![]() |
Name |
2-Palmitoylglycerol
|
Molecular Formula | C19H38O4 | |
IUPAC Name* |
1,3-dihydroxypropan-2-yl hexadecanoate
|
|
SMILES |
CCCCCCCCCCCCCCCC(=O)OC(CO)CO
|
|
InChI |
InChI=1S/C19H38O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-19(22)23-18(16-20)17-21/h18,20-21H,2-17H2,1H3
|
|
InChIKey |
BBNYCLAREVXOSG-UHFFFAOYSA-N
|
|
Synonyms |
2-Palmitoylglycerol; 2-Monopalmitin; 23470-00-0; 2-Monopalmitoylglycerol; 1,3-dihydroxypropan-2-yl palmitate; 2-palmitoyl-glycerol; 2-Hexadecanoyl glycerol; 1,3-dihydroxypropan-2-yl hexadecanoate; Glycerol, 2-palmitate; Palmitin, 2-mono; 2-Monopalmitoyl-sn-glycerol; Glyceryl 2-palmitate; Palmitin, 2-mono-; Hexadecanoic acid, 2-hydroxy-1-(hydroxymethyl)ethyl ester; .beta.-Monopalmitin; 2-hexadecanoyl-sn-glycerol; CHEBI:75455; MG(0:0/16:0/0:0); 21I29V2935; beta-Monopalmitin; 2-Palm-Gl; 2-Monohexadecanoylglycerol; UNII-21I29V2935; 2-hexadecanoylglycerol; 2-O-palmitoylglycerol; Glycerol 2-hexadecanoate; Glycerol .beta.-palmitate; 2-hexadecanoyl-rac-glycerol; SCHEMBL133614; QSPL 170; GLYCERYL 2-HEXADECANOATE; CHEMBL1317070; 2-Palmitoylmonoglycerol (2-PG); DTXSID30178024; Hexadecanoic Acid 2-Hydroxy-1-(hydroxymethyl)ethyl Ester; 1,3-dihydroxypropan-2-ylpalmitate; BDBM197166; Palmitic acid .beta.-monoglyceride; ZINC8022579; LMGL01010025; AKOS015951327; CS-W014504; HY-W013788; 2-Palmitoylglycerol, analytical standard; NCGC00092337-01; MAG(0:0/16:0); 2-Hydroxy-1-(hydroxymethyl)ethyl palmitate; FT-0673488; MG(0:0/16:0); P-1120; J-015121; MG (0:0/16:0/0:0); Q27145323; 2-Hydroxy-1-(hydroxymethyl)ethyl hexadecanoic acid ester; Hexadecanoic acid,2-hydroxy-1-(hydroxymethyl)ethyl ester; VLP
|
|
CAS | 23470-00-0 | |
PubChem CID | 123409 | |
ChEMBL ID | CHEMBL1317070 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 330.5 | ALogp: | 6.1 |
HBD: | 2 | HBA: | 4 |
Rotatable Bonds: | 18 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 66.8 | Aromatic Rings: | 0 |
Heavy Atoms: | 23 | QED Weighted: | 0.294 |
Caco-2 Permeability: | -4.752 | MDCK Permeability: | 0.00003650 |
Pgp-inhibitor: | 0.011 | Pgp-substrate: | 0.371 |
Human Intestinal Absorption (HIA): | 0.003 | 20% Bioavailability (F20%): | 0.178 |
30% Bioavailability (F30%): | 0.983 |
Blood-Brain-Barrier Penetration (BBB): | 0.058 | Plasma Protein Binding (PPB): | 95.95% |
Volume Distribution (VD): | 0.803 | Fu: | 2.33% |
CYP1A2-inhibitor: | 0.234 | CYP1A2-substrate: | 0.164 |
CYP2C19-inhibitor: | 0.138 | CYP2C19-substrate: | 0.051 |
CYP2C9-inhibitor: | 0.295 | CYP2C9-substrate: | 0.438 |
CYP2D6-inhibitor: | 0.007 | CYP2D6-substrate: | 0.03 |
CYP3A4-inhibitor: | 0.274 | CYP3A4-substrate: | 0.082 |
Clearance (CL): | 6.212 | Half-life (T1/2): | 0.768 |
hERG Blockers: | 0.097 | Human Hepatotoxicity (H-HT): | 0.024 |
Drug-inuced Liver Injury (DILI): | 0.053 | AMES Toxicity: | 0.008 |
Rat Oral Acute Toxicity: | 0.016 | Maximum Recommended Daily Dose: | 0.008 |
Skin Sensitization: | 0.923 | Carcinogencity: | 0.072 |
Eye Corrosion: | 0.011 | Eye Irritation: | 0.71 |
Respiratory Toxicity: | 0.153 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC001628 | ![]() |
0.766 | D07ILQ | ![]() |
0.667 | ||
ENC000484 | ![]() |
0.757 | D0O1PH | ![]() |
0.523 | ||
ENC000316 | ![]() |
0.722 | D00AOJ | ![]() |
0.517 | ||
ENC000271 | ![]() |
0.700 | D0Z5SM | ![]() |
0.506 | ||
ENC000419 | ![]() |
0.694 | D00FGR | ![]() |
0.474 | ||
ENC000496 | ![]() |
0.694 | D00MLW | ![]() |
0.447 | ||
ENC000575 | ![]() |
0.689 | D05ATI | ![]() |
0.436 | ||
ENC000280 | ![]() |
0.689 | D00STJ | ![]() |
0.398 | ||
ENC000050 | ![]() |
0.681 | D0T9TJ | ![]() |
0.393 | ||
ENC000356 | ![]() |
0.676 | D0P1RL | ![]() |
0.374 |