|
Name |
Vaccinol K
|
Molecular Formula | C14H18O4 | |
IUPAC Name* |
2-(3,4-dihydroxyhept-1-enyl)-6-hydroxybenzaldehyde
|
|
SMILES |
CCCC(O)C(O)C=Cc1cccc(O)c1C=O
|
|
InChI |
InChI=1S/C14H18O4/c1-2-4-13(17)14(18)8-7-10-5-3-6-12(16)11(10)9-15/h3,5-9,13-14,16-18H,2,4H2,1H3/b8-7+/t13-,14+/m0/s1
|
|
InChIKey |
FQVVYSGJJLYYAS-JYASZMECSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 250.29 | ALogp: | 1.7 |
HBD: | 3 | HBA: | 4 |
Rotatable Bonds: | 6 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 77.8 | Aromatic Rings: | 1 |
Heavy Atoms: | 18 | QED Weighted: | 0.677 |
Caco-2 Permeability: | -4.529 | MDCK Permeability: | 0.00001970 |
Pgp-inhibitor: | 0.01 | Pgp-substrate: | 0.004 |
Human Intestinal Absorption (HIA): | 0.288 | 20% Bioavailability (F20%): | 0.446 |
30% Bioavailability (F30%): | 0.958 |
Blood-Brain-Barrier Penetration (BBB): | 0.697 | Plasma Protein Binding (PPB): | 56.60% |
Volume Distribution (VD): | 0.435 | Fu: | 38.01% |
CYP1A2-inhibitor: | 0.484 | CYP1A2-substrate: | 0.489 |
CYP2C19-inhibitor: | 0.272 | CYP2C19-substrate: | 0.111 |
CYP2C9-inhibitor: | 0.098 | CYP2C9-substrate: | 0.671 |
CYP2D6-inhibitor: | 0.14 | CYP2D6-substrate: | 0.578 |
CYP3A4-inhibitor: | 0.042 | CYP3A4-substrate: | 0.262 |
Clearance (CL): | 10.82 | Half-life (T1/2): | 0.939 |
hERG Blockers: | 0.03 | Human Hepatotoxicity (H-HT): | 0.06 |
Drug-inuced Liver Injury (DILI): | 0.203 | AMES Toxicity: | 0.754 |
Rat Oral Acute Toxicity: | 0.221 | Maximum Recommended Daily Dose: | 0.013 |
Skin Sensitization: | 0.676 | Carcinogencity: | 0.122 |
Eye Corrosion: | 0.016 | Eye Irritation: | 0.915 |
Respiratory Toxicity: | 0.049 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC005354 | 0.736 | D0E9CD | 0.254 | ||||
ENC003578 | 0.574 | D0V9EN | 0.254 | ||||
ENC004301 | 0.533 | D04PHC | 0.254 | ||||
ENC001866 | 0.508 | D0I8FI | 0.254 | ||||
ENC005355 | 0.508 | D08HUC | 0.253 | ||||
ENC005508 | 0.493 | D07MOX | 0.246 | ||||
ENC004302 | 0.373 | D04EYC | 0.246 | ||||
ENC002694 | 0.371 | D0O6IU | 0.242 | ||||
ENC005504 | 0.364 | D0YF3X | 0.240 | ||||
ENC004381 | 0.362 | D0I3RO | 0.239 |