|
Name |
pestalotinone D
|
Molecular Formula | C19H16Cl2O5 | |
IUPAC Name* |
2,4-dichloro-1,5,7-trihydroxy-3-methyl-8-(3-methylbut-2-enyl)xanthen-9-one
|
|
SMILES |
CC(C)=CCc1c(O)cc(O)c2oc3c(Cl)c(C)c(Cl)c(O)c3c(=O)c12
|
|
InChI |
InChI=1S/C19H16Cl2O5/c1-7(2)4-5-9-10(22)6-11(23)18-12(9)16(24)13-17(25)14(20)8(3)15(21)19(13)26-18/h4,6,22-23,25H,5H2,1-3H3
|
|
InChIKey |
XQHBJRSJCFGLJD-UHFFFAOYSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 395.24 | ALogp: | 5.2 |
HBD: | 3 | HBA: | 5 |
Rotatable Bonds: | 2 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 90.9 | Aromatic Rings: | 3 |
Heavy Atoms: | 26 | QED Weighted: | 0.395 |
Caco-2 Permeability: | -4.885 | MDCK Permeability: | 0.00001210 |
Pgp-inhibitor: | 0.085 | Pgp-substrate: | 0.005 |
Human Intestinal Absorption (HIA): | 0.194 | 20% Bioavailability (F20%): | 0.041 |
30% Bioavailability (F30%): | 0.125 |
Blood-Brain-Barrier Penetration (BBB): | 0.033 | Plasma Protein Binding (PPB): | 97.70% |
Volume Distribution (VD): | 0.794 | Fu: | 4.24% |
CYP1A2-inhibitor: | 0.677 | CYP1A2-substrate: | 0.449 |
CYP2C19-inhibitor: | 0.388 | CYP2C19-substrate: | 0.063 |
CYP2C9-inhibitor: | 0.858 | CYP2C9-substrate: | 0.881 |
CYP2D6-inhibitor: | 0.076 | CYP2D6-substrate: | 0.159 |
CYP3A4-inhibitor: | 0.086 | CYP3A4-substrate: | 0.072 |
Clearance (CL): | 4.713 | Half-life (T1/2): | 0.314 |
hERG Blockers: | 0.002 | Human Hepatotoxicity (H-HT): | 0.837 |
Drug-inuced Liver Injury (DILI): | 0.985 | AMES Toxicity: | 0.382 |
Rat Oral Acute Toxicity: | 0.539 | Maximum Recommended Daily Dose: | 0.637 |
Skin Sensitization: | 0.781 | Carcinogencity: | 0.336 |
Eye Corrosion: | 0.006 | Eye Irritation: | 0.895 |
Respiratory Toxicity: | 0.466 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC002644 | 0.602 | D0K8KX | 0.265 | ||||
ENC004842 | 0.543 | D0Q0PR | 0.262 | ||||
ENC001976 | 0.526 | D0ZX2G | 0.253 | ||||
ENC004839 | 0.516 | D04AIT | 0.233 | ||||
ENC004838 | 0.510 | D06GCK | 0.232 | ||||
ENC004840 | 0.479 | D0FA2O | 0.221 | ||||
ENC004233 | 0.443 | D0WY9N | 0.217 | ||||
ENC004238 | 0.430 | D0G4KG | 0.208 | ||||
ENC002489 | 0.406 | D0O6KE | 0.207 | ||||
ENC000884 | 0.392 | D07MGA | 0.204 |