|
Name |
Isoaltenuene
|
Molecular Formula | C15H16O6 | |
IUPAC Name* |
(2R,3R,4aS)-2,3,7-trihydroxy-9-methoxy-4a-methyl-3,4-dihydro-2H-benzo[c]chromen-6-one
|
|
SMILES |
C[C@]12C[C@H]([C@@H](C=C1C3=C(C(=CC(=C3)OC)O)C(=O)O2)O)O
|
|
InChI |
InChI=1S/C15H16O6/c1-15-6-12(18)10(16)5-9(15)8-3-7(20-2)4-11(17)13(8)14(19)21-15/h3-5,10,12,16-18H,6H2,1-2H3/t10-,12-,15+/m1/s1
|
|
InChIKey |
MMHTXEATDNFMMY-HCKVZZMMSA-N
|
|
Synonyms |
Isoaltenuene; 126671-80-5; (2R,3R,4aS)-2,3,7-trihydroxy-9-methoxy-4a-methyl-3,4-dihydro-2H-benzo[c]chromen-6-one; CHEMBL504275; DTXSID80925666; (2R,3R,4aS)-2,3,7-Trihydroxy-9-methoxy-4a-methyl-3,4-dihydro-2H-benzo(c)isochromen-6-one; 2,3,7-Trihydroxy-9-methoxy-4a-methyl-2,3,4,4a-tetrahydro-6H-dibenzo[b,d]pyran-6-one; (2R,3R,4AS)-2,3,7-TRIHYDROXY-9-METHOXY-4A-METHYL-2H,3H,4H,4AH,6H-BENZO[C]CHROMEN-6-ONE
|
|
CAS | 126671-80-5 | |
PubChem CID | 180444 | |
ChEMBL ID | CHEMBL504275 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 292.28 | ALogp: | 0.7 |
HBD: | 3 | HBA: | 6 |
Rotatable Bonds: | 1 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 96.2 | Aromatic Rings: | 3 |
Heavy Atoms: | 21 | QED Weighted: | 0.674 |
Caco-2 Permeability: | -4.736 | MDCK Permeability: | 0.00000677 |
Pgp-inhibitor: | 0.003 | Pgp-substrate: | 0.099 |
Human Intestinal Absorption (HIA): | 0.057 | 20% Bioavailability (F20%): | 0.011 |
30% Bioavailability (F30%): | 0.039 |
Blood-Brain-Barrier Penetration (BBB): | 0.462 | Plasma Protein Binding (PPB): | 68.57% |
Volume Distribution (VD): | 0.304 | Fu: | 42.93% |
CYP1A2-inhibitor: | 0.026 | CYP1A2-substrate: | 0.801 |
CYP2C19-inhibitor: | 0.036 | CYP2C19-substrate: | 0.846 |
CYP2C9-inhibitor: | 0.041 | CYP2C9-substrate: | 0.446 |
CYP2D6-inhibitor: | 0.005 | CYP2D6-substrate: | 0.283 |
CYP3A4-inhibitor: | 0.102 | CYP3A4-substrate: | 0.37 |
Clearance (CL): | 6.767 | Half-life (T1/2): | 0.73 |
hERG Blockers: | 0.01 | Human Hepatotoxicity (H-HT): | 0.16 |
Drug-inuced Liver Injury (DILI): | 0.228 | AMES Toxicity: | 0.251 |
Rat Oral Acute Toxicity: | 0.321 | Maximum Recommended Daily Dose: | 0.866 |
Skin Sensitization: | 0.466 | Carcinogencity: | 0.046 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.119 |
Respiratory Toxicity: | 0.893 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC002647 | 1.000 | D07MGA | 0.297 | ||||
ENC005362 | 1.000 | D0J4IX | 0.240 | ||||
ENC002173 | 1.000 | D0P1FO | 0.235 | ||||
ENC006132 | 1.000 | D0I9HF | 0.232 | ||||
ENC004819 | 1.000 | D04UTT | 0.227 | ||||
ENC006131 | 1.000 | D06GCK | 0.223 | ||||
ENC000620 | 1.000 | D01XWG | 0.221 | ||||
ENC004851 | 1.000 | D0AZ8C | 0.220 | ||||
ENC005177 | 1.000 | D0C1SF | 0.220 | ||||
ENC006071 | 0.773 | D08CCE | 0.219 |