|
Name |
Armillarivin
|
Molecular Formula | C23H28O5 | |
IUPAC Name* |
[(2R,2aR,4aS,7aS,7bR)-3-formyl-6,6,7b-trimethyl-2,2a,4a,5,7,7a-hexahydro-1H-cyclobuta[e]inden-2-yl] 2,4-dihydroxy-6-methylbenzoate
|
|
SMILES |
CC1=CC(=CC(=C1C(=O)O[C@@H]2C[C@]3([C@@H]2C(=C[C@H]4[C@@H]3CC(C4)(C)C)C=O)C)O)O
|
|
InChI |
InChI=1S/C23H28O5/c1-12-5-15(25)7-17(26)19(12)21(27)28-18-10-23(4)16-9-22(2,3)8-13(16)6-14(11-24)20(18)23/h5-7,11,13,16,18,20,25-26H,8-10H2,1-4H3/t13-,16+,18-,20-,23-/m1/s1
|
|
InChIKey |
NFCOJBIECSQMAM-JQISRXLJSA-N
|
|
Synonyms |
Armillarivin; 135247-97-1; (+)-Armillarivin; DTXSID00159289; CHEBI:175056; [(2R,2aR,4aS,7aS,7bR)-3-formyl-6,6,7b-trimethyl-2,2a,4a,5,7,7a-hexahydro-1H-cyclobuta[e]inden-2-yl] 2,4-dihydroxy-6-methylbenzoate; [(2R,2aR,4aS,7aS,7bR)-3-ormyl-6,6,7b-trimethyl-2,2a,4a,5,7,7a-hexahydro-1H-cyclobuta[e]inden-2-yl] 2,4-dihydroxy-6-methylbenzoate; Benzoic acid, 2,4-dihydroxy-6-methyl-, 3-formyl-2,2a,4a,5,6,7,7a,7b-octahydro-6,6,7b-trimethyl-1H-cyclobut(e)inden-2-yl ester, (2alpha,2abeta,4aalpha,7aalpha,7bbeta)-(+)-
|
|
CAS | 135247-97-1 | |
PubChem CID | 131867 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 384.5 | ALogp: | 5.1 |
HBD: | 2 | HBA: | 5 |
Rotatable Bonds: | 4 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 83.8 | Aromatic Rings: | 4 |
Heavy Atoms: | 28 | QED Weighted: | 0.581 |
Caco-2 Permeability: | -5.048 | MDCK Permeability: | 0.00002420 |
Pgp-inhibitor: | 0.008 | Pgp-substrate: | 0.002 |
Human Intestinal Absorption (HIA): | 0.057 | 20% Bioavailability (F20%): | 0.832 |
30% Bioavailability (F30%): | 0.017 |
Blood-Brain-Barrier Penetration (BBB): | 0.12 | Plasma Protein Binding (PPB): | 95.59% |
Volume Distribution (VD): | 0.597 | Fu: | 2.85% |
CYP1A2-inhibitor: | 0.699 | CYP1A2-substrate: | 0.251 |
CYP2C19-inhibitor: | 0.861 | CYP2C19-substrate: | 0.218 |
CYP2C9-inhibitor: | 0.862 | CYP2C9-substrate: | 0.939 |
CYP2D6-inhibitor: | 0.914 | CYP2D6-substrate: | 0.366 |
CYP3A4-inhibitor: | 0.86 | CYP3A4-substrate: | 0.376 |
Clearance (CL): | 3.626 | Half-life (T1/2): | 0.703 |
hERG Blockers: | 0.142 | Human Hepatotoxicity (H-HT): | 0.833 |
Drug-inuced Liver Injury (DILI): | 0.146 | AMES Toxicity: | 0.071 |
Rat Oral Acute Toxicity: | 0.073 | Maximum Recommended Daily Dose: | 0.975 |
Skin Sensitization: | 0.928 | Carcinogencity: | 0.57 |
Eye Corrosion: | 0.231 | Eye Irritation: | 0.927 |
Respiratory Toxicity: | 0.869 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC005899 | 0.770 | D0P1FO | 0.239 | ||||
ENC001937 | 0.515 | D05VQI | 0.236 | ||||
ENC003224 | 0.495 | D0E9KA | 0.234 | ||||
ENC002973 | 0.406 | D0P0HT | 0.233 | ||||
ENC002972 | 0.398 | D0D2TN | 0.231 | ||||
ENC005503 | 0.394 | D0CZ1Q | 0.231 | ||||
ENC002788 | 0.386 | D0I5DS | 0.231 | ||||
ENC002726 | 0.382 | D04GJN | 0.231 | ||||
ENC000729 | 0.375 | D07VBA | 0.230 | ||||
ENC003952 | 0.364 | D00GOS | 0.228 |