|
Name |
3'-Methylacetanilide
|
Molecular Formula | C9H11NO | |
IUPAC Name* |
N-(3-methylphenyl)acetamide
|
|
SMILES |
CC1=CC(=CC=C1)NC(=O)C
|
|
InChI |
InChI=1S/C9H11NO/c1-7-4-3-5-9(6-7)10-8(2)11/h3-6H,1-2H3,(H,10,11)
|
|
InChIKey |
ALMHSXDYCFOZQD-UHFFFAOYSA-N
|
|
Synonyms |
3'-Methylacetanilide; 537-92-8; N-Acetyl-m-toluidine; 3-Methylacetanilide; m-Acetotoluide; m-Acetotoluidide; N-(3-METHYLPHENYL)ACETAMIDE; m-Methylacetanilide; m-Acetotoluidine; m-Tolylacetamide; 3-Acetamidotoluene; N-m-Tolylacetamide; Aceto-m-aminotoluene; Acetamide, N-(3-methylphenyl)-; Acetotoluide; m-Acetotolidide; N-Acetyl-3-methylaniline; 1-Acetamido-3-methylbenzene; 3-ACETYLAMINOTOLUENE; NSC 3103; KY86R0888B; NSC-3103; m-Methyl acetanilide; N-Acetyl-n-toluidine; N-Acetoxy-3-toluidine; CCRIS 5955; EINECS 208-678-1; N1-(3-methylphenyl)acetamide; UNII-KY86R0888B; AI3-16907; meta-Acetotoluidide; 3\'-Methylacetanilide; DSSTox_CID_4412; DSSTox_RID_77391; M-ACETOTOLUIDE [MI]; DSSTox_GSID_24412; SCHEMBL12133; WLN: 1VMR C1; 3'-Methylacetanilide, 98%; MLS002415752; N-(3-Tolyl)acetic acid amide; N-ACETYL-META-TOLUIDINE; ACETYL-M-TOLUIDINE, N-; CHEMBL1528164; DTXSID6024412; NSC3103; HMS3039L06; ZINC153024; Tox21_200887; MFCD00014962; STK301244; AKOS003870217; AB01179; NCGC00091308-01; NCGC00091308-02; NCGC00258441-01; CAS-537-92-8; LS-13628; SMR001370913; DB-013357; A0062; CS-0204499; FT-0616116; D88205; W-105708; Q27282500; Ethyl3-(trifluoromethyl)-1,2,4-oxadiazole-5-carboxylate
|
|
CAS | 537-92-8 | |
PubChem CID | 10843 | |
ChEMBL ID | CHEMBL1528164 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 149.19 | ALogp: | 1.7 |
HBD: | 1 | HBA: | 1 |
Rotatable Bonds: | 1 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 29.1 | Aromatic Rings: | 1 |
Heavy Atoms: | 11 | QED Weighted: | 0.653 |
Caco-2 Permeability: | -4.32 | MDCK Permeability: | 0.00002970 |
Pgp-inhibitor: | 0.002 | Pgp-substrate: | 0.288 |
Human Intestinal Absorption (HIA): | 0.004 | 20% Bioavailability (F20%): | 0.005 |
30% Bioavailability (F30%): | 0.847 |
Blood-Brain-Barrier Penetration (BBB): | 0.92 | Plasma Protein Binding (PPB): | 38.90% |
Volume Distribution (VD): | 1.082 | Fu: | 54.68% |
CYP1A2-inhibitor: | 0.933 | CYP1A2-substrate: | 0.934 |
CYP2C19-inhibitor: | 0.49 | CYP2C19-substrate: | 0.839 |
CYP2C9-inhibitor: | 0.07 | CYP2C9-substrate: | 0.452 |
CYP2D6-inhibitor: | 0.045 | CYP2D6-substrate: | 0.742 |
CYP3A4-inhibitor: | 0.042 | CYP3A4-substrate: | 0.528 |
Clearance (CL): | 5.128 | Half-life (T1/2): | 0.781 |
hERG Blockers: | 0.033 | Human Hepatotoxicity (H-HT): | 0.539 |
Drug-inuced Liver Injury (DILI): | 0.53 | AMES Toxicity: | 0.194 |
Rat Oral Acute Toxicity: | 0.029 | Maximum Recommended Daily Dose: | 0.07 |
Skin Sensitization: | 0.672 | Carcinogencity: | 0.164 |
Eye Corrosion: | 0.053 | Eye Irritation: | 0.852 |
Respiratory Toxicity: | 0.031 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC000239 | 0.486 | D0U5QK | 0.463 | ||||
ENC000072 | 0.463 | D02AQY | 0.388 | ||||
ENC000414 | 0.447 | D01PJR | 0.340 | ||||
ENC000413 | 0.447 | D0J9XZ | 0.333 | ||||
ENC000106 | 0.435 | D0KD1U | 0.323 | ||||
ENC000368 | 0.425 | D06MRT | 0.322 | ||||
ENC002213 | 0.413 | D0X4ZR | 0.309 | ||||
ENC000391 | 0.404 | D06LYG | 0.298 | ||||
ENC000612 | 0.395 | D0M4VM | 0.288 | ||||
ENC002891 | 0.383 | D0X4RN | 0.288 |