|
Name |
Leptosphin C
|
Molecular Formula | C20H28O2 | |
IUPAC Name* |
(1S,2S,6R,9S,10S,14S)-2,6,11,11,14-pentamethyltetracyclo[7.6.0.01,6.010,14]pentadec-3-ene-5,12-dione
|
|
SMILES |
C[C@H]1C=CC(=O)[C@]2([C@@]13C[C@]4(CC(=O)C([C@H]4[C@@H]3CC2)(C)C)C)C
|
|
InChI |
InChI=1S/C20H28O2/c1-12-6-7-14(21)19(5)9-8-13-16-17(2,3)15(22)10-18(16,4)11-20(12,13)19/h6-7,12-13,16H,8-11H2,1-5H3/t12-,13-,16+,18+,19-,20-/m0/s1
|
|
InChIKey |
AIOQIQOTKKEQMI-UPTYXGFUSA-N
|
|
Synonyms |
Leptosphin C
|
|
CAS | NA | |
PubChem CID | 146683428 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 300.4 | ALogp: | 3.9 |
HBD: | 0 | HBA: | 2 |
Rotatable Bonds: | 0 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 34.1 | Aromatic Rings: | 4 |
Heavy Atoms: | 22 | QED Weighted: | 0.646 |
Caco-2 Permeability: | -4.966 | MDCK Permeability: | 0.00001580 |
Pgp-inhibitor: | 0.473 | Pgp-substrate: | 0.002 |
Human Intestinal Absorption (HIA): | 0.007 | 20% Bioavailability (F20%): | 0.806 |
30% Bioavailability (F30%): | 0.884 |
Blood-Brain-Barrier Penetration (BBB): | 0.988 | Plasma Protein Binding (PPB): | 70.44% |
Volume Distribution (VD): | 0.769 | Fu: | 24.50% |
CYP1A2-inhibitor: | 0.035 | CYP1A2-substrate: | 0.761 |
CYP2C19-inhibitor: | 0.747 | CYP2C19-substrate: | 0.935 |
CYP2C9-inhibitor: | 0.459 | CYP2C9-substrate: | 0.479 |
CYP2D6-inhibitor: | 0.059 | CYP2D6-substrate: | 0.412 |
CYP3A4-inhibitor: | 0.9 | CYP3A4-substrate: | 0.576 |
Clearance (CL): | 10.568 | Half-life (T1/2): | 0.66 |
hERG Blockers: | 0.015 | Human Hepatotoxicity (H-HT): | 0.349 |
Drug-inuced Liver Injury (DILI): | 0.113 | AMES Toxicity: | 0.02 |
Rat Oral Acute Toxicity: | 0.664 | Maximum Recommended Daily Dose: | 0.043 |
Skin Sensitization: | 0.12 | Carcinogencity: | 0.919 |
Eye Corrosion: | 0.443 | Eye Irritation: | 0.172 |
Respiratory Toxicity: | 0.973 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC002545 | 0.706 | D0P0HT | 0.297 | ||||
ENC002546 | 0.686 | D0H1QY | 0.294 | ||||
ENC005300 | 0.630 | D0D2VS | 0.290 | ||||
ENC002539 | 0.630 | D0D2TN | 0.282 | ||||
ENC002547 | 0.532 | D0F1UL | 0.281 | ||||
ENC003581 | 0.412 | D0L2LS | 0.278 | ||||
ENC003804 | 0.407 | D0IL7L | 0.275 | ||||
ENC002099 | 0.356 | D0C7JF | 0.274 | ||||
ENC004412 | 0.326 | D0I2SD | 0.270 | ||||
ENC003565 | 0.323 | D04GJN | 0.270 |