NPs Basic Information
|
Name |
Alternariainol D
|
| Molecular Formula | C24H24O6 | |
| IUPAC Name* |
3-[5-[(4-hydroxy-1,3-dihydro-2-benzofuran-1-yl)methyl]-3,6-dimethyl-1,4-dioxin-2-yl]-3,4-dihydro-1H-isochromen-8-ol
|
|
| SMILES |
CC1=C(CC2OCc3c(O)cccc32)OC(C)=C(C2Cc3cccc(O)c3CO2)O1
|
|
| InChI |
InChI=1S/C24H24O6/c1-13-21(10-22-16-6-4-8-20(26)18(16)12-27-22)29-14(2)24(30-13)23-9-15-5-3-7-19(25)17(15)11-28-23/h3-8,22-23,25-26H,9-12H2,1-2H3
|
|
| InChIKey |
YYOPTRDZRLDXFI-UHFFFAOYSA-N
|
|
| Synonyms |
NA
|
|
| CAS | NA | |
| PubChem CID | NA | |
| ChEMBL ID | NA |
*Note: the IUPAC Name was calculated by STOUT. Reference: PMID:33906675.
Chemical Classification: |
|
|
|---|
——————————————————————————————————————————
NPs Species Source
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
NPs Biological Activity
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
NPs Physi-Chem Properties
| Molecular Weight: | 408.45 | ALogp: | 4.7 |
| HBD: | 2 | HBA: | 6 |
| Rotatable Bonds: | 3 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 77.4 | Aromatic Rings: | 5 |
| Heavy Atoms: | 30 | QED Weighted: | 0.732 |
——————————————————————————————————————————
NPs ADMET Properties*
ADMET: Absorption
| Caco-2 Permeability: | -4.855 | MDCK Permeability: | 0.00001670 |
| Pgp-inhibitor: | 0.3 | Pgp-substrate: | 0.967 |
| Human Intestinal Absorption (HIA): | 0.008 | 20% Bioavailability (F20%): | 0.026 |
| 30% Bioavailability (F30%): | 0.263 |
——————————————————————————————————————————
ADMET: Distribution
| Blood-Brain-Barrier Penetration (BBB): | 0.047 | Plasma Protein Binding (PPB): | 86.06% |
| Volume Distribution (VD): | 0.91 | Fu: | 10.12% |
——————————————————————————————————————————
ADMET: Metabolism
| CYP1A2-inhibitor: | 0.496 | CYP1A2-substrate: | 0.11 |
| CYP2C19-inhibitor: | 0.448 | CYP2C19-substrate: | 0.234 |
| CYP2C9-inhibitor: | 0.264 | CYP2C9-substrate: | 0.187 |
| CYP2D6-inhibitor: | 0.658 | CYP2D6-substrate: | 0.717 |
| CYP3A4-inhibitor: | 0.555 | CYP3A4-substrate: | 0.484 |
——————————————————————————————————————————
ADMET: Excretion
| Clearance (CL): | 11.186 | Half-life (T1/2): | 0.873 |
——————————————————————————————————————————
ADMET: Toxicity
| hERG Blockers: | 0.01 | Human Hepatotoxicity (H-HT): | 0.076 |
| Drug-inuced Liver Injury (DILI): | 0.69 | AMES Toxicity: | 0.751 |
| Rat Oral Acute Toxicity: | 0.413 | Maximum Recommended Daily Dose: | 0.121 |
| Skin Sensitization: | 0.934 | Carcinogencity: | 0.046 |
| Eye Corrosion: | 0.004 | Eye Irritation: | 0.695 |
| Respiratory Toxicity: | 0.189 |
——————————————————————————————————————————
*Note: the ADMET properties was calculated by ADMETlab 2.0. Reference: PMID: 33893803.
Similar Compounds*
Compounds similar to EMNPD with top10 similarity:
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC004565 |  |
0.955 | D0H6QU |  |
0.277 | ||
| ENC004564 |  |
0.703 | D09OQV |  |
0.271 | ||
| ENC004569 |  |
0.402 | D0R6BI |  |
0.229 | ||
| ENC005673 |  |
0.308 | D02TJS |  |
0.227 | ||
| ENC005674 |  |
0.308 | D03DJL |  |
0.226 | ||
| ENC001944 |  |
0.299 | D07MGA |  |
0.225 | ||
| ENC004303 |  |
0.297 | D05AFX |  |
0.224 | ||
| ENC002854 |  |
0.286 | D05MQK |  |
0.223 | ||
| ENC004888 |  |
0.283 | D05HSC |  |
0.223 | ||
| ENC000087 |  |
0.283 | D00JRA |  |
0.220 | ||