![]() |
Name |
Pyrazino[1,2-a]indole-1,4-dione, 2,3-dihydro-2-methyl-3-methylene-
|
Molecular Formula | C13H10N2O2 | |
IUPAC Name* |
2-methyl-3-methylidenepyrazino[1,2-a]indole-1,4-dione
|
|
SMILES |
CN1C(=C)C(=O)N2C3=CC=CC=C3C=C2C1=O
|
|
InChI |
InChI=1S/C13H10N2O2/c1-8-12(16)15-10-6-4-3-5-9(10)7-11(15)13(17)14(8)2/h3-7H,1H2,2H3
|
|
InChIKey |
SYXZMNNRTIHJKB-UHFFFAOYSA-N
|
|
Synonyms |
19079-11-9; NSC175900; Pyrazino[1,2-a]indole-1,4-dione, 2,3-dihydro-2-methyl-3-methylene-; 2-methyl-3-methylidenepyrazino[1,2-a]indole-1,4-dione; DTXSID90306366; NSC-175900; Pyrazino[1,4-dione, 2,3-dihydro-2-methyl-3-methylene-; 2,3-Dihydro-2-methyl-3-methylenepyrazino[1,2-a]indole-1,4-dione; 1,2,3,4-tetrahydro-2-methyl-3-methylene-1,4-dioxopyrazino[1,2-a]indole; 2-Methyl-3-methylene-2,3-dihydropyrazino[1,2-a]indole-1,4-dione #
|
|
CAS | 19079-11-9 | |
PubChem CID | 300706 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 226.23 | ALogp: | 2.1 |
HBD: | 0 | HBA: | 2 |
Rotatable Bonds: | 0 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 42.3 | Aromatic Rings: | 3 |
Heavy Atoms: | 17 | QED Weighted: | 0.565 |
Caco-2 Permeability: | -5.086 | MDCK Permeability: | 0.00002660 |
Pgp-inhibitor: | 0.003 | Pgp-substrate: | 0.003 |
Human Intestinal Absorption (HIA): | 0.006 | 20% Bioavailability (F20%): | 0.003 |
30% Bioavailability (F30%): | 0.002 |
Blood-Brain-Barrier Penetration (BBB): | 0.938 | Plasma Protein Binding (PPB): | 81.43% |
Volume Distribution (VD): | 0.985 | Fu: | 9.49% |
CYP1A2-inhibitor: | 0.978 | CYP1A2-substrate: | 0.341 |
CYP2C19-inhibitor: | 0.336 | CYP2C19-substrate: | 0.587 |
CYP2C9-inhibitor: | 0.205 | CYP2C9-substrate: | 0.161 |
CYP2D6-inhibitor: | 0.011 | CYP2D6-substrate: | 0.298 |
CYP3A4-inhibitor: | 0.019 | CYP3A4-substrate: | 0.302 |
Clearance (CL): | 6.473 | Half-life (T1/2): | 0.673 |
hERG Blockers: | 0.023 | Human Hepatotoxicity (H-HT): | 0.084 |
Drug-inuced Liver Injury (DILI): | 0.09 | AMES Toxicity: | 0.911 |
Rat Oral Acute Toxicity: | 0.039 | Maximum Recommended Daily Dose: | 0.9 |
Skin Sensitization: | 0.124 | Carcinogencity: | 0.97 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.522 |
Respiratory Toxicity: | 0.163 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC002809 | ![]() |
0.407 | D03GET | ![]() |
0.339 | ||
ENC002158 | ![]() |
0.382 | D06BYV | ![]() |
0.323 | ||
ENC000732 | ![]() |
0.362 | D08EOD | ![]() |
0.313 | ||
ENC004693 | ![]() |
0.355 | D06IXT | ![]() |
0.310 | ||
ENC004686 | ![]() |
0.355 | D06GKN | ![]() |
0.310 | ||
ENC004684 | ![]() |
0.346 | D0K7WK | ![]() |
0.310 | ||
ENC002566 | ![]() |
0.342 | D07RGW | ![]() |
0.300 | ||
ENC004688 | ![]() |
0.342 | D08UMH | ![]() |
0.297 | ||
ENC004691 | ![]() |
0.342 | D05EPM | ![]() |
0.290 | ||
ENC000667 | ![]() |
0.315 | D04ACW | ![]() |
0.286 |