NPs Basic Information
|
Name |
6-(2'S-hydroxy-5'E-ene-1'-heptyl)-4-hydroxy-3-methyl-2H-pyran-2-one
|
| Molecular Formula | C13H18O4 | |
| IUPAC Name* |
4-hydroxy-6-[(E,2S)-2-hydroxyhept-5-enyl]-3-methylpyran-2-one
|
|
| SMILES |
C/C=C/CC[C@@H](CC1=CC(=C(C(=O)O1)C)O)O
|
|
| InChI |
InChI=1S/C13H18O4/c1-3-4-5-6-10(14)7-11-8-12(15)9(2)13(16)17-11/h3-4,8,10,14-15H,5-7H2,1-2H3/b4-3+/t10-/m0/s1
|
|
| InChIKey |
RYNJIMOMAPRLSD-FSIBCCDJSA-N
|
|
| Synonyms |
6-(2'S-hydroxy-5'E-ene-1'-heptyl)-4-hydroxy-3-methyl-2H-pyran-2-one
|
|
| CAS | NA | |
| PubChem CID | 146682578 | |
| ChEMBL ID | NA |
*Note: the IUPAC Name was collected from PubChem.
Chemical Classification: |
|
|
|---|
——————————————————————————————————————————
NPs Species Source
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
NPs Biological Activity
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
NPs Physi-Chem Properties
| Molecular Weight: | 238.28 | ALogp: | 1.9 |
| HBD: | 2 | HBA: | 4 |
| Rotatable Bonds: | 5 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 66.8 | Aromatic Rings: | 1 |
| Heavy Atoms: | 17 | QED Weighted: | 0.773 |
——————————————————————————————————————————
NPs ADMET Properties*
ADMET: Absorption
| Caco-2 Permeability: | -4.7 | MDCK Permeability: | 0.00004530 |
| Pgp-inhibitor: | 0.001 | Pgp-substrate: | 0.824 |
| Human Intestinal Absorption (HIA): | 0.021 | 20% Bioavailability (F20%): | 0.509 |
| 30% Bioavailability (F30%): | 0.997 |
——————————————————————————————————————————
ADMET: Distribution
| Blood-Brain-Barrier Penetration (BBB): | 0.125 | Plasma Protein Binding (PPB): | 96.63% |
| Volume Distribution (VD): | 0.286 | Fu: | 7.33% |
——————————————————————————————————————————
ADMET: Metabolism
| CYP1A2-inhibitor: | 0.118 | CYP1A2-substrate: | 0.832 |
| CYP2C19-inhibitor: | 0.04 | CYP2C19-substrate: | 0.719 |
| CYP2C9-inhibitor: | 0.048 | CYP2C9-substrate: | 0.933 |
| CYP2D6-inhibitor: | 0.01 | CYP2D6-substrate: | 0.611 |
| CYP3A4-inhibitor: | 0.014 | CYP3A4-substrate: | 0.18 |
——————————————————————————————————————————
ADMET: Excretion
| Clearance (CL): | 8.247 | Half-life (T1/2): | 0.815 |
——————————————————————————————————————————
ADMET: Toxicity
| hERG Blockers: | 0.006 | Human Hepatotoxicity (H-HT): | 0.182 |
| Drug-inuced Liver Injury (DILI): | 0.041 | AMES Toxicity: | 0.006 |
| Rat Oral Acute Toxicity: | 0.023 | Maximum Recommended Daily Dose: | 0.816 |
| Skin Sensitization: | 0.767 | Carcinogencity: | 0.619 |
| Eye Corrosion: | 0.092 | Eye Irritation: | 0.584 |
| Respiratory Toxicity: | 0.066 |
——————————————————————————————————————————
*Note: the ADMET properties was calculated by ADMETlab 2.0. Reference: PMID: 33893803.
Similar Compounds*
Compounds similar to EMNPD with top10 similarity:
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC004051 |  |
0.643 | D03LGG |  |
0.216 | ||
| ENC002813 |  |
0.600 | D0U5CE |  |
0.216 | ||
| ENC004049 |  |
0.586 | D02PWM |  |
0.205 | ||
| ENC004559 |  |
0.517 | D0K5CB |  |
0.197 | ||
| ENC004199 |  |
0.509 | D02ZJI |  |
0.197 | ||
| ENC004938 |  |
0.478 | D04KJO |  |
0.196 | ||
| ENC003892 |  |
0.475 | D0D1DI |  |
0.196 | ||
| ENC004625 |  |
0.474 | D0Q1IT |  |
0.196 | ||
| ENC002803 |  |
0.443 | D0L5FY |  |
0.195 | ||
| ENC005393 |  |
0.420 | D0U0OT |  |
0.194 | ||