![]() |
Name |
Hexamethylcyclotrisiloxane
|
Molecular Formula | C6H18O3Si3 | |
IUPAC Name* |
2,2,4,4,6,6-hexamethyl-1,3,5,2,4,6-trioxatrisilinane
|
|
SMILES |
C[Si]1(O[Si](O[Si](O1)(C)C)(C)C)C
|
|
InChI |
InChI=1S/C6H18O3Si3/c1-10(2)7-11(3,4)9-12(5,6)8-10/h1-6H3
|
|
InChIKey |
HTDJPCNNEPUOOQ-UHFFFAOYSA-N
|
|
Synonyms |
HEXAMETHYLCYCLOTRISILOXANE; 541-05-9; Cyclotrisiloxane, hexamethyl-; 2,2,4,4,6,6-Hexamethyl-1,3,5,2,4,6-trioxatrisilinane; Dimethylsiloxane cyclic trimer; CCRIS 1326; SDK 10; hexamethylcyclohexasiloxane; UNII-EPV75L8O0R; EINECS 208-765-4; AI3-62005; MFCD00005943; EPV75L8O0R; Cyclotrisiloxane, 2,2,4,4,6,6-hexamethyl-; 25084-99-5; J-200100; C6H18O3Si3; DC 246; LS 8120; DSSTox_CID_7185; EC 208-765-4; hexamethylcyclotrisiloxane d3; DSSTox_RID_78339; DSSTox_GSID_27185; SCHEMBL29235; Hexamethylcyclotrisiloxane, 98%; CHEMBL3182063; HTDJPCNNEPUOOQ-UHFFFAOYSA-; CHEBI:189167; DTXSID501337639; Tox21_303233; CH7260; AKOS008901190; ZINC169743111; NCGC00164098-01; NCGC00257091-01; AS-14775; CAS-541-05-9; hexamethyl-1,3,5,2,4,6-trioxatrisilinane; FT-0627018; H0725; 2-(boc-amino)-2-(4-hydroxyphenyl)aceticacid; Hexamethylcyclotrisiloxane, analytical standard; H11267; S09550; A923449; Q26840948; 2,2,4,4,6,6-Hexamethyl-1,3,5,2,4,6-trioxatrisilinane #
|
|
CAS | 541-05-9 | |
PubChem CID | 10914 | |
ChEMBL ID | CHEMBL3182063 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 222.46 | ALogp: | 2.2 |
HBD: | 0 | HBA: | 3 |
Rotatable Bonds: | 0 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 27.7 | Aromatic Rings: | 1 |
Heavy Atoms: | 12 | QED Weighted: | 0.59 |
Caco-2 Permeability: | -5.3 | MDCK Permeability: | 0.00005770 |
Pgp-inhibitor: | 0.052 | Pgp-substrate: | 0.007 |
Human Intestinal Absorption (HIA): | 0.074 | 20% Bioavailability (F20%): | 0.006 |
30% Bioavailability (F30%): | 0.061 |
Blood-Brain-Barrier Penetration (BBB): | 0 | Plasma Protein Binding (PPB): | 100.12% |
Volume Distribution (VD): | 1.839 | Fu: | 5.63% |
CYP1A2-inhibitor: | 0.741 | CYP1A2-substrate: | 0.967 |
CYP2C19-inhibitor: | 0.804 | CYP2C19-substrate: | 0.928 |
CYP2C9-inhibitor: | 0.329 | CYP2C9-substrate: | 0.936 |
CYP2D6-inhibitor: | 0.12 | CYP2D6-substrate: | 0.903 |
CYP3A4-inhibitor: | 0.055 | CYP3A4-substrate: | 0.11 |
Clearance (CL): | 2.231 | Half-life (T1/2): | 0.476 |
hERG Blockers: | 0.099 | Human Hepatotoxicity (H-HT): | 0.021 |
Drug-inuced Liver Injury (DILI): | 0.036 | AMES Toxicity: | 0.031 |
Rat Oral Acute Toxicity: | 0.009 | Maximum Recommended Daily Dose: | 0.151 |
Skin Sensitization: | 0.876 | Carcinogencity: | 0.089 |
Eye Corrosion: | 0.999 | Eye Irritation: | 0.997 |
Respiratory Toxicity: | 0.408 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC000385 | ![]() |
0.750 | D0U3IG | ![]() |
0.100 | ||
ENC000374 | ![]() |
0.600 | D04MWJ | ![]() |
0.096 | ||
ENC000372 | ![]() |
0.500 | D02LPF | ![]() |
0.095 | ||
ENC000236 | ![]() |
0.429 | D07VDZ | ![]() |
0.085 | ||
ENC000386 | ![]() |
0.375 | D02LTL | ![]() |
0.084 | ||
ENC000387 | ![]() |
0.333 | D05QNO | ![]() |
0.083 | ||
ENC001134 | ![]() |
0.300 | D0Y5ZA | ![]() |
0.082 | ||
ENC001171 | ![]() |
0.111 | D0QC3M | ![]() |
0.081 | ||
ENC001213 | ![]() |
0.111 | D0Q7ZQ | ![]() |
0.079 | ||
ENC006024 | ![]() |
0.109 | D0Q9HF | ![]() |
0.078 |