NPs Basic Information
|
Name |
(R)-desferri-ferrithiocinmethylester
|
| Molecular Formula | C18H18N2O4S | |
| IUPAC Name* |
2-(4-hydroxyphenyl)ethyl (4R)-2-(3-hydroxypyridin-2-yl)-4-methyl-5H-1,3-thiazole-4-carboxylate
|
|
| SMILES |
C[C@]1(CSC(=N1)C2=C(C=CC=N2)O)C(=O)OCCC3=CC=C(C=C3)O
|
|
| InChI |
InChI=1S/C18H18N2O4S/c1-18(11-25-16(20-18)15-14(22)3-2-9-19-15)17(23)24-10-8-12-4-6-13(21)7-5-12/h2-7,9,21-22H,8,10-11H2,1H3/t18-/m0/s1
|
|
| InChIKey |
MAGHMFIGCXZRQB-SFHVURJKSA-N
|
|
| Synonyms |
(R)-desferri-ferrithiocinmethylester
|
|
| CAS | NA | |
| PubChem CID | 156582643 | |
| ChEMBL ID | NA |
*Note: the IUPAC Name was collected from PubChem.
Chemical Classification: |
|
|
|---|
——————————————————————————————————————————
NPs Species Source
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
NPs Biological Activity
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
NPs Physi-Chem Properties
| Molecular Weight: | 358.4 | ALogp: | 2.8 |
| HBD: | 2 | HBA: | 7 |
| Rotatable Bonds: | 6 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 117.0 | Aromatic Rings: | 3 |
| Heavy Atoms: | 25 | QED Weighted: | 0.797 |
——————————————————————————————————————————
NPs ADMET Properties*
ADMET: Absorption
| Caco-2 Permeability: | -4.749 | MDCK Permeability: | 0.00002120 |
| Pgp-inhibitor: | 0.005 | Pgp-substrate: | 0 |
| Human Intestinal Absorption (HIA): | 0.005 | 20% Bioavailability (F20%): | 0.057 |
| 30% Bioavailability (F30%): | 0.009 |
——————————————————————————————————————————
ADMET: Distribution
| Blood-Brain-Barrier Penetration (BBB): | 0.133 | Plasma Protein Binding (PPB): | 93.06% |
| Volume Distribution (VD): | 0.644 | Fu: | 7.08% |
——————————————————————————————————————————
ADMET: Metabolism
| CYP1A2-inhibitor: | 0.969 | CYP1A2-substrate: | 0.37 |
| CYP2C19-inhibitor: | 0.962 | CYP2C19-substrate: | 0.113 |
| CYP2C9-inhibitor: | 0.91 | CYP2C9-substrate: | 0.943 |
| CYP2D6-inhibitor: | 0.93 | CYP2D6-substrate: | 0.711 |
| CYP3A4-inhibitor: | 0.854 | CYP3A4-substrate: | 0.461 |
——————————————————————————————————————————
ADMET: Excretion
| Clearance (CL): | 12.677 | Half-life (T1/2): | 0.828 |
——————————————————————————————————————————
ADMET: Toxicity
| hERG Blockers: | 0.045 | Human Hepatotoxicity (H-HT): | 0.266 |
| Drug-inuced Liver Injury (DILI): | 0.906 | AMES Toxicity: | 0.032 |
| Rat Oral Acute Toxicity: | 0.046 | Maximum Recommended Daily Dose: | 0.78 |
| Skin Sensitization: | 0.202 | Carcinogencity: | 0.394 |
| Eye Corrosion: | 0.005 | Eye Irritation: | 0.229 |
| Respiratory Toxicity: | 0.164 |
——————————————————————————————————————————
*Note: the ADMET properties was calculated by ADMETlab 2.0. Reference: PMID: 33893803.
Similar Compounds*
Compounds similar to EMNPD with top10 similarity:
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
 |
D0J7RK |  |
0.343 | ||||
|
D00LFB |  |
0.327 | ||||
|
D06KYN |  |
0.320 | ||||
|
D0B3QM |  |
0.301 | ||||
|
D0Q9ON |  |
0.295 | ||||
|
D04XEG |  |
0.294 | ||||
|
D01CRB |  |
0.293 | ||||
|
D0K5ER |  |
0.283 | ||||
|
D0Y2NE |  |
0.283 | ||||
|
D0X6HD |  |
0.281 | ||||