|
Name |
Terreprenphenol A
|
Molecular Formula | C13H16O3 | |
IUPAC Name* |
2-hydroxy-1-[4-hydroxy-3-(3-methylbut-2-enyl)phenyl]ethanone
|
|
SMILES |
CC(=CCC1=C(C=CC(=C1)C(=O)CO)O)C
|
|
InChI |
InChI=1S/C13H16O3/c1-9(2)3-4-10-7-11(13(16)8-14)5-6-12(10)15/h3,5-7,14-15H,4,8H2,1-2H3
|
|
InChIKey |
TXXYIQQHQIBKNQ-UHFFFAOYSA-N
|
|
Synonyms |
Terreprenphenol A
|
|
CAS | NA | |
PubChem CID | 156582148 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 220.26 | ALogp: | 2.5 |
HBD: | 2 | HBA: | 3 |
Rotatable Bonds: | 4 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 57.5 | Aromatic Rings: | 1 |
Heavy Atoms: | 16 | QED Weighted: | 0.606 |
Caco-2 Permeability: | -4.526 | MDCK Permeability: | 0.00001320 |
Pgp-inhibitor: | 0.005 | Pgp-substrate: | 0.011 |
Human Intestinal Absorption (HIA): | 0.006 | 20% Bioavailability (F20%): | 0.347 |
30% Bioavailability (F30%): | 0.054 |
Blood-Brain-Barrier Penetration (BBB): | 0.82 | Plasma Protein Binding (PPB): | 77.84% |
Volume Distribution (VD): | 1.07 | Fu: | 13.37% |
CYP1A2-inhibitor: | 0.791 | CYP1A2-substrate: | 0.129 |
CYP2C19-inhibitor: | 0.24 | CYP2C19-substrate: | 0.102 |
CYP2C9-inhibitor: | 0.102 | CYP2C9-substrate: | 0.483 |
CYP2D6-inhibitor: | 0.44 | CYP2D6-substrate: | 0.393 |
CYP3A4-inhibitor: | 0.072 | CYP3A4-substrate: | 0.221 |
Clearance (CL): | 12.866 | Half-life (T1/2): | 0.916 |
hERG Blockers: | 0.015 | Human Hepatotoxicity (H-HT): | 0.181 |
Drug-inuced Liver Injury (DILI): | 0.574 | AMES Toxicity: | 0.242 |
Rat Oral Acute Toxicity: | 0.217 | Maximum Recommended Daily Dose: | 0.037 |
Skin Sensitization: | 0.512 | Carcinogencity: | 0.231 |
Eye Corrosion: | 0.058 | Eye Irritation: | 0.98 |
Respiratory Toxicity: | 0.521 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC001090 | 0.766 | D0K5CB | 0.313 | ||||
ENC004987 | 0.766 | D02ZJI | 0.313 | ||||
ENC004988 | 0.588 | D0C4YC | 0.309 | ||||
ENC000777 | 0.529 | D0Y6KO | 0.309 | ||||
ENC004157 | 0.422 | D0BA6T | 0.302 | ||||
ENC004300 | 0.420 | D0V9EN | 0.300 | ||||
ENC004350 | 0.417 | D0U0OT | 0.297 | ||||
ENC005298 | 0.414 | D08HVR | 0.290 | ||||
ENC005297 | 0.414 | D0P7JZ | 0.288 | ||||
ENC004195 | 0.403 | D0Q0PR | 0.286 |