![]() |
Name |
4'-Hydroxyacetophenone
|
Molecular Formula | C8H8O2 | |
IUPAC Name* |
1-(4-hydroxyphenyl)ethanone
|
|
SMILES |
CC(=O)C1=CC=C(C=C1)O
|
|
InChI |
InChI=1S/C8H8O2/c1-6(9)7-2-4-8(10)5-3-7/h2-5,10H,1H3
|
|
InChIKey |
TXFPEBPIARQUIG-UHFFFAOYSA-N
|
|
Synonyms |
4'-Hydroxyacetophenone; 99-93-4; 4-Hydroxyacetophenone; 1-(4-Hydroxyphenyl)ethanone; P-HYDROXYACETOPHENONE; 4-Acetylphenol; Piceol; Ethanone, 1-(4-hydroxyphenyl)-; p-Acetylphenol; p-Hydroxyphenyl methyl ketone; para-Hydroxyacetophenone; p-Oxyacetophenone; Methyl p-hydroxyphenyl ketone; 4-hydroxy acetophenone; Acetophenone, 4'-hydroxy-; Phenol, p-acetyl-; 1-(4-Hydroxyphenyl)Ethan-1-One; (4-Hydroxyphenyl)ethan-1-one; Acetophenone, p-hydroxy-; USAF KF-15; 4-Acetophenol; HYDROXYACETOPHENONE, PARA; 4-Hydroksyacetofenol; 4'-hydroxy acetophenone; 1-(4-Hydroxy-phenyl)-ethanone; NSC 3698; MFCD00002359; Paracetamol Impurity E; G1L3HT4CMH; 4-Hydroxyphenyl Methyl Ketone; CHEMBL201083; CHEBI:28032; NSC-3698; c0694; DSSTox_CID_9133; DSSTox_RID_78678; DSSTox_GSID_29133; AC6; CAS-99-93-4; Methyl-p-hydroxyphenyl ketone; 4-Hydroksyacetofenol [Polish]; 1-(4-Hydroxyphenyl)ethanone (4-Hydroxyacetophenone); EINECS 202-802-8; UNII-G1L3HT4CMH; 4-HYDROXYLACETOPHENONE; AI3-12133; p-Hydroxacetophenone; parahydroxyacetophenone; 4'-hyroxyacetophenone; p-hydroxy acetophenone; p-hydroxy-acetophenone; rho-hydroxyacetophenone; 4''-hydroxyacetophenone; Acetaminophen Impurity E; 4\'-Hydroxypropiophenone; (4-hydroxyphenyl)ethanone; bmse000593; bmse000670; bmse010030; EC 202-802-8; WLN: QR DV1; 4-HAP; SCHEMBL40866; BIDD:ER0242; 1-(4-hydroxyphenyl) ethanone; 1-(4-hydroxyphenyl)-ethanone; 4'-Hydroxyacetophenone, 99%; 278564_ALDRICH; AMY921; DTXSID0029133; FEMA NO. 4330; 1-(4-hydroxyphenyl)-1-ethanone; HYDROXYACETOPHENONE [INCI]; NSC3698; 2o48; ZINC330136; ACT01160; CS-D1120; HY-Y0073; STR01114; Tox21_200228; Tox21_303602; 4-HYDROXYACETOPHENONE [FHFI]; BDBM50177409; LT0047; STK397448; ZINC00330136; AKOS000118915; AC-6123; NCGC00248570-01; NCGC00248570-02; NCGC00257375-01; NCGC00257782-01; SY009665; 4'-Hydroxyacetophenone, analytical standard; FT-0618684; H0193; PARACETAMOL IMPURITY E [EP IMPURITY]; EN300-17800; 70H702; 4 inverted exclamation mark -Hydroxyacetophenone; AB00443569-03; A846106; AB-131/40179700; 4-(1-Hydroxyethylidene)-2,5-cyclohexadiene-1-one; Q7190613; W-100007; Z57040434; F0001-2341; 4'-Hydroxyacetophenone (Acetaminophen Impurity E), Pharmaceutical Secondary Standards; Certified Reference Material
|
|
CAS | 99-93-4 | |
PubChem CID | 7469 | |
ChEMBL ID | CHEMBL201083 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 136.15 | ALogp: | 1.4 |
HBD: | 1 | HBA: | 2 |
Rotatable Bonds: | 1 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 37.3 | Aromatic Rings: | 1 |
Heavy Atoms: | 10 | QED Weighted: | 0.6 |
Caco-2 Permeability: | -4.411 | MDCK Permeability: | 0.00001900 |
Pgp-inhibitor: | 0 | Pgp-substrate: | 0.01 |
Human Intestinal Absorption (HIA): | 0.005 | 20% Bioavailability (F20%): | 0.004 |
30% Bioavailability (F30%): | 0.007 |
Blood-Brain-Barrier Penetration (BBB): | 0.218 | Plasma Protein Binding (PPB): | 63.27% |
Volume Distribution (VD): | 0.675 | Fu: | 33.78% |
CYP1A2-inhibitor: | 0.942 | CYP1A2-substrate: | 0.55 |
CYP2C19-inhibitor: | 0.565 | CYP2C19-substrate: | 0.085 |
CYP2C9-inhibitor: | 0.135 | CYP2C9-substrate: | 0.897 |
CYP2D6-inhibitor: | 0.08 | CYP2D6-substrate: | 0.708 |
CYP3A4-inhibitor: | 0.083 | CYP3A4-substrate: | 0.282 |
Clearance (CL): | 9.422 | Half-life (T1/2): | 0.877 |
hERG Blockers: | 0.04 | Human Hepatotoxicity (H-HT): | 0.033 |
Drug-inuced Liver Injury (DILI): | 0.574 | AMES Toxicity: | 0.066 |
Rat Oral Acute Toxicity: | 0.538 | Maximum Recommended Daily Dose: | 0.019 |
Skin Sensitization: | 0.283 | Carcinogencity: | 0.638 |
Eye Corrosion: | 0.899 | Eye Irritation: | 0.994 |
Respiratory Toxicity: | 0.295 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC000007 | ![]() |
0.688 | D0U5QK | ![]() |
0.583 | ||
ENC000665 | ![]() |
0.688 | D03UOT | ![]() |
0.485 | ||
ENC000195 | ![]() |
0.676 | D02WAB | ![]() |
0.455 | ||
ENC000201 | ![]() |
0.583 | D0B3QM | ![]() |
0.455 | ||
ENC000072 | ![]() |
0.583 | D01CRB | ![]() |
0.442 | ||
ENC005097 | ![]() |
0.579 | D0W1RY | ![]() |
0.415 | ||
ENC000468 | ![]() |
0.553 | D0Q8ZX | ![]() |
0.395 | ||
ENC000086 | ![]() |
0.531 | D09ZQN | ![]() |
0.339 | ||
ENC000006 | ![]() |
0.500 | D0Y2NE | ![]() |
0.339 | ||
ENC004860 | ![]() |
0.500 | D0S2BV | ![]() |
0.327 |