![]() |
Name |
Territrem C
|
Molecular Formula | C28H32O9 | |
IUPAC Name* |
(1S,2S,7R,10R)-1,7-dihydroxy-14-(4-hydroxy-3,5-dimethoxyphenyl)-2,6,6,10-tetramethyl-11,15-dioxatetracyclo[8.8.0.02,7.012,17]octadeca-4,12(17),13-triene-3,16-dione
|
|
SMILES |
C[C@@]12CC[C@@]3([C@@]([C@]1(CC4=C(O2)C=C(OC4=O)C5=CC(=C(C(=C5)OC)O)OC)O)(C(=O)C=CC3(C)C)C)O
|
|
InChI |
InChI=1S/C28H32O9/c1-24(2)8-7-21(29)26(4)27(24,32)10-9-25(3)28(26,33)14-16-18(37-25)13-17(36-23(16)31)15-11-19(34-5)22(30)20(12-15)35-6/h7-8,11-13,30,32-33H,9-10,14H2,1-6H3/t25-,26+,27-,28-/m1/s1
|
|
InChIKey |
FTTNXWIFPFEOQT-JUDWXZBOSA-N
|
|
Synonyms |
Territrem C; 89020-33-7; CHEMBL3632858; DTXSID60897216; BDBM50130204; 4a,6,6a,12,12a,12b-hexahydro-4a,12a-dihydroxy-4,4,6a,12b-tetramethyl-9-(3,5-dimethoxy-4-hydroxyphenyl)-4H,11H-naphtho(2.1-b)pyrano(3,4-e)pyran-1,11(5H)-dione; 4H,11H-Naphtho(2,1-b)pyrano(3,4-e)pyran-1,11(5H)-dione, 4a,6,6a,12,12a,12b-hexahydro-4a,12a-dihydroxy-9-(4-hydroxy-3,5-dimethoxyphenyl)-4,4,6a,12b-tetramethyl-, (4aR-(4a-alpha,6a-beta,12a-alpha,12b-beta))-
|
|
CAS | 89020-33-7 | |
PubChem CID | 160306 | |
ChEMBL ID | CHEMBL3632858 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 512.5 | ALogp: | 2.5 |
HBD: | 3 | HBA: | 9 |
Rotatable Bonds: | 3 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 132.0 | Aromatic Rings: | 5 |
Heavy Atoms: | 37 | QED Weighted: | 0.559 |
Caco-2 Permeability: | -4.891 | MDCK Permeability: | 0.00001370 |
Pgp-inhibitor: | 0.923 | Pgp-substrate: | 0.008 |
Human Intestinal Absorption (HIA): | 0.591 | 20% Bioavailability (F20%): | 0.913 |
30% Bioavailability (F30%): | 0.978 |
Blood-Brain-Barrier Penetration (BBB): | 0.099 | Plasma Protein Binding (PPB): | 80.02% |
Volume Distribution (VD): | 1.062 | Fu: | 14.57% |
CYP1A2-inhibitor: | 0.457 | CYP1A2-substrate: | 0.979 |
CYP2C19-inhibitor: | 0.322 | CYP2C19-substrate: | 0.739 |
CYP2C9-inhibitor: | 0.646 | CYP2C9-substrate: | 0.201 |
CYP2D6-inhibitor: | 0.232 | CYP2D6-substrate: | 0.172 |
CYP3A4-inhibitor: | 0.814 | CYP3A4-substrate: | 0.876 |
Clearance (CL): | 7.093 | Half-life (T1/2): | 0.293 |
hERG Blockers: | 0.044 | Human Hepatotoxicity (H-HT): | 0.732 |
Drug-inuced Liver Injury (DILI): | 0.7 | AMES Toxicity: | 0.009 |
Rat Oral Acute Toxicity: | 0.433 | Maximum Recommended Daily Dose: | 0.92 |
Skin Sensitization: | 0.282 | Carcinogencity: | 0.965 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.007 |
Respiratory Toxicity: | 0.95 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC003232 | ![]() |
0.560 | D06GCK | ![]() |
0.331 | ||
ENC003231 | ![]() |
0.419 | D09NIB | ![]() |
0.259 | ||
ENC002037 | ![]() |
0.415 | D0V8HJ | ![]() |
0.250 | ||
ENC003130 | ![]() |
0.370 | D0C1SF | ![]() |
0.250 | ||
ENC002102 | ![]() |
0.351 | D0D4HN | ![]() |
0.250 | ||
ENC002118 | ![]() |
0.347 | D0F7CS | ![]() |
0.247 | ||
ENC003422 | ![]() |
0.329 | D09DHY | ![]() |
0.241 | ||
ENC003423 | ![]() |
0.329 | D02LZB | ![]() |
0.241 | ||
ENC003409 | ![]() |
0.328 | D01DBQ | ![]() |
0.241 | ||
ENC000970 | ![]() |
0.325 | D07MGA | ![]() |
0.238 |