|
Name |
Pretrichodermamide G
|
Molecular Formula | C20H22N2O9S2 | |
IUPAC Name* |
3,6,7-trihydroxy-13-(2-hydroxy-3,4-dimethoxyphenyl)-9-oxa-14,15-dithia-10,17-diazatetracyclo[10.3.2.01,10.03,8]heptadec-4-ene-11,16-dione
|
|
SMILES |
COc1ccc(C2SSC34CC5(O)C=CC(O)C(O)C5ON3C(=O)C2NC4=O)c(O)c1OC
|
|
InChI |
InChI=1S/C20H22N2O9S2/c1-29-10-4-3-8(12(24)14(10)30-2)15-11-17(26)22-20(33-32-15,18(27)21-11)7-19(28)6-5-9(23)13(25)16(19)31-22/h3-6,9,11,13,15-16,23-25,28H,7H2,1-2H3,(H,21,27)/t9-,11-,13-,15+,16+,19-,20-/m1/s1
|
|
InChIKey |
DMZZAWPFZREPRZ-WKCQQSJXSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 498.54 | ALogp: | -0.4 |
HBD: | 5 | HBA: | 11 |
Rotatable Bonds: | 3 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 158.0 | Aromatic Rings: | 6 |
Heavy Atoms: | 33 | QED Weighted: | 0.283 |
Caco-2 Permeability: | -5.839 | MDCK Permeability: | 0.00000549 |
Pgp-inhibitor: | 0.002 | Pgp-substrate: | 0.283 |
Human Intestinal Absorption (HIA): | 0.885 | 20% Bioavailability (F20%): | 0.819 |
30% Bioavailability (F30%): | 0.987 |
Blood-Brain-Barrier Penetration (BBB): | 0.329 | Plasma Protein Binding (PPB): | 78.73% |
Volume Distribution (VD): | 0.548 | Fu: | 14.01% |
CYP1A2-inhibitor: | 0.011 | CYP1A2-substrate: | 0.645 |
CYP2C19-inhibitor: | 0.059 | CYP2C19-substrate: | 0.825 |
CYP2C9-inhibitor: | 0.064 | CYP2C9-substrate: | 0.755 |
CYP2D6-inhibitor: | 0.004 | CYP2D6-substrate: | 0.186 |
CYP3A4-inhibitor: | 0.367 | CYP3A4-substrate: | 0.499 |
Clearance (CL): | 4.092 | Half-life (T1/2): | 0.237 |
hERG Blockers: | 0.002 | Human Hepatotoxicity (H-HT): | 0.167 |
Drug-inuced Liver Injury (DILI): | 0.968 | AMES Toxicity: | 0.191 |
Rat Oral Acute Toxicity: | 0.811 | Maximum Recommended Daily Dose: | 0.036 |
Skin Sensitization: | 0.024 | Carcinogencity: | 0.891 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.005 |
Respiratory Toxicity: | 0.603 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC003659 | 0.802 | D01XWG | 0.260 | ||||
ENC003545 | 0.480 | D0L1JW | 0.257 | ||||
ENC004276 | 0.475 | D07VLY | 0.255 | ||||
ENC003540 | 0.457 | D0C9XJ | 0.255 | ||||
ENC003544 | 0.457 | D03DIG | 0.252 | ||||
ENC003738 | 0.430 | D06GCK | 0.250 | ||||
ENC004280 | 0.419 | D04TDQ | 0.239 | ||||
ENC004279 | 0.419 | D01XDL | 0.235 | ||||
ENC004278 | 0.419 | D0D4HN | 0.231 | ||||
ENC004281 | 0.419 | D06TQZ | 0.229 |