|
Name |
Pestaphilone I
|
Molecular Formula | C20H26O6 | |
IUPAC Name* |
7,8-dihydroxy-3-[2-hydroxy-4-(3-methyloxolan-2-yl)pent-3-en-2-yl]-7-methyl-8H-isochromen-6-one
|
|
SMILES |
CC(=CC(C)(O)C1=CC2=CC(=O)C(C)(O)C(O)C2=CO1)C1OCCC1C
|
|
InChI |
InChI=1S/C20H26O6/c1-11-5-6-25-17(11)12(2)9-19(3,23)16-8-13-7-15(21)20(4,24)18(22)14(13)10-26-16/h7-11,17-18,22-24H,5-6H2,1-4H3/b12-9+/t11-,17-,18+,19-,20+/m0/s1
|
|
InChIKey |
UIDQJNBCYJOAHK-QGIOBFFLSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 362.42 | ALogp: | 1.5 |
HBD: | 3 | HBA: | 6 |
Rotatable Bonds: | 3 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 96.2 | Aromatic Rings: | 3 |
Heavy Atoms: | 26 | QED Weighted: | 0.665 |
Caco-2 Permeability: | -4.844 | MDCK Permeability: | 0.00001970 |
Pgp-inhibitor: | 0.743 | Pgp-substrate: | 0.621 |
Human Intestinal Absorption (HIA): | 0.849 | 20% Bioavailability (F20%): | 0.937 |
30% Bioavailability (F30%): | 0.182 |
Blood-Brain-Barrier Penetration (BBB): | 0.936 | Plasma Protein Binding (PPB): | 73.69% |
Volume Distribution (VD): | 1.327 | Fu: | 23.52% |
CYP1A2-inhibitor: | 0.017 | CYP1A2-substrate: | 0.383 |
CYP2C19-inhibitor: | 0.035 | CYP2C19-substrate: | 0.772 |
CYP2C9-inhibitor: | 0.016 | CYP2C9-substrate: | 0.057 |
CYP2D6-inhibitor: | 0.004 | CYP2D6-substrate: | 0.053 |
CYP3A4-inhibitor: | 0.252 | CYP3A4-substrate: | 0.758 |
Clearance (CL): | 1.615 | Half-life (T1/2): | 0.385 |
hERG Blockers: | 0.109 | Human Hepatotoxicity (H-HT): | 0.9 |
Drug-inuced Liver Injury (DILI): | 0.082 | AMES Toxicity: | 0.722 |
Rat Oral Acute Toxicity: | 0.833 | Maximum Recommended Daily Dose: | 0.905 |
Skin Sensitization: | 0.682 | Carcinogencity: | 0.96 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.009 |
Respiratory Toxicity: | 0.629 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC004593 | 0.586 | D0P0HT | 0.235 | ||||
ENC004592 | 0.516 | D08PIQ | 0.222 | ||||
ENC004591 | 0.479 | D07DVK | 0.218 | ||||
ENC004589 | 0.463 | D0CW1P | 0.218 | ||||
ENC004590 | 0.458 | D0IT2G | 0.218 | ||||
ENC004586 | 0.457 | D0E9KA | 0.216 | ||||
ENC004587 | 0.429 | D0W2EK | 0.215 | ||||
ENC004588 | 0.418 | D0K7LU | 0.214 | ||||
ENC005430 | 0.359 | D0CZ1Q | 0.212 | ||||
ENC005429 | 0.359 | D0I5DS | 0.212 |