|
Name |
koninginin Q
|
Molecular Formula | C17H28O5 | |
IUPAC Name* |
6-hydroxy-2-(1-hydroxyheptyl)-4-methoxy-2,3,4,6,7,8-hexahydrochromen-5-one
|
|
SMILES |
CCCCCCC(O)C1CC(OC)C2=C(CCC(O)C2=O)O1
|
|
InChI |
InChI=1S/C17H28O5/c1-3-4-5-6-7-11(18)14-10-15(21-2)16-13(22-14)9-8-12(19)17(16)20/h11-12,14-15,18-19H,3-10H2,1-2H3/t11-,12-,14-,15+/m0/s1
|
|
InChIKey |
ZGBVAAJYWMQSFD-NZBPQXDJSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 312.41 | ALogp: | 2.1 |
HBD: | 2 | HBA: | 5 |
Rotatable Bonds: | 7 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 76.0 | Aromatic Rings: | 2 |
Heavy Atoms: | 22 | QED Weighted: | 0.707 |
Caco-2 Permeability: | -4.67 | MDCK Permeability: | 0.00003400 |
Pgp-inhibitor: | 0.569 | Pgp-substrate: | 0.006 |
Human Intestinal Absorption (HIA): | 0.17 | 20% Bioavailability (F20%): | 0.092 |
30% Bioavailability (F30%): | 0.278 |
Blood-Brain-Barrier Penetration (BBB): | 0.813 | Plasma Protein Binding (PPB): | 77.71% |
Volume Distribution (VD): | 0.594 | Fu: | 18.93% |
CYP1A2-inhibitor: | 0.014 | CYP1A2-substrate: | 0.329 |
CYP2C19-inhibitor: | 0.048 | CYP2C19-substrate: | 0.781 |
CYP2C9-inhibitor: | 0.027 | CYP2C9-substrate: | 0.099 |
CYP2D6-inhibitor: | 0.006 | CYP2D6-substrate: | 0.211 |
CYP3A4-inhibitor: | 0.034 | CYP3A4-substrate: | 0.269 |
Clearance (CL): | 11.139 | Half-life (T1/2): | 0.283 |
hERG Blockers: | 0.029 | Human Hepatotoxicity (H-HT): | 0.184 |
Drug-inuced Liver Injury (DILI): | 0.215 | AMES Toxicity: | 0.384 |
Rat Oral Acute Toxicity: | 0.669 | Maximum Recommended Daily Dose: | 0.292 |
Skin Sensitization: | 0.517 | Carcinogencity: | 0.196 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.122 |
Respiratory Toxicity: | 0.171 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC005892 | 1.000 | D0V0IX | 0.297 | ||||
ENC003134 | 0.776 | D01WUA | 0.284 | ||||
ENC002691 | 0.768 | D0I4DQ | 0.275 | ||||
ENC003975 | 0.628 | D0L7AS | 0.274 | ||||
ENC002090 | 0.608 | D06FEA | 0.262 | ||||
ENC002643 | 0.539 | D0XN8C | 0.250 | ||||
ENC005927 | 0.539 | D0ZI4H | 0.250 | ||||
ENC002146 | 0.539 | D00HCQ | 0.240 | ||||
ENC005893 | 0.524 | D09ANG | 0.239 | ||||
ENC005888 | 0.490 | D00CTS | 0.239 |