![]() |
Name |
2-Amino-3-methoxybenzoic acid
|
Molecular Formula | C8H9NO3 | |
IUPAC Name* |
2-amino-3-methoxybenzoic acid
|
|
SMILES |
COC1=CC=CC(=C1N)C(=O)O
|
|
InChI |
InChI=1S/C8H9NO3/c1-12-6-4-2-3-5(7(6)9)8(10)11/h2-4H,9H2,1H3,(H,10,11)
|
|
InChIKey |
SXOPCLUOUFQBJV-UHFFFAOYSA-N
|
|
Synonyms |
2-Amino-3-methoxybenzoic acid; 3177-80-8; 3-Methoxyanthranilic acid; Benzoic acid, 2-amino-3-methoxy-; m-Anisic acid, 2-amino-; 3-Methoxyanthranilate; 2-AMINO-3-METHOXYBENZOICACID; 3-Methoxy-2-aminobenzoic acid; 2-amino-3-methoxy-benzoic acid; 2-Amino-3-(methyloxy)benzoic acid; MFCD00075178; HU74W6CCX9; 2-amino-3-methoxy benzoic acid; 2-azanyl-3-methoxy-benzoic acid; NSC-81443; 2-Amino-m-anisic Acid; 3-methoxy-anthranilic acid; bmse000692; UNII-HU74W6CCX9; 4-ETHYL PROPIOPHENONE; SCHEMBL148830; o-Anisidine-6-carboxylic Acid; CHEBI:27440; DTXSID60292303; ZINC389612; ACT00288; BCP06185; CS-B0779; NSC81443; CCG-40456; NSC 81443; 2-Amino-3-methoxybenzoic acid, 98%; AKOS005133185; PS-5537; SB11450; WT82260; AC-28712; SY011381; DB-013150; A1378; AM20040159; FT-0634715; EN300-86180; A19579; C05831; 177A808; A1-00266; W-202311; 9BB46DAB-577F-4758-8D02-E7EDF6B52FBF; Q27103130
|
|
CAS | 3177-80-8 | |
PubChem CID | 255720 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 167.16 | ALogp: | 1.6 |
HBD: | 2 | HBA: | 4 |
Rotatable Bonds: | 2 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 72.6 | Aromatic Rings: | 1 |
Heavy Atoms: | 12 | QED Weighted: | 0.653 |
Caco-2 Permeability: | -4.914 | MDCK Permeability: | 0.00027553 |
Pgp-inhibitor: | 0.001 | Pgp-substrate: | 0.903 |
Human Intestinal Absorption (HIA): | 0.005 | 20% Bioavailability (F20%): | 0.003 |
30% Bioavailability (F30%): | 0.021 |
Blood-Brain-Barrier Penetration (BBB): | 0.763 | Plasma Protein Binding (PPB): | 48.73% |
Volume Distribution (VD): | 0.332 | Fu: | 59.75% |
CYP1A2-inhibitor: | 0.046 | CYP1A2-substrate: | 0.501 |
CYP2C19-inhibitor: | 0.048 | CYP2C19-substrate: | 0.067 |
CYP2C9-inhibitor: | 0.156 | CYP2C9-substrate: | 0.212 |
CYP2D6-inhibitor: | 0.024 | CYP2D6-substrate: | 0.158 |
CYP3A4-inhibitor: | 0.013 | CYP3A4-substrate: | 0.098 |
Clearance (CL): | 6.926 | Half-life (T1/2): | 0.837 |
hERG Blockers: | 0.039 | Human Hepatotoxicity (H-HT): | 0.217 |
Drug-inuced Liver Injury (DILI): | 0.942 | AMES Toxicity: | 0.022 |
Rat Oral Acute Toxicity: | 0.119 | Maximum Recommended Daily Dose: | 0.016 |
Skin Sensitization: | 0.33 | Carcinogencity: | 0.057 |
Eye Corrosion: | 0.027 | Eye Irritation: | 0.987 |
Respiratory Toxicity: | 0.479 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC002213 | ![]() |
0.457 | D0GY5Z | ![]() |
0.457 | ||
ENC000073 | ![]() |
0.457 | D0C4YC | ![]() |
0.419 | ||
ENC000296 | ![]() |
0.455 | D01WJL | ![]() |
0.419 | ||
ENC001055 | ![]() |
0.422 | D0N3UL | ![]() |
0.408 | ||
ENC001056 | ![]() |
0.422 | D07HBX | ![]() |
0.405 | ||
ENC002881 | ![]() |
0.420 | D0E9CD | ![]() |
0.348 | ||
ENC000103 | ![]() |
0.419 | D0FN7J | ![]() |
0.339 | ||
ENC002235 | ![]() |
0.417 | D0Y0JH | ![]() |
0.328 | ||
ENC003116 | ![]() |
0.417 | D09SOA | ![]() |
0.323 | ||
ENC001774 | ![]() |
0.415 | D05FTJ | ![]() |
0.323 |