![]() |
Name |
Bicyclo[2.2.1]hept-5-en-2-ol
|
Molecular Formula | C7H10O | |
IUPAC Name* |
bicyclo[2.2.1]hept-5-en-2-ol
|
|
SMILES |
C1C2CC(C1C=C2)O
|
|
InChI |
InChI=1S/C7H10O/c8-7-4-5-1-2-6(7)3-5/h1-2,5-8H,3-4H2
|
|
InChIKey |
MKOSBHNWXFSHSW-UHFFFAOYSA-N
|
|
Synonyms |
Bicyclo[2.2.1]hept-5-en-2-ol; 13080-90-5; 5-Norbornene-2-ol; 5-Norbornen-2-ol; 5-Norbornen-2-ol, exo-; exo-2-Norbornenol; Bicyclo(2.2.1)hept-5-en-2-ol; Bicyclo[2.2.1]hept-5-en-2-ol, exo-; bicyclo[2.2.1)hept-5-en-2-ol; Bicyclo(2.2.1)hept-5-en-2-ol, exo-; bicyclo[2.2.1]hept-2-en-5-ol; norbornene-5-ol; Norbornen-5-ol; 5-exo-norbornenol; 2890-98-4; endo-2-Norbornenol; NSC50234; EINECS 235-987-9; exo-Dehydronorborneol; endo-Dehydronorborneol; 5-Norbornen-2-ol, endo-; ghl.PD_Mitscher_leg0.740; SCHEMBL278517; DTXSID40871953; 5-bicyclo[2.2.1]hept-2-enol; ACT03083; MFCD00167566; NSC 50234; NSC-50234; NSC108290; NSC110578; AKOS015917582; Bicyclo[2.2.1]hept-5-en-2-ol #; CS-W008466; FD14040; NSC-108290; NSC-110578; DA-17372; DS-13830; Bicyclo[2.2.1]hept-5-en-2-ol, endo-; FT-0689543; EN300-110065; A806152; A905540; 694-97-3
|
|
CAS | 13080-90-5 | |
PubChem CID | 96066 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 110.15 | ALogp: | 0.8 |
HBD: | 1 | HBA: | 1 |
Rotatable Bonds: | 0 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 20.2 | Aromatic Rings: | 2 |
Heavy Atoms: | 8 | QED Weighted: | 0.467 |
Caco-2 Permeability: | -4.417 | MDCK Permeability: | 0.00008530 |
Pgp-inhibitor: | 0 | Pgp-substrate: | 0.005 |
Human Intestinal Absorption (HIA): | 0.075 | 20% Bioavailability (F20%): | 0.007 |
30% Bioavailability (F30%): | 0.279 |
Blood-Brain-Barrier Penetration (BBB): | 0.996 | Plasma Protein Binding (PPB): | 31.42% |
Volume Distribution (VD): | 0.938 | Fu: | 54.84% |
CYP1A2-inhibitor: | 0.129 | CYP1A2-substrate: | 0.85 |
CYP2C19-inhibitor: | 0.038 | CYP2C19-substrate: | 0.67 |
CYP2C9-inhibitor: | 0.019 | CYP2C9-substrate: | 0.482 |
CYP2D6-inhibitor: | 0.012 | CYP2D6-substrate: | 0.709 |
CYP3A4-inhibitor: | 0.125 | CYP3A4-substrate: | 0.238 |
Clearance (CL): | 13.758 | Half-life (T1/2): | 0.673 |
hERG Blockers: | 0.006 | Human Hepatotoxicity (H-HT): | 0.014 |
Drug-inuced Liver Injury (DILI): | 0.032 | AMES Toxicity: | 0.048 |
Rat Oral Acute Toxicity: | 0.305 | Maximum Recommended Daily Dose: | 0.056 |
Skin Sensitization: | 0.103 | Carcinogencity: | 0.172 |
Eye Corrosion: | 0.384 | Eye Irritation: | 0.978 |
Respiratory Toxicity: | 0.144 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC002637 | ![]() |
0.296 | D0B4TN | ![]() |
0.247 | ||
ENC002165 | ![]() |
0.296 | D03CNS | ![]() |
0.236 | ||
ENC001275 | ![]() |
0.289 | D04CSZ | ![]() |
0.209 | ||
ENC005380 | ![]() |
0.260 | D0Z4EI | ![]() |
0.182 | ||
ENC001252 | ![]() |
0.256 | D07HZY | ![]() |
0.167 | ||
ENC002508 | ![]() |
0.231 | D0T3AD | ![]() |
0.167 | ||
ENC003771 | ![]() |
0.222 | D06VFO | ![]() |
0.164 | ||
ENC001433 | ![]() |
0.220 | D0YS7D | ![]() |
0.157 | ||
ENC002454 | ![]() |
0.220 | D0MU9L | ![]() |
0.156 | ||
ENC001184 | ![]() |
0.220 | D0X5XU | ![]() |
0.155 |