|
Name |
Incarxanthone D
|
Molecular Formula | C14H11NO6 | |
IUPAC Name* |
(1R,13R,16R)-1,5,16-trihydroxy-10-oxa-14-azatetracyclo[11.2.1.02,11.04,9]hexadeca-2(11),4,6,8-tetraene-3,15-dione
|
|
SMILES |
C1[C@@H]2[C@H]([C@](C3=C1OC4=CC=CC(=C4C3=O)O)(C(=O)N2)O)O
|
|
InChI |
InChI=1S/C14H11NO6/c16-6-2-1-3-7-9(6)11(17)10-8(21-7)4-5-12(18)14(10,20)13(19)15-5/h1-3,5,12,16,18,20H,4H2,(H,15,19)/t5-,12-,14-/m1/s1
|
|
InChIKey |
QPCOTBRTYCZCGH-DKEGVVEDSA-N
|
|
Synonyms |
Incarxanthone D; CHEMBL4788152
|
|
CAS | NA | |
PubChem CID | 156580926 | |
ChEMBL ID | CHEMBL4788152 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 289.24 | ALogp: | -0.5 |
HBD: | 4 | HBA: | 6 |
Rotatable Bonds: | 0 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 116.0 | Aromatic Rings: | 4 |
Heavy Atoms: | 21 | QED Weighted: | 0.523 |
Caco-2 Permeability: | -5.536 | MDCK Permeability: | 0.00000380 |
Pgp-inhibitor: | 0.002 | Pgp-substrate: | 0.993 |
Human Intestinal Absorption (HIA): | 0.036 | 20% Bioavailability (F20%): | 0.006 |
30% Bioavailability (F30%): | 0.952 |
Blood-Brain-Barrier Penetration (BBB): | 0.281 | Plasma Protein Binding (PPB): | 68.00% |
Volume Distribution (VD): | 1.325 | Fu: | 44.76% |
CYP1A2-inhibitor: | 0.086 | CYP1A2-substrate: | 0.165 |
CYP2C19-inhibitor: | 0.03 | CYP2C19-substrate: | 0.195 |
CYP2C9-inhibitor: | 0.051 | CYP2C9-substrate: | 0.564 |
CYP2D6-inhibitor: | 0.007 | CYP2D6-substrate: | 0.139 |
CYP3A4-inhibitor: | 0.091 | CYP3A4-substrate: | 0.269 |
Clearance (CL): | 1.3 | Half-life (T1/2): | 0.605 |
hERG Blockers: | 0.015 | Human Hepatotoxicity (H-HT): | 0.624 |
Drug-inuced Liver Injury (DILI): | 0.95 | AMES Toxicity: | 0.806 |
Rat Oral Acute Toxicity: | 0.2 | Maximum Recommended Daily Dose: | 0.229 |
Skin Sensitization: | 0.41 | Carcinogencity: | 0.042 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.013 |
Respiratory Toxicity: | 0.108 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC004285 | 0.579 | D0K8KX | 0.269 | ||||
ENC004284 | 0.557 | D0H1AR | 0.268 | ||||
ENC002954 | 0.557 | D0S0LZ | 0.268 | ||||
ENC002671 | 0.493 | D08NQZ | 0.268 | ||||
ENC004286 | 0.481 | D0J2NK | 0.263 | ||||
ENC004138 | 0.463 | D04AIT | 0.247 | ||||
ENC004884 | 0.457 | D07MGA | 0.240 | ||||
ENC002349 | 0.457 | D02NSF | 0.237 | ||||
ENC004823 | 0.433 | D0R9WP | 0.235 | ||||
ENC004887 | 0.385 | D0R6RC | 0.231 |