![]() |
Name |
Sabinene
|
Molecular Formula | C10H16 | |
IUPAC Name* |
4-methylidene-1-propan-2-ylbicyclo[3.1.0]hexane
|
|
SMILES |
CC(C)C12CCC(=C)C1C2
|
|
InChI |
InChI=1S/C10H16/c1-7(2)10-5-4-8(3)9(10)6-10/h7,9H,3-6H2,1-2H3
|
|
InChIKey |
NDVASEGYNIMXJL-UHFFFAOYSA-N
|
|
Synonyms |
SABINENE; 3387-41-5; 4(10)-Thujene; Sabinen; 4-methylidene-1-(propan-2-yl)bicyclo[3.1.0]hexane; Bicyclo[3.1.0]hexane, 4-methylene-1-(1-methylethyl)-; 1-Isopropyl-4-methylenebicyclo[3.1.0]hexane; Thuj-4(10)-ene; CHEBI:50027; THUJENE, 4(10)-; 4-methylidene-1-propan-2-ylbicyclo[3.1.0]hexane; MFCD00064917; NSC 407278; NSC-407278; (+/-)-Sabinene; 4-Methylene-1-(1-methylethyl)-bicyclo[3.1.0]hexane; Sabinene, natural, 75%; CHEMBL452687; BCP25950; NSC407278; AKOS024318970; 4(10)-Thujene pound>>Thuj-4(10)-ene; DB-048514; HY-108943; (+/-)-Sabinene 100 microg/mL in Methanol; CS-0032596; FT-0634821; FT-0674491; FT-0674492; SABINENE, 75% (STABILIZED WITH TBC); 5-isopropyl-2-methylene-bicyclo[3.1.0]hexane; E75933; EN300-250199; 387S415; Q421278; 4-methylene-1-(1-methylethyl)bicyclo[3.1.0]hexane; J-019353
|
|
CAS | 3387-41-5 | |
PubChem CID | 18818 | |
ChEMBL ID | CHEMBL452687 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 136.23 | ALogp: | 3.1 |
HBD: | 0 | HBA: | 0 |
Rotatable Bonds: | 1 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 0.0 | Aromatic Rings: | 2 |
Heavy Atoms: | 10 | QED Weighted: | 0.481 |
Caco-2 Permeability: | -4.4 | MDCK Permeability: | 0.00002310 |
Pgp-inhibitor: | 0 | Pgp-substrate: | 0 |
Human Intestinal Absorption (HIA): | 0.003 | 20% Bioavailability (F20%): | 0.304 |
30% Bioavailability (F30%): | 0.02 |
Blood-Brain-Barrier Penetration (BBB): | 0.976 | Plasma Protein Binding (PPB): | 69.45% |
Volume Distribution (VD): | 1.169 | Fu: | 29.20% |
CYP1A2-inhibitor: | 0.497 | CYP1A2-substrate: | 0.384 |
CYP2C19-inhibitor: | 0.123 | CYP2C19-substrate: | 0.9 |
CYP2C9-inhibitor: | 0.113 | CYP2C9-substrate: | 0.398 |
CYP2D6-inhibitor: | 0.045 | CYP2D6-substrate: | 0.744 |
CYP3A4-inhibitor: | 0.108 | CYP3A4-substrate: | 0.273 |
Clearance (CL): | 11.198 | Half-life (T1/2): | 0.194 |
hERG Blockers: | 0.009 | Human Hepatotoxicity (H-HT): | 0.119 |
Drug-inuced Liver Injury (DILI): | 0.155 | AMES Toxicity: | 0.029 |
Rat Oral Acute Toxicity: | 0.088 | Maximum Recommended Daily Dose: | 0.156 |
Skin Sensitization: | 0.059 | Carcinogencity: | 0.305 |
Eye Corrosion: | 0.189 | Eye Irritation: | 0.976 |
Respiratory Toxicity: | 0.305 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC000520 | ![]() |
0.421 | D0H1QY | ![]() |
0.191 | ||
ENC000653 | ![]() |
0.366 | D04CSZ | ![]() |
0.191 | ||
ENC002232 | ![]() |
0.366 | D0K5WS | ![]() |
0.180 | ||
ENC000482 | ![]() |
0.350 | D06JPB | ![]() |
0.176 | ||
ENC003109 | ![]() |
0.333 | D0G5CF | ![]() |
0.172 | ||
ENC002110 | ![]() |
0.333 | D08SVH | ![]() |
0.172 | ||
ENC002553 | ![]() |
0.308 | D0A2AJ | ![]() |
0.167 | ||
ENC002220 | ![]() |
0.302 | D08KVZ | ![]() |
0.164 | ||
ENC000388 | ![]() |
0.302 | D0TQ1G | ![]() |
0.164 | ||
ENC003098 | ![]() |
0.302 | D02VPX | ![]() |
0.163 |