|
Name |
(3S)-5-(3-hydroxy-5-methylphenoxy)-2,2,7-trimethyl-6-(3-methylbut-2-enyl)-3,4-dihydrochromen-3-ol
|
Molecular Formula | C24H30O4 | |
IUPAC Name* |
(3S)-5-(3-hydroxy-5-methylphenoxy)-2,2,7-trimethyl-6-(3-methylbut-2-enyl)-3,4-dihydrochromen-3-ol
|
|
SMILES |
CC1=CC(=CC(=C1)OC2=C(C(=CC3=C2C[C@@H](C(O3)(C)C)O)C)CC=C(C)C)O
|
|
InChI |
InChI=1S/C24H30O4/c1-14(2)7-8-19-16(4)11-21-20(13-22(26)24(5,6)28-21)23(19)27-18-10-15(3)9-17(25)12-18/h7,9-12,22,25-26H,8,13H2,1-6H3/t22-/m0/s1
|
|
InChIKey |
ZNFWPTJQFCVUHJ-QFIPXVFZSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | 146684097 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 382.5 | ALogp: | 5.8 |
HBD: | 2 | HBA: | 4 |
Rotatable Bonds: | 4 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 58.9 | Aromatic Rings: | 3 |
Heavy Atoms: | 28 | QED Weighted: | 0.674 |
Caco-2 Permeability: | -4.975 | MDCK Permeability: | 0.00001710 |
Pgp-inhibitor: | 0.81 | Pgp-substrate: | 0.712 |
Human Intestinal Absorption (HIA): | 0.03 | 20% Bioavailability (F20%): | 0.999 |
30% Bioavailability (F30%): | 0.833 |
Blood-Brain-Barrier Penetration (BBB): | 0.088 | Plasma Protein Binding (PPB): | 99.27% |
Volume Distribution (VD): | 1.21 | Fu: | 1.65% |
CYP1A2-inhibitor: | 0.347 | CYP1A2-substrate: | 0.39 |
CYP2C19-inhibitor: | 0.619 | CYP2C19-substrate: | 0.296 |
CYP2C9-inhibitor: | 0.471 | CYP2C9-substrate: | 0.918 |
CYP2D6-inhibitor: | 0.51 | CYP2D6-substrate: | 0.75 |
CYP3A4-inhibitor: | 0.365 | CYP3A4-substrate: | 0.401 |
Clearance (CL): | 11.627 | Half-life (T1/2): | 0.251 |
hERG Blockers: | 0.606 | Human Hepatotoxicity (H-HT): | 0.881 |
Drug-inuced Liver Injury (DILI): | 0.029 | AMES Toxicity: | 0.006 |
Rat Oral Acute Toxicity: | 0.431 | Maximum Recommended Daily Dose: | 0.976 |
Skin Sensitization: | 0.663 | Carcinogencity: | 0.17 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.026 |
Respiratory Toxicity: | 0.939 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC002964 | 0.563 | D0Q0PR | 0.266 | ||||
ENC004152 | 0.511 | D0W6DG | 0.252 | ||||
ENC004163 | 0.454 | D0P1FO | 0.250 | ||||
ENC005186 | 0.418 | D07MGA | 0.245 | ||||
ENC002965 | 0.408 | D06RGG | 0.239 | ||||
ENC003317 | 0.408 | D03TPR | 0.239 | ||||
ENC000979 | 0.407 | D0S5CH | 0.235 | ||||
ENC003608 | 0.396 | D03VFL | 0.232 | ||||
ENC002963 | 0.388 | D0L7AS | 0.230 | ||||
ENC002962 | 0.386 | D06XZW | 0.227 |