NPs Basic Information
|
Name |
2'-Aminodechlorogeodoxin
|
| Molecular Formula | C17H15NO8 | |
| IUPAC Name* |
methyl (2R)-2'-amino-5-hydroxy-5'-methoxy-7-methyl-3',4-dioxospiro[1,3-benzodioxine-2,6'-cyclohexa-1,4-diene]-1'-carboxylate
|
|
| SMILES |
CC1=CC(=C2C(=C1)O[C@@]3(C(=CC(=O)C(=C3C(=O)OC)N)OC)OC2=O)O
|
|
| InChI |
InChI=1S/C17H15NO8/c1-7-4-8(19)12-10(5-7)25-17(26-15(12)21)11(23-2)6-9(20)14(18)13(17)16(22)24-3/h4-6,19H,18H2,1-3H3/t17-/m0/s1
|
|
| InChIKey |
ZTAIZVQCSGMCHP-KRWDZBQOSA-N
|
|
| Synonyms |
2'-aminodechlorogeodoxin
|
|
| CAS | NA | |
| PubChem CID | 146683388 | |
| ChEMBL ID | NA |
*Note: the IUPAC Name was collected from PubChem.
Chemical Classification: |
|
|
|---|
——————————————————————————————————————————
NPs Species Source
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
NPs Biological Activity
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
NPs Physi-Chem Properties
| Molecular Weight: | 361.3 | ALogp: | 1.8 |
| HBD: | 2 | HBA: | 9 |
| Rotatable Bonds: | 3 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 134.0 | Aromatic Rings: | 3 |
| Heavy Atoms: | 26 | QED Weighted: | 0.735 |
——————————————————————————————————————————
NPs ADMET Properties*
ADMET: Absorption
| Caco-2 Permeability: | -5.613 | MDCK Permeability: | 0.00007750 |
| Pgp-inhibitor: | 0.015 | Pgp-substrate: | 0.023 |
| Human Intestinal Absorption (HIA): | 0.871 | 20% Bioavailability (F20%): | 0.905 |
| 30% Bioavailability (F30%): | 0.986 |
——————————————————————————————————————————
ADMET: Distribution
| Blood-Brain-Barrier Penetration (BBB): | 0.906 | Plasma Protein Binding (PPB): | 77.88% |
| Volume Distribution (VD): | 1.109 | Fu: | 24.47% |
——————————————————————————————————————————
ADMET: Metabolism
| CYP1A2-inhibitor: | 0.737 | CYP1A2-substrate: | 0.743 |
| CYP2C19-inhibitor: | 0.176 | CYP2C19-substrate: | 0.336 |
| CYP2C9-inhibitor: | 0.245 | CYP2C9-substrate: | 0.077 |
| CYP2D6-inhibitor: | 0.009 | CYP2D6-substrate: | 0.178 |
| CYP3A4-inhibitor: | 0.213 | CYP3A4-substrate: | 0.317 |
——————————————————————————————————————————
ADMET: Excretion
| Clearance (CL): | 4.415 | Half-life (T1/2): | 0.355 |
——————————————————————————————————————————
ADMET: Toxicity
| hERG Blockers: | 0.014 | Human Hepatotoxicity (H-HT): | 0.815 |
| Drug-inuced Liver Injury (DILI): | 0.929 | AMES Toxicity: | 0.945 |
| Rat Oral Acute Toxicity: | 0.739 | Maximum Recommended Daily Dose: | 0.507 |
| Skin Sensitization: | 0.537 | Carcinogencity: | 0.861 |
| Eye Corrosion: | 0.008 | Eye Irritation: | 0.056 |
| Respiratory Toxicity: | 0.887 |
——————————————————————————————————————————
*Note: the ADMET properties was calculated by ADMETlab 2.0. Reference: PMID: 33893803.
Similar Compounds*
Compounds similar to EMNPD with top10 similarity:
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC004116 |  |
0.795 | D0C1SF |  |
0.286 | ||
| ENC003213 |  |
0.663 | D0G4KG |  |
0.255 | ||
| ENC005981 |  |
0.468 | D06GCK |  |
0.252 | ||
| ENC002743 |  |
0.440 | D07MGA |  |
0.248 | ||
| ENC004059 |  |
0.411 | D0L1JW |  |
0.240 | ||
| ENC006072 |  |
0.400 | D0O6KE |  |
0.237 | ||
| ENC003136 |  |
0.400 | D0N1FS |  |
0.233 | ||
| ENC002197 |  |
0.392 | D09DHY |  |
0.230 | ||
| ENC002852 |  |
0.380 | D01XWG |  |
0.227 | ||
| ENC003814 |  |
0.378 | D0G5UB |  |
0.226 | ||