NPs Basic Information
|
Name |
botryospyrone A
|
| Molecular Formula | C11H10O5 | |
| IUPAC Name* |
6,7,8-trihydroxy-3,5-dimethylisochromen-1-one
|
|
| SMILES |
Cc1cc2c(C)c(O)c(O)c(O)c2c(=O)o1
|
|
| InChI |
InChI=1S/C11H10O5/c1-4-3-6-5(2)8(12)10(14)9(13)7(6)11(15)16-4/h3,12-14H,1-2H3
|
|
| InChIKey |
QVTZZFBNMCZBHZ-UHFFFAOYSA-N
|
|
| Synonyms |
NA
|
|
| CAS | NA | |
| PubChem CID | NA | |
| ChEMBL ID | NA |
*Note: the IUPAC Name was calculated by STOUT. Reference: PMID:33906675.
Chemical Classification: |
|
|
|---|
——————————————————————————————————————————
NPs Species Source
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
NPs Biological Activity
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
NPs Physi-Chem Properties
| Molecular Weight: | 222.2 | ALogp: | 1.5 |
| HBD: | 3 | HBA: | 5 |
| Rotatable Bonds: | 0 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 90.9 | Aromatic Rings: | 2 |
| Heavy Atoms: | 16 | QED Weighted: | 0.593 |
——————————————————————————————————————————
NPs ADMET Properties*
ADMET: Absorption
| Caco-2 Permeability: | -4.991 | MDCK Permeability: | 0.00000844 |
| Pgp-inhibitor: | 0.002 | Pgp-substrate: | 0.726 |
| Human Intestinal Absorption (HIA): | 0.028 | 20% Bioavailability (F20%): | 0.09 |
| 30% Bioavailability (F30%): | 0.926 |
——————————————————————————————————————————
ADMET: Distribution
| Blood-Brain-Barrier Penetration (BBB): | 0.021 | Plasma Protein Binding (PPB): | 94.62% |
| Volume Distribution (VD): | 0.47 | Fu: | 9.29% |
——————————————————————————————————————————
ADMET: Metabolism
| CYP1A2-inhibitor: | 0.816 | CYP1A2-substrate: | 0.933 |
| CYP2C19-inhibitor: | 0.03 | CYP2C19-substrate: | 0.099 |
| CYP2C9-inhibitor: | 0.333 | CYP2C9-substrate: | 0.619 |
| CYP2D6-inhibitor: | 0.084 | CYP2D6-substrate: | 0.215 |
| CYP3A4-inhibitor: | 0.04 | CYP3A4-substrate: | 0.1 |
——————————————————————————————————————————
ADMET: Excretion
| Clearance (CL): | 5.421 | Half-life (T1/2): | 0.882 |
——————————————————————————————————————————
ADMET: Toxicity
| hERG Blockers: | 0.029 | Human Hepatotoxicity (H-HT): | 0.1 |
| Drug-inuced Liver Injury (DILI): | 0.951 | AMES Toxicity: | 0.064 |
| Rat Oral Acute Toxicity: | 0.099 | Maximum Recommended Daily Dose: | 0.647 |
| Skin Sensitization: | 0.926 | Carcinogencity: | 0.06 |
| Eye Corrosion: | 0.07 | Eye Irritation: | 0.939 |
| Respiratory Toxicity: | 0.081 |
——————————————————————————————————————————
*Note: the ADMET properties was calculated by ADMETlab 2.0. Reference: PMID: 33893803.
Similar Compounds*
Compounds similar to EMNPD with top10 similarity:
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC001940 |  |
0.608 | D0FA2O |  |
0.328 | ||
| ENC003370 |  |
0.556 | D0G4KG |  |
0.284 | ||
| ENC005334 |  |
0.554 | D0K8KX |  |
0.275 | ||
| ENC004786 |  |
0.500 | D04AIT |  |
0.266 | ||
| ENC004675 |  |
0.491 | D06GCK |  |
0.247 | ||
| ENC001518 |  |
0.464 | D07MGA |  |
0.241 | ||
| ENC005125 |  |
0.447 | D02TJS |  |
0.228 | ||
| ENC005327 |  |
0.444 | D0O6KE |  |
0.228 | ||
| ENC001622 |  |
0.439 | D0JO3U |  |
0.225 | ||
| ENC004984 |  |
0.436 | D0WY9N |  |
0.215 | ||