|
Name |
5-(undeca-3′,5′,7′-trien-1′-yl)furan-2-carbonate
|
Molecular Formula | C16H20O4 | |
IUPAC Name* |
(5-undeca-3,5,7-trienylfuran-2-yl)hydrogencarbonate
|
|
SMILES |
CCCC=CC=CC=CCCc1ccc(OC(=O)O)o1
|
|
InChI |
InChI=1S/C16H20O4/c1-2-3-4-5-6-7-8-9-10-11-14-12-13-15(19-14)20-16(17)18/h4-9,12-13H,2-3,10-11H2,1H3,(H,17,18)
|
|
InChIKey |
SAGFYRGTZFFXNC-UHFFFAOYSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 276.33 | ALogp: | 4.7 |
HBD: | 1 | HBA: | 3 |
Rotatable Bonds: | 8 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 59.7 | Aromatic Rings: | 1 |
Heavy Atoms: | 20 | QED Weighted: | 0.526 |
Caco-2 Permeability: | -4.766 | MDCK Permeability: | 0.00002180 |
Pgp-inhibitor: | 0.001 | Pgp-substrate: | 0.005 |
Human Intestinal Absorption (HIA): | 0.005 | 20% Bioavailability (F20%): | 0.062 |
30% Bioavailability (F30%): | 0.132 |
Blood-Brain-Barrier Penetration (BBB): | 0.55 | Plasma Protein Binding (PPB): | 97.76% |
Volume Distribution (VD): | 0.519 | Fu: | 2.36% |
CYP1A2-inhibitor: | 0.07 | CYP1A2-substrate: | 0.572 |
CYP2C19-inhibitor: | 0.043 | CYP2C19-substrate: | 0.287 |
CYP2C9-inhibitor: | 0.144 | CYP2C9-substrate: | 0.981 |
CYP2D6-inhibitor: | 0.016 | CYP2D6-substrate: | 0.91 |
CYP3A4-inhibitor: | 0.04 | CYP3A4-substrate: | 0.141 |
Clearance (CL): | 1.886 | Half-life (T1/2): | 0.864 |
hERG Blockers: | 0.475 | Human Hepatotoxicity (H-HT): | 0.794 |
Drug-inuced Liver Injury (DILI): | 0.022 | AMES Toxicity: | 0.377 |
Rat Oral Acute Toxicity: | 0.862 | Maximum Recommended Daily Dose: | 0.939 |
Skin Sensitization: | 0.979 | Carcinogencity: | 0.545 |
Eye Corrosion: | 0.018 | Eye Irritation: | 0.044 |
Respiratory Toxicity: | 0.944 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC003481 | 0.710 | D0UE9X | 0.239 | ||||
ENC001552 | 0.390 | D0O1TC | 0.224 | ||||
ENC004536 | 0.341 | D02HXS | 0.214 | ||||
ENC004535 | 0.341 | D03LGG | 0.204 | ||||
ENC005508 | 0.317 | D0U5CE | 0.204 | ||||
ENC001600 | 0.313 | D0OR6A | 0.200 | ||||
ENC001808 | 0.313 | D0L7FM | 0.200 | ||||
ENC005507 | 0.310 | D0Q2XF | 0.193 | ||||
ENC005385 | 0.300 | D0Q5XX | 0.189 | ||||
ENC001594 | 0.295 | D06FEA | 0.189 |