NPs Basic Information
|
Name |
Didymelol C
|
| Molecular Formula | C10H12O4 | |
| IUPAC Name* |
(1S,2R,4R)-1,2,3,4-tetrahydronaphthalene-1,2,4,8-tetrol
|
|
| SMILES |
C1[C@H]([C@H](C2=C([C@@H]1O)C=CC=C2O)O)O
|
|
| InChI |
InChI=1S/C10H12O4/c11-6-3-1-2-5-7(12)4-8(13)10(14)9(5)6/h1-3,7-8,10-14H,4H2/t7-,8-,10-/m1/s1
|
|
| InChIKey |
BOORRODXIRDJFF-NQMVMOMDSA-N
|
|
| Synonyms |
Didymelol C
|
|
| CAS | NA | |
| PubChem CID | 156582509 | |
| ChEMBL ID | NA |
*Note: the IUPAC Name was collected from PubChem.
Chemical Classification: |
|
|
|---|
——————————————————————————————————————————
NPs Species Source
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
NPs Biological Activity
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
NPs Physi-Chem Properties
| Molecular Weight: | 196.2 | ALogp: | -0.6 |
| HBD: | 4 | HBA: | 4 |
| Rotatable Bonds: | 0 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 80.9 | Aromatic Rings: | 2 |
| Heavy Atoms: | 14 | QED Weighted: | 0.49 |
——————————————————————————————————————————
NPs ADMET Properties*
ADMET: Absorption
| Caco-2 Permeability: | -5.201 | MDCK Permeability: | 0.00000391 |
| Pgp-inhibitor: | 0.001 | Pgp-substrate: | 0.944 |
| Human Intestinal Absorption (HIA): | 0.032 | 20% Bioavailability (F20%): | 0.654 |
| 30% Bioavailability (F30%): | 0.99 |
——————————————————————————————————————————
ADMET: Distribution
| Blood-Brain-Barrier Penetration (BBB): | 0.379 | Plasma Protein Binding (PPB): | 23.29% |
| Volume Distribution (VD): | 3.149 | Fu: | 71.14% |
——————————————————————————————————————————
ADMET: Metabolism
| CYP1A2-inhibitor: | 0.041 | CYP1A2-substrate: | 0.073 |
| CYP2C19-inhibitor: | 0.025 | CYP2C19-substrate: | 0.657 |
| CYP2C9-inhibitor: | 0.012 | CYP2C9-substrate: | 0.923 |
| CYP2D6-inhibitor: | 0.006 | CYP2D6-substrate: | 0.24 |
| CYP3A4-inhibitor: | 0.003 | CYP3A4-substrate: | 0.11 |
——————————————————————————————————————————
ADMET: Excretion
| Clearance (CL): | 4.252 | Half-life (T1/2): | 0.669 |
——————————————————————————————————————————
ADMET: Toxicity
| hERG Blockers: | 0.033 | Human Hepatotoxicity (H-HT): | 0.071 |
| Drug-inuced Liver Injury (DILI): | 0.142 | AMES Toxicity: | 0.295 |
| Rat Oral Acute Toxicity: | 0.719 | Maximum Recommended Daily Dose: | 0.959 |
| Skin Sensitization: | 0.731 | Carcinogencity: | 0.041 |
| Eye Corrosion: | 0.005 | Eye Irritation: | 0.833 |
| Respiratory Toxicity: | 0.242 |
——————————————————————————————————————————
*Note: the ADMET properties was calculated by ADMETlab 2.0. Reference: PMID: 33893803.
Similar Compounds*
Compounds similar to EMNPD with top10 similarity:
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC004400 |  |
1.000 | D0Z1FX |  |
0.276 | ||
| ENC004398 |  |
1.000 | D07HBX |  |
0.250 | ||
| ENC005233 |  |
0.810 | D0Z4EI |  |
0.241 | ||
| ENC005234 |  |
0.810 | D05SHK |  |
0.241 | ||
| ENC006108 |  |
0.520 | D06BQU |  |
0.240 | ||
| ENC001083 |  |
0.520 | D0S0LZ |  |
0.232 | ||
| ENC005843 |  |
0.490 | D07HZY |  |
0.231 | ||
| ENC004790 |  |
0.490 | D07MOX |  |
0.228 | ||
| ENC005067 |  |
0.490 | D0I3RO |  |
0.222 | ||
| ENC005104 |  |
0.490 | D03DXN |  |
0.221 | ||