![]() |
Name |
Butyl isocyanatoacetate
|
Molecular Formula | C7H11NO3 | |
IUPAC Name* |
butyl 2-isocyanatoacetate
|
|
SMILES |
CCCCOC(=O)CN=C=O
|
|
InChI |
InChI=1S/C7H11NO3/c1-2-3-4-11-7(10)5-8-6-9/h2-5H2,1H3
|
|
InChIKey |
RMZSOGJUEUFCBK-UHFFFAOYSA-N
|
|
Synonyms |
Butyl isocyanatoacetate; 17046-22-9; n-Butyl isocyanatoacetate; butyl 2-isocyanatoacetate; butyl N-(oxomethylene)glycinate; Acetic acid, isocyanato-, butyl ester; isocyanatoacetic acid n-butyl ester; Acetic acid, 2-isocyanato-, butyl ester; CVM3W9Q955; NSC-518681; EINECS 241-114-2; NSC 518681; Butyl=isocyanatoacetate; UNII-CVM3W9Q955; Butyl isocyanatoacetate, 98%; SCHEMBL1493035; DTXSID1066152; butyl N-(oxomethylidene)glycinate; Isocyanatoacetic Acid Butyl Ester; ALBB-007571; ZINC1604664; GEO-03693; MFCD00041743; NSC518681; STK504631; Acetic acid,2-isocyanato-,butyl ester; AKOS005171742; (BUTOXYCARBONYL)METHYL ISOCYANATE; BS-44097; BB 0261796; FT-0627392; I0358; D91130; J-010625
|
|
CAS | 17046-22-9 | |
PubChem CID | 86921 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 157.17 | ALogp: | 2.3 |
HBD: | 0 | HBA: | 4 |
Rotatable Bonds: | 6 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 55.7 | Aromatic Rings: | 0 |
Heavy Atoms: | 11 | QED Weighted: | 0.259 |
Caco-2 Permeability: | -4.563 | MDCK Permeability: | 0.00007070 |
Pgp-inhibitor: | 0.005 | Pgp-substrate: | 0.01 |
Human Intestinal Absorption (HIA): | 0.005 | 20% Bioavailability (F20%): | 0.638 |
30% Bioavailability (F30%): | 0.856 |
Blood-Brain-Barrier Penetration (BBB): | 0.298 | Plasma Protein Binding (PPB): | 10.72% |
Volume Distribution (VD): | 1.101 | Fu: | 86.78% |
CYP1A2-inhibitor: | 0.318 | CYP1A2-substrate: | 0.325 |
CYP2C19-inhibitor: | 0.065 | CYP2C19-substrate: | 0.327 |
CYP2C9-inhibitor: | 0.009 | CYP2C9-substrate: | 0.082 |
CYP2D6-inhibitor: | 0.031 | CYP2D6-substrate: | 0.168 |
CYP3A4-inhibitor: | 0.014 | CYP3A4-substrate: | 0.18 |
Clearance (CL): | 4.997 | Half-life (T1/2): | 0.443 |
hERG Blockers: | 0.031 | Human Hepatotoxicity (H-HT): | 0.025 |
Drug-inuced Liver Injury (DILI): | 0.03 | AMES Toxicity: | 0.021 |
Rat Oral Acute Toxicity: | 0.01 | Maximum Recommended Daily Dose: | 0.011 |
Skin Sensitization: | 0.908 | Carcinogencity: | 0.286 |
Eye Corrosion: | 0.993 | Eye Irritation: | 0.942 |
Respiratory Toxicity: | 0.28 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC000245 | ![]() |
0.500 | D0AY9Q | ![]() |
0.358 | ||
ENC000602 | ![]() |
0.457 | D01QLH | ![]() |
0.333 | ||
ENC000655 | ![]() |
0.400 | D0NU2H | ![]() |
0.259 | ||
ENC000188 | ![]() |
0.400 | D02HXS | ![]() |
0.250 | ||
ENC000371 | ![]() |
0.385 | D0Y4AW | ![]() |
0.232 | ||
ENC004529 | ![]() |
0.385 | D08HQK | ![]() |
0.221 | ||
ENC000645 | ![]() |
0.383 | D0Y3KG | ![]() |
0.217 | ||
ENC000718 | ![]() |
0.378 | D0OL6O | ![]() |
0.217 | ||
ENC000726 | ![]() |
0.372 | D0H2SY | ![]() |
0.213 | ||
ENC000264 | ![]() |
0.364 | D06ORU | ![]() |
0.211 |