|
Name |
Koninginin W
|
Molecular Formula | C16H26O4 | |
IUPAC Name* |
2-(5-hexyl-4-hydroxyoxolan-2-yl)-4-hydroxycyclohex-2-en-1-one
|
|
SMILES |
CCCCCCC1OC(C2=CC(O)CCC2=O)CC1O
|
|
InChI |
InChI=1S/C16H26O4/c1-2-3-4-5-6-15-14(19)10-16(20-15)12-9-11(17)7-8-13(12)18/h9,11,14-17,19H,2-8,10H2,1H3/t11-,14-,15-,16+/m0/s1
|
|
InChIKey |
LOLGDEXQRRBZMU-VCOSZWKGSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 282.38 | ALogp: | 2.1 |
HBD: | 2 | HBA: | 4 |
Rotatable Bonds: | 6 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 66.8 | Aromatic Rings: | 2 |
Heavy Atoms: | 20 | QED Weighted: | 0.735 |
Caco-2 Permeability: | -4.687 | MDCK Permeability: | 0.00002880 |
Pgp-inhibitor: | 0.767 | Pgp-substrate: | 0.089 |
Human Intestinal Absorption (HIA): | 0.133 | 20% Bioavailability (F20%): | 0.951 |
30% Bioavailability (F30%): | 0.469 |
Blood-Brain-Barrier Penetration (BBB): | 0.83 | Plasma Protein Binding (PPB): | 58.85% |
Volume Distribution (VD): | 0.99 | Fu: | 32.00% |
CYP1A2-inhibitor: | 0.016 | CYP1A2-substrate: | 0.478 |
CYP2C19-inhibitor: | 0.026 | CYP2C19-substrate: | 0.542 |
CYP2C9-inhibitor: | 0.018 | CYP2C9-substrate: | 0.807 |
CYP2D6-inhibitor: | 0.002 | CYP2D6-substrate: | 0.695 |
CYP3A4-inhibitor: | 0.021 | CYP3A4-substrate: | 0.124 |
Clearance (CL): | 11.353 | Half-life (T1/2): | 0.814 |
hERG Blockers: | 0.023 | Human Hepatotoxicity (H-HT): | 0.263 |
Drug-inuced Liver Injury (DILI): | 0.2 | AMES Toxicity: | 0.193 |
Rat Oral Acute Toxicity: | 0.794 | Maximum Recommended Daily Dose: | 0.278 |
Skin Sensitization: | 0.103 | Carcinogencity: | 0.267 |
Eye Corrosion: | 0.004 | Eye Irritation: | 0.109 |
Respiratory Toxicity: | 0.105 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC005833 | 0.459 | D0XN8C | 0.307 | ||||
ENC002090 | 0.425 | D0I4DQ | 0.276 | ||||
ENC005832 | 0.395 | D00CTS | 0.275 | ||||
ENC002066 | 0.395 | D0L7AS | 0.275 | ||||
ENC002691 | 0.393 | D01WUA | 0.274 | ||||
ENC003134 | 0.390 | D0V0IX | 0.273 | ||||
ENC005834 | 0.384 | D00HCQ | 0.265 | ||||
ENC002146 | 0.383 | D09SRR | 0.260 | ||||
ENC005927 | 0.383 | D09ANG | 0.250 | ||||
ENC002643 | 0.383 | D0HR8Z | 0.247 |