![]() |
Name |
Omacetaxine mepesuccinate
|
Molecular Formula | C29H39NO9 | |
IUPAC Name* |
1-O-[(2S,3S,6R)-4-methoxy-16,18-dioxa-10-azapentacyclo[11.7.0.02,6.06,10.015,19]icosa-1(20),4,13,15(19)-tetraen-3-yl] 4-O-methyl (2R)-2-hydroxy-2-(4-hydroxy-4-methylpentyl)butanedioate
|
|
SMILES |
CC(C)(CCC[C@@](CC(=O)OC)(C(=O)O[C@H]1[C@H]2C3=CC4=C(C=C3CCN5[C@@]2(CCC5)C=C1OC)OCO4)O)O
|
|
InChI |
InChI=1S/C29H39NO9/c1-27(2,33)8-5-10-29(34,16-23(31)36-4)26(32)39-25-22(35-3)15-28-9-6-11-30(28)12-7-18-13-20-21(38-17-37-20)14-19(18)24(25)28/h13-15,24-25,33-34H,5-12,16-17H2,1-4H3/t24-,25-,28+,29-/m1/s1
|
|
InChIKey |
HYFHYPWGAURHIV-JFIAXGOJSA-N
|
|
Synonyms |
homoharringtonine; Omacetaxine mepesuccinate; 26833-87-4; Ceflatonin; Myelostat; Synribo; CGX-635; Omapro; Homoharringtonin; (-)-homoharringtonine; NSC-141633; C29H39NO9; CHEBI:71019; (2'R,3S,4S,5R)-(-)-homoharringtonine; Omacetaxine (homoharringtonine); Omacetaxine mepesuccinate [USAN]; 6FG8041S5B; NSC 141633; 1-O-[(2S,3S,6R)-4-methoxy-16,18-dioxa-10-azapentacyclo[11.7.0.02,6.06,10.015,19]icosa-1(20),4,13,15(19)-tetraen-3-yl] 4-O-methyl (2R)-2-hydroxy-2-(4-hydroxy-4-methylpentyl)butanedioate; Cephalotaxine 4-methyl (2R)-2-hydroxy-2-(4-hydroxy-4-methylpentyl)butanedioate; Omacetaxine mepesuccinate (USAN); Tekinex; Synribo (TN); Cephalotaxine, 4-methyl (2R)-2-hydroxy-2-(4-hydroxy-4-methylpentyl)butanedioate (ester); UNII-6FG8041S5B; NSC141633; NCGC00025155-01; Omacetaxine mepesuccinate [USAN:INN]; BRN 5687925; omacetaxini mepesuccinas; ZJ-C; mepesuccinate d'omacetaxine; mepesuccinato de omacetaxina; Cephalotaxine 4-Methyl (2R)-2-Hydroxy-2-(4-hydroxy-4-methylpentyl)butanedioate (Ester); MLS001424293; CHEMBL46286; HOMOHARRINGTONINE [MI]; CGX-635-14 (formulation); GTPL7454; SCHEMBL12745687; HMS3267H22; HMS3414N05; HMS3678N03; AMY33459; Homoharringtonine, >=98% (HPLC); BDBM50480293; HB4660; MFCD05618221; NSC758253; s9015; ZINC26011099; AKOS024456585; CCG-269981; DB04865; NC00395; NSC-758253; OMACETAXINE MEPESUCCINATE [INN]; NCGC00025155-02; NCGC00025155-03; NCGC00025155-04; NCGC00025155-07; OMACETAXINE MEPESUCCINATE [MART.]; OMACETAXINE MEPESUCCINATE [VANDF]; HY-14944; NCI60_000917; OMACETAXINE MEPESUCCINATE [WHO-DD]; SMR000469230; H1775; D08956; OMACETAXINE MEPESUCCINATE [ORANGE BOOK]; AB00642561-02; EN300-22161068; SR-01000597562; Q7089373; SR-01000597562-1; BRD-K76674262-001-01-7; BRD-K76674262-001-02-5; Cephalotaxine, 3-[4-methyl (2R)-2-hydroxy-2-(4-hydroxy-4-methylpentyl)butanedioate]; Cephalotaxine, 4-methyl-, 2-hydroxy-2-(4-hydroxy-4-methylpentyl)butanedioate (ester); (2S,3S,6R)-4-methoxy-16,18-dioxa-10-azapentacyclo[11.7.0.0^{2,6}.0^{6,10}.0^{15,19}]icosa-1(13),4,14,19-tetraen-3-yl 1-methyl (3R)-3-hydroxy-3-(4-hydroxy-4-methylpentyl)butanedioate; (S)-1-((11bS,12S,14aR)-13-methoxy-2,3,5,6,11b,12-hexahydro-1H-[1,3]dioxolo[4',5':4,5]benzo[1,2-d]cyclopenta[b]pyrrolo[1,2-a]azepin-12-yl) 4-methyl 2-hydroxy-2-(4-hydroxy-4-methylpentyl)succinate; 1-((1S,3aR,14bS)-2-Methoxy-1,5,6,8,9,14b-hexahydro-4H- cyclopenta(a)(1,3)dioxolo(4,5-h)pyrrolo(2,1-b)(3)benzazepin-1-yl) 4-methyl (2R)-2- hydroxy-2-(4-hydroxy-4-methylpentyl)butanedioate; 1-[(1S,3aR,14bS)-2-Methoxy-1,5,6,8,9,14b-hexahydro-4H-cyclopenta[a][1,3]dioxolo[4,5-H]pyrrolo[2,1-b][3]benzazepin-1-yl] 4-methyl (2R)-2-hydroxy-2-(4-hydroxy-4-methylpentyl)butanedioate; Homoharringtonine; Cephalotaxine; [3(R)]-4-methyl 2-hydroxy-2-(4-hydroxy-4-methylpentyl)butanedioate
|
|
CAS | 26833-87-4 | |
PubChem CID | 285033 | |
ChEMBL ID | CHEMBL46286 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 545.6 | ALogp: | 0.8 |
HBD: | 2 | HBA: | 10 |
Rotatable Bonds: | 11 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 124.0 | Aromatic Rings: | 5 |
Heavy Atoms: | 39 | QED Weighted: | 0.447 |
Caco-2 Permeability: | -4.88 | MDCK Permeability: | 0.00004850 |
Pgp-inhibitor: | 0.988 | Pgp-substrate: | 0.002 |
Human Intestinal Absorption (HIA): | 0.002 | 20% Bioavailability (F20%): | 0.138 |
30% Bioavailability (F30%): | 0.69 |
Blood-Brain-Barrier Penetration (BBB): | 0.872 | Plasma Protein Binding (PPB): | 52.93% |
Volume Distribution (VD): | 2.517 | Fu: | 37.37% |
CYP1A2-inhibitor: | 0.067 | CYP1A2-substrate: | 0.605 |
CYP2C19-inhibitor: | 0.172 | CYP2C19-substrate: | 0.876 |
CYP2C9-inhibitor: | 0.379 | CYP2C9-substrate: | 0.256 |
CYP2D6-inhibitor: | 0.851 | CYP2D6-substrate: | 0.316 |
CYP3A4-inhibitor: | 0.945 | CYP3A4-substrate: | 0.914 |
Clearance (CL): | 8.199 | Half-life (T1/2): | 0.224 |
hERG Blockers: | 0.109 | Human Hepatotoxicity (H-HT): | 0.863 |
Drug-inuced Liver Injury (DILI): | 0.206 | AMES Toxicity: | 0.198 |
Rat Oral Acute Toxicity: | 0.086 | Maximum Recommended Daily Dose: | 0.941 |
Skin Sensitization: | 0.061 | Carcinogencity: | 0.851 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.008 |
Respiratory Toxicity: | 0.165 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC000702 | ![]() |
0.278 | D0M4XY | ![]() |
1.000 | ||
ENC000361 | ![]() |
0.252 | D0L1JW | ![]() |
0.313 | ||
ENC005626 | ![]() |
0.244 | D02DKD | ![]() |
0.268 | ||
ENC002565 | ![]() |
0.238 | D04TDQ | ![]() |
0.260 | ||
ENC002383 | ![]() |
0.238 | D0D4HN | ![]() |
0.252 | ||
ENC001089 | ![]() |
0.236 | D0W8WB | ![]() |
0.238 | ||
ENC005621 | ![]() |
0.233 | D09PJX | ![]() |
0.236 | ||
ENC002846 | ![]() |
0.231 | D07VBA | ![]() |
0.228 | ||
ENC005153 | ![]() |
0.229 | D0Y5RZ | ![]() |
0.228 | ||
ENC003401 | ![]() |
0.223 | D07UXP | ![]() |
0.227 |