![]() |
Name |
Dihydrocitrinone
|
Molecular Formula | C13H14O6 | |
IUPAC Name* |
(3R,4S)-6,8-dihydroxy-3,4,5-trimethyl-1-oxo-3,4-dihydroisochromene-7-carboxylic acid
|
|
SMILES |
C[C@@H]1[C@H](OC(=O)C2=C(C(=C(C(=C12)C)O)C(=O)O)O)C
|
|
InChI |
InChI=1S/C13H14O6/c1-4-6(3)19-13(18)8-7(4)5(2)10(14)9(11(8)15)12(16)17/h4,6,14-15H,1-3H3,(H,16,17)/t4-,6-/m1/s1
|
|
InChIKey |
VVVMDYGNIVXIIG-INEUFUBQSA-N
|
|
Synonyms |
Dihydrocitrinone; 65718-85-6; (3R,4S)-6,8-dihydroxy-3,4,5-trimethyl-1-oxo-3,4-dihydroisochromene-7-carboxylic acid; 9I8K50016V; 1H-2-Benzopyran-7-carboxylic acid, 3,4-dihydro-6,8-dihydroxy-3,4,5-trimethyl-1-oxo-, (3R-trans)-; UNII-9I8K50016V; CITRINONE, DIHYDRO-; CHEMBL465858; MEGxm0_000092; ACon0_000322; ACon1_001305; DTXSID10215926; ZINC6069169; NCGC00180648-01; BRD-K21191814-001-01-1; Q27272591; (3R,4S)-3,4-DIHYDRO-6,8-DIHYDROXY-3,4,5-TRIMETHYL-1-OXO-1H-2-BENZOPYRAN-7-CARBOXYLIC ACID; 1H-2-BENZOPYRAN-7-CARBOXYLIC ACID, 3,4-DIHYDRO-6,8-DIHYDROXY-3,4,5-TRIMETHYL-1-OXO-, (3R,4S)-; NCGC00180648-02!(3R,4S)-6,8-dihydroxy-3,4,5-trimethyl-1-oxo-3,4-dihydroisochromene-7-carboxylic acid
|
|
CAS | 65718-85-6 | |
PubChem CID | 163095 | |
ChEMBL ID | CHEMBL465858 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 266.25 | ALogp: | 2.9 |
HBD: | 3 | HBA: | 6 |
Rotatable Bonds: | 1 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 104.0 | Aromatic Rings: | 2 |
Heavy Atoms: | 19 | QED Weighted: | 0.674 |
Caco-2 Permeability: | -5.743 | MDCK Permeability: | 0.00000658 |
Pgp-inhibitor: | 0.001 | Pgp-substrate: | 0.001 |
Human Intestinal Absorption (HIA): | 0.026 | 20% Bioavailability (F20%): | 0.011 |
30% Bioavailability (F30%): | 0.023 |
Blood-Brain-Barrier Penetration (BBB): | 0.056 | Plasma Protein Binding (PPB): | 97.84% |
Volume Distribution (VD): | 0.425 | Fu: | 2.34% |
CYP1A2-inhibitor: | 0.119 | CYP1A2-substrate: | 0.436 |
CYP2C19-inhibitor: | 0.033 | CYP2C19-substrate: | 0.057 |
CYP2C9-inhibitor: | 0.281 | CYP2C9-substrate: | 0.109 |
CYP2D6-inhibitor: | 0.083 | CYP2D6-substrate: | 0.102 |
CYP3A4-inhibitor: | 0.062 | CYP3A4-substrate: | 0.056 |
Clearance (CL): | 1.16 | Half-life (T1/2): | 0.745 |
hERG Blockers: | 0.004 | Human Hepatotoxicity (H-HT): | 0.273 |
Drug-inuced Liver Injury (DILI): | 0.97 | AMES Toxicity: | 0.014 |
Rat Oral Acute Toxicity: | 0.07 | Maximum Recommended Daily Dose: | 0.022 |
Skin Sensitization: | 0.111 | Carcinogencity: | 0.085 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.409 |
Respiratory Toxicity: | 0.347 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC004924 | ![]() |
0.467 | D01XWG | ![]() |
0.236 | ||
ENC002391 | ![]() |
0.448 | D01XDL | ![]() |
0.235 | ||
ENC005912 | ![]() |
0.446 | D0S0LZ | ![]() |
0.231 | ||
ENC005911 | ![]() |
0.446 | D0JL2K | ![]() |
0.224 | ||
ENC004367 | ![]() |
0.446 | D0WY9N | ![]() |
0.223 | ||
ENC004991 | ![]() |
0.444 | D0YH0N | ![]() |
0.221 | ||
ENC004363 | ![]() |
0.444 | D07VLY | ![]() |
0.220 | ||
ENC003148 | ![]() |
0.439 | D0C9XJ | ![]() |
0.220 | ||
ENC003702 | ![]() |
0.422 | D0Q2AT | ![]() |
0.215 | ||
ENC004969 | ![]() |
0.400 | D0R2KJ | ![]() |
0.215 |