|
Name |
Trichocarotin E
|
Molecular Formula | C15H26O3 | |
IUPAC Name* |
(1S,2R,3aR,8aS)-1-(2-hydroxypropan-2-yl)-3a,6-dimethyl-2,3,4,7,8,8a-hexahydroazulene-1,2-diol
|
|
SMILES |
CC1=CC[C@@]2(C[C@H]([C@@]([C@H]2CC1)(C(C)(C)O)O)O)C
|
|
InChI |
InChI=1S/C15H26O3/c1-10-5-6-11-14(4,8-7-10)9-12(16)15(11,18)13(2,3)17/h7,11-12,16-18H,5-6,8-9H2,1-4H3/t11-,12+,14+,15-/m0/s1
|
|
InChIKey |
OIQDRCFPGRCOGU-MXYBEHONSA-N
|
|
Synonyms |
Trichocarotin E
|
|
CAS | NA | |
PubChem CID | 148772264 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 254.36 | ALogp: | 1.8 |
HBD: | 3 | HBA: | 3 |
Rotatable Bonds: | 1 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 60.7 | Aromatic Rings: | 2 |
Heavy Atoms: | 18 | QED Weighted: | 0.63 |
Caco-2 Permeability: | -4.503 | MDCK Permeability: | 0.00001350 |
Pgp-inhibitor: | 0.003 | Pgp-substrate: | 0.22 |
Human Intestinal Absorption (HIA): | 0.008 | 20% Bioavailability (F20%): | 0.872 |
30% Bioavailability (F30%): | 0.008 |
Blood-Brain-Barrier Penetration (BBB): | 0.846 | Plasma Protein Binding (PPB): | 84.57% |
Volume Distribution (VD): | 1.08 | Fu: | 19.43% |
CYP1A2-inhibitor: | 0.036 | CYP1A2-substrate: | 0.113 |
CYP2C19-inhibitor: | 0.027 | CYP2C19-substrate: | 0.691 |
CYP2C9-inhibitor: | 0.028 | CYP2C9-substrate: | 0.325 |
CYP2D6-inhibitor: | 0.007 | CYP2D6-substrate: | 0.157 |
CYP3A4-inhibitor: | 0.038 | CYP3A4-substrate: | 0.184 |
Clearance (CL): | 6.828 | Half-life (T1/2): | 0.392 |
hERG Blockers: | 0.025 | Human Hepatotoxicity (H-HT): | 0.171 |
Drug-inuced Liver Injury (DILI): | 0.054 | AMES Toxicity: | 0.01 |
Rat Oral Acute Toxicity: | 0.27 | Maximum Recommended Daily Dose: | 0.176 |
Skin Sensitization: | 0.28 | Carcinogencity: | 0.931 |
Eye Corrosion: | 0.011 | Eye Irritation: | 0.5 |
Respiratory Toxicity: | 0.478 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC003268 | 0.643 | D07QKN | 0.295 | ||||
ENC004620 | 0.508 | D0L2LS | 0.244 | ||||
ENC005118 | 0.484 | D0IT2G | 0.232 | ||||
ENC004313 | 0.470 | D0CW1P | 0.232 | ||||
ENC005115 | 0.469 | D07DVK | 0.232 | ||||
ENC004312 | 0.424 | D0P0HT | 0.227 | ||||
ENC005089 | 0.415 | D0R7JT | 0.224 | ||||
ENC004616 | 0.394 | D04VIS | 0.223 | ||||
ENC004617 | 0.394 | D0FL5V | 0.220 | ||||
ENC000860 | 0.388 | D03BLF | 0.220 |