||
ENC006007 | 0.427 | D01WUA | 0.274 | ||||
ENC002580 | 0.420 | D0C6NM | 0.248 | ||||
ENC002912 | 0.414 | D01QIN | 0.236 | ||||
ENC000994 | 0.412 | D03KIA | 0.226 | ||||
ENC004385 | 0.307 | D01STB | 0.226 | ||||
ENC004384 | 0.307 | D0ZI4H | 0.225 | ||||
ENC005083 | 0.289 | D0N3NO | 0.224 |