|
Name |
Divirensol D
|
Molecular Formula | C29H42O9 | |
IUPAC Name* |
(5aS,6R,9S,9aS)-9-hydroxy-9-[[2-(hydroxymethyl)-3-[(1R,6R)-3-(hydroxymethyl)-6-propan-2-ylcyclohex-2-en-1-yl]prop-2-enoyl]oxymethyl]-1-oxo-6-propan-2-yl-3,5a,6,7,8,9a-hexahydro-2-benzoxepine-4-carboxylic acid
|
|
SMILES |
CC(C)[C@H]1CCC(=C[C@@H]1C=C(CO)C(=O)OC[C@@]2(CC[C@@H]([C@@H]3[C@@H]2C(=O)OCC(=C3)C(=O)O)C(C)C)O)CO
|
|
InChI |
InChI=1S/C29H42O9/c1-16(2)22-6-5-18(12-30)9-19(22)10-20(13-31)27(34)38-15-29(36)8-7-23(17(3)4)24-11-21(26(32)33)14-37-28(35)25(24)29/h9-11,16-17,19,22-25,30-31,36H,5-8,12-15H2,1-4H3,(H,32,33)/t19-,22-,23-,24-,25-,29-/m1/s1
|
|
InChIKey |
RCOCBDNPQGVEDL-JSWYNFOLSA-N
|
|
Synonyms |
Divirensol D
|
|
CAS | NA | |
PubChem CID | 145720752 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 534.6 | ALogp: | 2.3 |
HBD: | 4 | HBA: | 9 |
Rotatable Bonds: | 10 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 151.0 | Aromatic Rings: | 3 |
Heavy Atoms: | 38 | QED Weighted: | 0.198 |
Caco-2 Permeability: | -5.712 | MDCK Permeability: | 0.00003870 |
Pgp-inhibitor: | 0.005 | Pgp-substrate: | 0.067 |
Human Intestinal Absorption (HIA): | 0.049 | 20% Bioavailability (F20%): | 0.98 |
30% Bioavailability (F30%): | 0.602 |
Blood-Brain-Barrier Penetration (BBB): | 0.087 | Plasma Protein Binding (PPB): | 88.22% |
Volume Distribution (VD): | 0.6 | Fu: | 5.10% |
CYP1A2-inhibitor: | 0.011 | CYP1A2-substrate: | 0.065 |
CYP2C19-inhibitor: | 0.012 | CYP2C19-substrate: | 0.203 |
CYP2C9-inhibitor: | 0.019 | CYP2C9-substrate: | 0.076 |
CYP2D6-inhibitor: | 0.002 | CYP2D6-substrate: | 0.069 |
CYP3A4-inhibitor: | 0.165 | CYP3A4-substrate: | 0.34 |
Clearance (CL): | 6.189 | Half-life (T1/2): | 0.537 |
hERG Blockers: | 0.022 | Human Hepatotoxicity (H-HT): | 0.677 |
Drug-inuced Liver Injury (DILI): | 0.814 | AMES Toxicity: | 0.017 |
Rat Oral Acute Toxicity: | 0.041 | Maximum Recommended Daily Dose: | 0.928 |
Skin Sensitization: | 0.5 | Carcinogencity: | 0.713 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.03 |
Respiratory Toxicity: | 0.515 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC004002 | 0.562 | D0V2JK | 0.238 | ||||
ENC004012 | 0.526 | D0IL7L | 0.234 | ||||
ENC004011 | 0.514 | D05RXI | 0.233 | ||||
ENC004919 | 0.465 | D0X4RS | 0.230 | ||||
ENC002569 | 0.425 | D09IEE | 0.228 | ||||
ENC003998 | 0.420 | D0D1SG | 0.225 | ||||
ENC004063 | 0.405 | D0IX6I | 0.225 | ||||
ENC004921 | 0.359 | D02CNR | 0.224 | ||||
ENC003589 | 0.358 | D0I5DS | 0.222 | ||||
ENC004062 | 0.358 | D04GJN | 0.221 |