|
Name |
1,2-Benzenedicarboxylicacid, bis (2-methylpropyl) ester
|
Molecular Formula | C16H20O4 | |
IUPAC Name* |
2-O-(2-methylprop-2-enyl)1-O-(2-methylpropyl)benzene-1,2-dicarboxylate
|
|
SMILES |
C=C(C)COC(=O)c1ccccc1C(=O)OCC(C)C
|
|
InChI |
InChI=1S/C16H20O4/c1-11(2)9-19-15(17)13-7-5-6-8-14(13)16(18)20-10-12(3)4/h5-8,12H,1,9-10H2,2-4H3
|
|
InChIKey |
RUGXJKRXAZIUDA-UHFFFAOYSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 276.33 | ALogp: | 3.2 |
HBD: | 0 | HBA: | 4 |
Rotatable Bonds: | 6 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 52.6 | Aromatic Rings: | 1 |
Heavy Atoms: | 20 | QED Weighted: | 0.582 |
Caco-2 Permeability: | -4.41 | MDCK Permeability: | 0.00003710 |
Pgp-inhibitor: | 0.036 | Pgp-substrate: | 0 |
Human Intestinal Absorption (HIA): | 0.003 | 20% Bioavailability (F20%): | 0.118 |
30% Bioavailability (F30%): | 0.943 |
Blood-Brain-Barrier Penetration (BBB): | 0.101 | Plasma Protein Binding (PPB): | 83.29% |
Volume Distribution (VD): | 1.405 | Fu: | 10.43% |
CYP1A2-inhibitor: | 0.814 | CYP1A2-substrate: | 0.127 |
CYP2C19-inhibitor: | 0.911 | CYP2C19-substrate: | 0.093 |
CYP2C9-inhibitor: | 0.796 | CYP2C9-substrate: | 0.23 |
CYP2D6-inhibitor: | 0.041 | CYP2D6-substrate: | 0.114 |
CYP3A4-inhibitor: | 0.074 | CYP3A4-substrate: | 0.163 |
Clearance (CL): | 12.855 | Half-life (T1/2): | 0.604 |
hERG Blockers: | 0.02 | Human Hepatotoxicity (H-HT): | 0.019 |
Drug-inuced Liver Injury (DILI): | 0.653 | AMES Toxicity: | 0.027 |
Rat Oral Acute Toxicity: | 0.008 | Maximum Recommended Daily Dose: | 0.006 |
Skin Sensitization: | 0.578 | Carcinogencity: | 0.481 |
Eye Corrosion: | 0.11 | Eye Irritation: | 0.985 |
Respiratory Toxicity: | 0.068 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC000155 | 0.714 | D0S5CU | 0.372 | ||||
ENC005690 | 0.714 | D0GY5Z | 0.348 | ||||
ENC000586 | 0.703 | D05KON | 0.329 | ||||
ENC001801 | 0.592 | D05OFX | 0.316 | ||||
ENC003076 | 0.589 | D08GJO | 0.297 | ||||
ENC000154 | 0.581 | D0FN7J | 0.295 | ||||
ENC001802 | 0.558 | D0G2MH | 0.292 | ||||
ENC000300 | 0.529 | D06LYG | 0.289 | ||||
ENC001804 | 0.515 | D0Y0JH | 0.289 | ||||
ENC001027 | 0.500 | D0RA5Q | 0.284 |