|
Name |
Colletotryptin B
|
Molecular Formula | C21H22N2O3 | |
IUPAC Name* |
(2S,3S)-3-[3-(2-hydroxyethyl)-1H-indol-2-yl]-3-(1H-indol-3-yl)propane-1,2-diol
|
|
SMILES |
C1=CC=C2C(=C1)C(=CN2)[C@@H](C3=C(C4=CC=CC=C4N3)CCO)[C@@H](CO)O
|
|
InChI |
InChI=1S/C21H22N2O3/c24-10-9-15-13-5-2-4-8-18(13)23-21(15)20(19(26)12-25)16-11-22-17-7-3-1-6-14(16)17/h1-8,11,19-20,22-26H,9-10,12H2/t19-,20-/m1/s1
|
|
InChIKey |
GTKKLIYNQCXJMH-WOJBJXKFSA-N
|
|
Synonyms |
Colletotryptin B
|
|
CAS | NA | |
PubChem CID | 156582371 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 350.4 | ALogp: | 2.2 |
HBD: | 5 | HBA: | 3 |
Rotatable Bonds: | 6 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 92.3 | Aromatic Rings: | 4 |
Heavy Atoms: | 26 | QED Weighted: | 0.369 |
Caco-2 Permeability: | -5.032 | MDCK Permeability: | 0.00000524 |
Pgp-inhibitor: | 0.052 | Pgp-substrate: | 0.095 |
Human Intestinal Absorption (HIA): | 0.807 | 20% Bioavailability (F20%): | 0.971 |
30% Bioavailability (F30%): | 0.994 |
Blood-Brain-Barrier Penetration (BBB): | 0.611 | Plasma Protein Binding (PPB): | 89.65% |
Volume Distribution (VD): | 0.981 | Fu: | 6.23% |
CYP1A2-inhibitor: | 0.873 | CYP1A2-substrate: | 0.831 |
CYP2C19-inhibitor: | 0.396 | CYP2C19-substrate: | 0.165 |
CYP2C9-inhibitor: | 0.326 | CYP2C9-substrate: | 0.928 |
CYP2D6-inhibitor: | 0.465 | CYP2D6-substrate: | 0.552 |
CYP3A4-inhibitor: | 0.799 | CYP3A4-substrate: | 0.62 |
Clearance (CL): | 7.077 | Half-life (T1/2): | 0.708 |
hERG Blockers: | 0.068 | Human Hepatotoxicity (H-HT): | 0.269 |
Drug-inuced Liver Injury (DILI): | 0.523 | AMES Toxicity: | 0.064 |
Rat Oral Acute Toxicity: | 0.61 | Maximum Recommended Daily Dose: | 0.585 |
Skin Sensitization: | 0.514 | Carcinogencity: | 0.055 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.063 |
Respiratory Toxicity: | 0.972 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
D0W9LX | 0.358 | ||||||
D0BV3J | 0.349 | ||||||
D04VKS | 0.317 | ||||||
D0E3SH | 0.316 | ||||||
D02TJS | 0.315 | ||||||
D0QV5T | 0.311 | ||||||
D0E3OF | 0.296 | ||||||
D02DMQ | 0.286 | ||||||
D05EJG | 0.286 | ||||||
D0B1FE | 0.284 |