![]() |
Name |
2-Ethylhexyl acetate
|
Molecular Formula | C10H20O2 | |
IUPAC Name* |
2-ethylhexyl acetate
|
|
SMILES |
CCCCC(CC)COC(=O)C
|
|
InChI |
InChI=1S/C10H20O2/c1-4-6-7-10(5-2)8-12-9(3)11/h10H,4-8H2,1-3H3
|
|
InChIKey |
WOYWLLHHWAMFCB-UHFFFAOYSA-N
|
|
Synonyms |
2-ETHYLHEXYL ACETATE; 103-09-3; Acetic acid, 2-ethylhexyl ester; 2-Ethyl-1-hexanol acetate; 2-Ethylhexyl ethanoate; 2-Ethyl-1-hexyl acetate; 2-Ethylhexanyl acetate; Acetic Acid 2-Ethylhexyl Ester; 2-Ethylhexylester kyseliny octove; .beta.-ethylhexyl acetate; ethylhexyl acetate; NSC 8897; 2C7K8OA8SB; CHEBI:87392; NSC-8897; DSSTox_CID_6694; DSSTox_RID_78185; DSSTox_GSID_26694; beta-Ethylhexyl acetate; FEMA Number 2806; Acetic acid alpha-ethylhexyl ester; CAS-103-09-3; 1219802-70-6; HSDB 2668; EINECS 203-079-1; UNII-2C7K8OA8SB; BRN 1758321; 2-Ethylhexylester kyseliny octove [Czech]; AI3-07924; 2EH Acetate; Ethyl(2)-hexyl acetate; Acetic acid 2-ethylhexyl; EC 203-079-1; OCTYL ACETATE [MI]; 2-Ethylhexyl acetate, 99%; 4-02-00-00166 (Beilstein Handbook Reference); SCHEMBL146937; Acetic acid-2-ethylhexyl ester; 2-Ethylhexyl acetate, >=99%; CHEMBL1879713; DTXSID8026694; ETHYLHEXYL ACETATE [INCI]; NSC8897; WLN: 4Y2 & 1OV1; (+/-)-ETHYLHEXYL ACETATE; 2-ETHYLHEXYL ACETATE [HSDB]; Tox21_201992; Tox21_303318; Acetic acid .alpha.-ethylhexyl ester; MFCD00027249; AKOS015915370; ETHYLHEXYL ACETATE, (+/-)-; (+/-)-2-Ethylhexyl-[d17] Acetate; CS-W016020; 1-HEXANOL, 2-ETHYL-, ACETATE; NCGC00164202-01; NCGC00164202-02; NCGC00257097-01; NCGC00259541-01; BS-14180; DB-040415; A0031; FT-0612278; A800676; Q5656537; W-108856; 2eh acetate, 2-ethylhexyl, Octyl acetate, 2-Octylacetate
|
|
CAS | 103-09-3 | |
PubChem CID | 7635 | |
ChEMBL ID | CHEMBL1879713 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 172.26 | ALogp: | 3.2 |
HBD: | 0 | HBA: | 2 |
Rotatable Bonds: | 7 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 26.3 | Aromatic Rings: | 0 |
Heavy Atoms: | 12 | QED Weighted: | 0.573 |
Caco-2 Permeability: | -4.333 | MDCK Permeability: | 0.00002500 |
Pgp-inhibitor: | 0.013 | Pgp-substrate: | 0.003 |
Human Intestinal Absorption (HIA): | 0.003 | 20% Bioavailability (F20%): | 0.816 |
30% Bioavailability (F30%): | 0.725 |
Blood-Brain-Barrier Penetration (BBB): | 0.988 | Plasma Protein Binding (PPB): | 73.84% |
Volume Distribution (VD): | 1.162 | Fu: | 26.66% |
CYP1A2-inhibitor: | 0.899 | CYP1A2-substrate: | 0.362 |
CYP2C19-inhibitor: | 0.23 | CYP2C19-substrate: | 0.69 |
CYP2C9-inhibitor: | 0.221 | CYP2C9-substrate: | 0.226 |
CYP2D6-inhibitor: | 0.42 | CYP2D6-substrate: | 0.186 |
CYP3A4-inhibitor: | 0.153 | CYP3A4-substrate: | 0.231 |
Clearance (CL): | 5.235 | Half-life (T1/2): | 0.624 |
hERG Blockers: | 0.047 | Human Hepatotoxicity (H-HT): | 0.032 |
Drug-inuced Liver Injury (DILI): | 0.079 | AMES Toxicity: | 0.009 |
Rat Oral Acute Toxicity: | 0.022 | Maximum Recommended Daily Dose: | 0.043 |
Skin Sensitization: | 0.823 | Carcinogencity: | 0.313 |
Eye Corrosion: | 0.973 | Eye Irritation: | 0.985 |
Respiratory Toxicity: | 0.62 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC000212 | ![]() |
0.675 | D0X4FM | ![]() |
0.354 | ||
ENC000220 | ![]() |
0.514 | D0ZK8H | ![]() |
0.333 | ||
ENC001899 | ![]() |
0.514 | D0Y3KG | ![]() |
0.318 | ||
ENC000543 | ![]() |
0.500 | D0Q9HF | ![]() |
0.295 | ||
ENC000833 | ![]() |
0.488 | D0Q6DX | ![]() |
0.291 | ||
ENC000849 | ![]() |
0.487 | D0VT8P | ![]() |
0.263 | ||
ENC000416 | ![]() |
0.486 | D01QLH | ![]() |
0.256 | ||
ENC000602 | ![]() |
0.472 | D0AY9Q | ![]() |
0.254 | ||
ENC002444 | ![]() |
0.455 | D08HQK | ![]() |
0.250 | ||
ENC000306 | ![]() |
0.450 | D0H2SY | ![]() |
0.240 |