|
Name |
Menthofuran
|
Molecular Formula | C10H14O | |
IUPAC Name* |
3,6-dimethyl-4,5,6,7-tetrahydro-1-benzofuran
|
|
SMILES |
CC1CCC2=C(C1)OC=C2C
|
|
InChI |
InChI=1S/C10H14O/c1-7-3-4-9-8(2)6-11-10(9)5-7/h6-7H,3-5H2,1-2H3
|
|
InChIKey |
YGWKXXYGDYYFJU-UHFFFAOYSA-N
|
|
Synonyms |
Menthofuran; 494-90-6; Menthofurane; 3,6-Dimethyl-4,5,6,7-tetrahydro-1-benzofuran; BENZOFURAN, 4,5,6,7-TETRAHYDRO-3,6-DIMETHYL-; 3,9-Epoxy-p-mentha-3,8-diene; p-Mentha-3,8-diene, 3,9-epoxy-; 4,5,6,7-Tetrahydro-3,6-dimethylbenzofuran; 4,5,6,7-Tetrahydro-3,6-dimethylcoumarone; LK024V9U3C; 3,6-dimethyl-4,5,6,7-tetrahydrobenzofuran; CHEBI:50542; FEMA No. 3235; NSC-315249; (R)-(+)-Menthofuran; EINECS 207-795-5; NSC 315249; UNII-LK024V9U3C; MFCD00041851; (+/-)-menthofuran; 3,8-diene; (R)-4,5,6,7-tetrahydro-3,6-dimethylbenzofuran; DSSTox_CID_5534; DSSTox_RID_77820; DSSTox_GSID_25534; p-Mentha-3, 3,9-epoxy-; SCHEMBL1472618; CHEMBL1522900; DTXSID9025534; MENTHOFURAN, (+/-)-; ALBB-025049; Tox21_200722; BDBM50418084; NSC315249; AKOS015906818; SB47674; 3,9-Epoxy-(+)-p-Mentha-3,8-diene; NCGC00090822-01; NCGC00090822-02; NCGC00258276-01; AS-76978; CAS-494-90-6; DB-065282; Benzofuran,5,6,7-tetrahydro-3,6-dimethyl-; FT-0617128; FT-0772068; 3,6-dimethyl-4,5,6,7-tetrahydro-benzofuran; C09868; 3,6-Dimethyl-4,5,6,7-tetrahydrobenzo[b]furan; 3,6-Dimethyl-4,5,6,7-tetrahydro-1-benzofuran #; 4,5,6,7-Tetrahydro-3,6-dimethyl-(R)-Benzofuran; Q6817554; 4,5,6,7-TETRAHYDRO-3,6-DIMETHYL-BENZOFURAN; 4,5,6,7-Tetrahydro-3,6-dimethylbenzofuran, >=95%
|
|
CAS | 494-90-6 | |
PubChem CID | 329983 | |
ChEMBL ID | CHEMBL1522900 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 150.22 | ALogp: | 3.0 |
HBD: | 0 | HBA: | 1 |
Rotatable Bonds: | 0 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 13.1 | Aromatic Rings: | 2 |
Heavy Atoms: | 11 | QED Weighted: | 0.551 |
Caco-2 Permeability: | -4.445 | MDCK Permeability: | 0.00002990 |
Pgp-inhibitor: | 0.001 | Pgp-substrate: | 0.025 |
Human Intestinal Absorption (HIA): | 0.003 | 20% Bioavailability (F20%): | 0.015 |
30% Bioavailability (F30%): | 0.186 |
Blood-Brain-Barrier Penetration (BBB): | 0.822 | Plasma Protein Binding (PPB): | 94.93% |
Volume Distribution (VD): | 2.985 | Fu: | 5.32% |
CYP1A2-inhibitor: | 0.835 | CYP1A2-substrate: | 0.854 |
CYP2C19-inhibitor: | 0.438 | CYP2C19-substrate: | 0.319 |
CYP2C9-inhibitor: | 0.181 | CYP2C9-substrate: | 0.805 |
CYP2D6-inhibitor: | 0.05 | CYP2D6-substrate: | 0.903 |
CYP3A4-inhibitor: | 0.056 | CYP3A4-substrate: | 0.214 |
Clearance (CL): | 12.468 | Half-life (T1/2): | 0.569 |
hERG Blockers: | 0.019 | Human Hepatotoxicity (H-HT): | 0.417 |
Drug-inuced Liver Injury (DILI): | 0.353 | AMES Toxicity: | 0.019 |
Rat Oral Acute Toxicity: | 0.099 | Maximum Recommended Daily Dose: | 0.24 |
Skin Sensitization: | 0.209 | Carcinogencity: | 0.735 |
Eye Corrosion: | 0.019 | Eye Irritation: | 0.33 |
Respiratory Toxicity: | 0.742 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC000907 | 0.457 | D00EEL | 0.200 | ||||
ENC001082 | 0.333 | D0K7LU | 0.194 | ||||
ENC002097 | 0.298 | D01JMC | 0.193 | ||||
ENC003840 | 0.288 | D0WO8W | 0.191 | ||||
ENC003551 | 0.267 | D0A2AJ | 0.191 | ||||
ENC001047 | 0.265 | D06FPQ | 0.188 | ||||
ENC001256 | 0.255 | D0G8NN | 0.183 | ||||
ENC002309 | 0.255 | D0U0KW | 0.178 | ||||
ENC001817 | 0.241 | D07GRH | 0.177 | ||||
ENC001305 | 0.241 | D0H1QY | 0.176 |