NPs Basic Information
|
Name |
phomopchalasin C4
|
| Molecular Formula | C28H37NO3 | |
| IUPAC Name* |
16-benzyl-2,12-dihydroxy-5,7,13,14-tetramethyl-17-azatricyclo[9.7.0.01,15]octadeca-3,9,13-trien-18-one
|
|
| SMILES |
CC1=C(C)C2C(Cc3ccccc3)NC(=O)C23C(O)C=CC(C)CC(C)CC=CC3C1O
|
|
| InChI |
InChI=1S/C28H37NO3/c1-17-9-8-12-22-26(31)20(4)19(3)25-23(16-21-10-6-5-7-11-21)29-27(32)28(22,25)24(30)14-13-18(2)15-17/h5-8,10-14,17-18,22-26,30-31H,9,15-16H2,1-4H3,(H,29,32)/b12-8+,14-13+/t17-,18?,22-,23-,24+,25-,26+,28+/m0/s1
|
|
| InChIKey |
FLVNEDIENMGZKO-DQPHLKHISA-N
|
|
| Synonyms |
NA
|
|
| CAS | NA | |
| PubChem CID | NA | |
| ChEMBL ID | NA |
*Note: the IUPAC Name was calculated by STOUT. Reference: PMID:33906675.
Chemical Classification: |
|
|
|---|
——————————————————————————————————————————
NPs Species Source
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
NPs Biological Activity
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
NPs Physi-Chem Properties
| Molecular Weight: | 435.61 | ALogp: | 4.2 |
| HBD: | 3 | HBA: | 3 |
| Rotatable Bonds: | 2 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 69.6 | Aromatic Rings: | 4 |
| Heavy Atoms: | 32 | QED Weighted: | 0.586 |
——————————————————————————————————————————
NPs ADMET Properties*
ADMET: Absorption
| Caco-2 Permeability: | -4.919 | MDCK Permeability: | 0.00007880 |
| Pgp-inhibitor: | 0.078 | Pgp-substrate: | 0.53 |
| Human Intestinal Absorption (HIA): | 0.103 | 20% Bioavailability (F20%): | 0.007 |
| 30% Bioavailability (F30%): | 0.005 |
——————————————————————————————————————————
ADMET: Distribution
| Blood-Brain-Barrier Penetration (BBB): | 0.973 | Plasma Protein Binding (PPB): | 97.51% |
| Volume Distribution (VD): | 1.616 | Fu: | 2.10% |
——————————————————————————————————————————
ADMET: Metabolism
| CYP1A2-inhibitor: | 0.041 | CYP1A2-substrate: | 0.403 |
| CYP2C19-inhibitor: | 0.476 | CYP2C19-substrate: | 0.408 |
| CYP2C9-inhibitor: | 0.595 | CYP2C9-substrate: | 0.816 |
| CYP2D6-inhibitor: | 0.081 | CYP2D6-substrate: | 0.775 |
| CYP3A4-inhibitor: | 0.876 | CYP3A4-substrate: | 0.465 |
——————————————————————————————————————————
ADMET: Excretion
| Clearance (CL): | 12.777 | Half-life (T1/2): | 0.019 |
——————————————————————————————————————————
ADMET: Toxicity
| hERG Blockers: | 0.014 | Human Hepatotoxicity (H-HT): | 0.009 |
| Drug-inuced Liver Injury (DILI): | 0.028 | AMES Toxicity: | 0.014 |
| Rat Oral Acute Toxicity: | 0.348 | Maximum Recommended Daily Dose: | 0.474 |
| Skin Sensitization: | 0.025 | Carcinogencity: | 0.023 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.006 |
| Respiratory Toxicity: | 0.907 |
——————————————————————————————————————————
*Note: the ADMET properties was calculated by ADMETlab 2.0. Reference: PMID: 33893803.
Similar Compounds*
Compounds similar to EMNPD with top10 similarity:
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
 |
D0I0DL |  |
0.254 | ||||
|
D0SP3D |  |
0.247 | ||||
|
D09NNH |  |
0.247 | ||||
|
D0V3ZA |  |
0.247 | ||||
|
D06CWH |  |
0.245 | ||||
|
D0IN7I |  |
0.241 | ||||
|
D0UA0I |  |
0.239 | ||||
|
D0D7KC |  |
0.239 | ||||
|
D01TSI |  |
0.233 | ||||
|
D0H6TP |  |
0.231 | ||||