![]() |
Name |
(+)-Menthol
|
Molecular Formula | C10H20O | |
IUPAC Name* |
(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexan-1-ol
|
|
SMILES |
C[C@H]1CC[C@@H]([C@H](C1)O)C(C)C
|
|
InChI |
InChI=1S/C10H20O/c1-7(2)9-5-4-8(3)6-10(9)11/h7-11H,4-6H2,1-3H3/t8-,9+,10-/m0/s1
|
|
InChIKey |
NOOLISFMXDJSKH-AEJSXWLSSA-N
|
|
Synonyms |
(+)-Menthol; 15356-60-2; d-Menthol; (1S,2R,5S)-(+)-Menthol; (1S,2R,5S)-Menthol; Cyclohexanol, 5-methyl-2-(1-methylethyl)-, (1S,2R,5S)-; (1S,2R,5S)-2-Isopropyl-5-methylcyclohexanol; Hexahydrothymol; Menthol, (+)-; (1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexan-1-ol; (1S,2R,5S)-5-methyl-2-(propan-2-yl)cyclohexan-1-ol; Menthol, (1S,3S,4R)-(+)-; C6B1OE8P3W; rac-Menthol; CHEBI:76306; (+)-(1S,2R,5S)-menthol; (+)-(1S,3S,4R)-menthol; 89-78-1; p-Menthan-3-ol; MFCD00062983; (1S,2R,5S)-5-methyl-2-(1-methylethyl)cyclohexanol; (+)-p-Menthan-3-ol; Racemic menthol; 3-p-Menthanol; NSC 2603; Therapeutic mineral ice; Fisherman's friend lozenges; UNII-C6B1OE8P3W; Menthol, cis-1,3,trans-1,4-; Fancol menthol; Cyclohexanol, 5-methyl-2-(1-methylethyl)-, (1.alpha.,2.beta.,5.alpha.)-; (DL)-Menthol; EINECS 239-387-8; (.+/-.)-Menthol; (1S)-(+)-menthol; (+/-)-Menthol racemic; MENTHOL, D-; DSSTox_CID_9733; EC 239-387-8; DSSTox_RID_78817; DSSTox_GSID_29733; SCHEMBL521946; GTPL2471; CHEMBL2106989; DTXSID8029733; ZINC967511; (1s, 2r, 5s)-(+)-menthol; Tox21_201043; AKOS006281173; CS-W017993; DB11344; HY-W017277; NCGC00248905-01; NCGC00258596-01; AS-69562; (1S,2R,5S)-(+)-Menthol, 99%; CAS-15356-60-2; M0826; M3170; EN300-92162; A815982; (1S,2R,5S)-2-Isopropyl-5-methylcyclohexan-1-ol; (1S,2R,5S)-5-methyl-2-propan-2-yl-1-cyclohexanol; Q27084428; (1S,2R,5S)-5-methyl-2-propan-2-yl-cyclohexan-1-ol; F8889-8741; Z1198149783; 5.alpha.-Methyl-2.beta.-(1.alpha.-methylethyl)cyclohexanol; Cyclohexanol,5-methyl-2-(1-methylethyl)-,(1S,2R,5S)-; 2-Isopropyl-5-methylcyclohexanol, (1.alpha.,2.beta.,5.alpha.)-; 5-Methyl-2-(1-methylethyl)cyclohexanol, (1.alpha.,2.beta.,5.alpha.)-; Cyclohexanol, 2-isopropyl-5-methyl-, (1.alpha.,2.beta.,5.alpha.)-; Cyclohexanol, 5-methyl-2-(1-methylethyl)-, (1S-(1alpha,2beta,5alpha))-; (+)-Menthol, puriss. p.a., terpene standard for GC, >=99.0% (sum of enantiomers, GC)
|
|
CAS | 89-78-1 | |
PubChem CID | 165675 | |
ChEMBL ID | CHEMBL2106989 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 156.26 | ALogp: | 3.0 |
HBD: | 1 | HBA: | 1 |
Rotatable Bonds: | 1 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 20.2 | Aromatic Rings: | 1 |
Heavy Atoms: | 11 | QED Weighted: | 0.618 |
Caco-2 Permeability: | -4.429 | MDCK Permeability: | 0.00002290 |
Pgp-inhibitor: | 0 | Pgp-substrate: | 0.823 |
Human Intestinal Absorption (HIA): | 0.005 | 20% Bioavailability (F20%): | 0.839 |
30% Bioavailability (F30%): | 0.739 |
Blood-Brain-Barrier Penetration (BBB): | 0.373 | Plasma Protein Binding (PPB): | 74.19% |
Volume Distribution (VD): | 1.05 | Fu: | 20.56% |
CYP1A2-inhibitor: | 0.395 | CYP1A2-substrate: | 0.595 |
CYP2C19-inhibitor: | 0.028 | CYP2C19-substrate: | 0.899 |
CYP2C9-inhibitor: | 0.092 | CYP2C9-substrate: | 0.677 |
CYP2D6-inhibitor: | 0.006 | CYP2D6-substrate: | 0.171 |
CYP3A4-inhibitor: | 0.022 | CYP3A4-substrate: | 0.31 |
Clearance (CL): | 11.777 | Half-life (T1/2): | 0.588 |
hERG Blockers: | 0.042 | Human Hepatotoxicity (H-HT): | 0.104 |
Drug-inuced Liver Injury (DILI): | 0.225 | AMES Toxicity: | 0.027 |
Rat Oral Acute Toxicity: | 0.081 | Maximum Recommended Daily Dose: | 0.028 |
Skin Sensitization: | 0.811 | Carcinogencity: | 0.525 |
Eye Corrosion: | 0.988 | Eye Irritation: | 0.985 |
Respiratory Toxicity: | 0.873 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC000578 | ![]() |
0.535 | D04CSZ | ![]() |
1.000 | ||
ENC001908 | ![]() |
0.511 | D0V8HA | ![]() |
0.220 | ||
ENC001888 | ![]() |
0.487 | D0S0AS | ![]() |
0.200 | ||
ENC003125 | ![]() |
0.469 | D06PTA | ![]() |
0.200 | ||
ENC000791 | ![]() |
0.432 | D03DVJ | ![]() |
0.200 | ||
ENC000762 | ![]() |
0.381 | D04SFH | ![]() |
0.198 | ||
ENC000763 | ![]() |
0.381 | D0N6FH | ![]() |
0.197 | ||
ENC003266 | ![]() |
0.378 | D07QKN | ![]() |
0.196 | ||
ENC004915 | ![]() |
0.378 | D0R2KF | ![]() |
0.194 | ||
ENC003087 | ![]() |
0.373 | D0G3SH | ![]() |
0.191 |