![]() |
Name |
Stemphyltoxin III
|
Molecular Formula | C20H12O6 | |
IUPAC Name* |
(10R,11S)-5,10,17-trihydroxy-13-oxahexacyclo[9.8.1.12,6.012,14.016,20.010,21]henicosa-1(20),2(21),3,5,8,16,18-heptaene-7,15-dione
|
|
SMILES |
C1=CC(=C2C3=C1C4=C5C(=C(C=C4)O)C(=O)C=C[C@]5([C@@H]3C6C(C2=O)O6)O)O
|
|
InChI |
InChI=1S/C20H12O6/c21-9-4-2-8-7-1-3-10(22)14-12(7)16(18-19(26-18)17(14)24)20(25)6-5-11(23)13(9)15(8)20/h1-6,16,18-19,21-22,25H/t16-,18?,19?,20-/m0/s1
|
|
InChIKey |
OXZKROMWFXHLSV-ACAXCVFMSA-N
|
|
Synonyms |
Stemphyltoxin III; 102694-32-6; CCRIS 3973; Perylo(1,2-b)oxirene-7,11-dione, 7a,8a,8b,8c-tetrahydro-1,6,8c-trihydroxy-, (7aR-(7aalpha,8aalpha,8bbeta,8calpha))-; DTXSID90908001; 3,6a,10-trihydroxy-4,9-dioxo-4,6a,6b,7,8,9-hexahydro-7,8-epoxyperylene; Perylo(1,2-b)oxirane-7,11-dione, 7a,8a,8b,8c-tetrahydro-1,6,8c-trihydroxy-, (7aalpha,8aalpha,8balpha,8calpha)-(+)-; 1,6,8c-Trihydroxy-7a,8a,8b,8c-tetrahydroperylo[1,2-b]oxirene-7,11-dione; (10R,11S)-5,10,17-trihydroxy-13-oxahexacyclo[9.8.1.12,6.012,14.016,20.010,21]henicosa-1(20),2(21),3,5,8,16,18-heptaene-7,15-dione
|
|
CAS | 102694-32-6 | |
PubChem CID | 128155 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 348.3 | ALogp: | 2.1 |
HBD: | 3 | HBA: | 6 |
Rotatable Bonds: | 0 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 107.0 | Aromatic Rings: | 6 |
Heavy Atoms: | 26 | QED Weighted: | 0.631 |
Caco-2 Permeability: | -5.207 | MDCK Permeability: | 0.00000895 |
Pgp-inhibitor: | 0.006 | Pgp-substrate: | 0.001 |
Human Intestinal Absorption (HIA): | 0.037 | 20% Bioavailability (F20%): | 0.008 |
30% Bioavailability (F30%): | 0.415 |
Blood-Brain-Barrier Penetration (BBB): | 0.032 | Plasma Protein Binding (PPB): | 97.56% |
Volume Distribution (VD): | 0.5 | Fu: | 1.53% |
CYP1A2-inhibitor: | 0.362 | CYP1A2-substrate: | 0.098 |
CYP2C19-inhibitor: | 0.254 | CYP2C19-substrate: | 0.059 |
CYP2C9-inhibitor: | 0.691 | CYP2C9-substrate: | 0.682 |
CYP2D6-inhibitor: | 0.708 | CYP2D6-substrate: | 0.148 |
CYP3A4-inhibitor: | 0.77 | CYP3A4-substrate: | 0.163 |
Clearance (CL): | 0.666 | Half-life (T1/2): | 0.027 |
hERG Blockers: | 0.086 | Human Hepatotoxicity (H-HT): | 0.193 |
Drug-inuced Liver Injury (DILI): | 0.544 | AMES Toxicity: | 0.932 |
Rat Oral Acute Toxicity: | 0.64 | Maximum Recommended Daily Dose: | 0.912 |
Skin Sensitization: | 0.881 | Carcinogencity: | 0.666 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.506 |
Respiratory Toxicity: | 0.255 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC000881 | ![]() |
0.726 | D0R9WP | ![]() |
0.276 | ||
ENC000841 | ![]() |
0.698 | D0H1AR | ![]() |
0.276 | ||
ENC005311 | ![]() |
0.515 | D0AZ8C | ![]() |
0.276 | ||
ENC003652 | ![]() |
0.515 | D01XDL | ![]() |
0.276 | ||
ENC003252 | ![]() |
0.515 | D0R3JB | ![]() |
0.273 | ||
ENC005389 | ![]() |
0.510 | D07JHH | ![]() |
0.272 | ||
ENC000835 | ![]() |
0.510 | D0R6RC | ![]() |
0.272 | ||
ENC002281 | ![]() |
0.480 | D04AIT | ![]() |
0.272 | ||
ENC003841 | ![]() |
0.475 | D0K8KX | ![]() |
0.267 | ||
ENC002125 | ![]() |
0.420 | D0J2NK | ![]() |
0.262 |